11. Draw all organic products from the following reaction. NaOH • H,0

Q: When the following reaction occurs, which of the following organic products would be obtained? Group…

A:

Q: What functional group would be synthesized through the following reaction? CH,CH,CH, + 2CH,OH a.…

A: Given is reaction of ketone with alcohol.

Q: Determine the product of the reaction: NaOH ut of `NH2 Select one: NH2 OF No reaction OH

A: Given reaction is ester Hydrolysis reaction. Ester on hydrolysis gives corresponding alcohols and…

Q: The synthesis pathway of methyl phenylacetate from the simplest hydrocarbon

A: The simplest hydrocarbon is methane. Chlorination of methane in the presence of light gives methyl…

Q: 63. What is the functional group of the intermediate product in the reaction? A. Ketone B.…

A: The given reaction is the example of oxidation reaction in which a primary alcohol get converted…

Q: nach

A: Given reaction is Sn2 substitution reaction.  Hence we get product with inverted stereochemistry.

Q: NaOH Br

A: Reaction of secondary alkyl halide in the presence of strong base will give elimination as minor…

Q: What is the product of this reaction sequence? A B. 1. Br₂ (xs), NaOH (xs) 2. H₂O* Br CBr3 C. D. ?…

A: Benzene undergo aromatic electrophilic substitution

Q: Explain why metal hydride reduction gives an endo alcohol as the major product in one reaction and…

A: The metal hydride here used is Lithium Aluminum hydride, which is a reducing agent and acts as a…

Q: what is the reaction for getting a carboxylic acid from C10H13BrO?

A: C10H13BrO is chemical compound having Carbon, Hydrogen, Oxygen, Bromine with molecular weight 229.11…

Q: 6) the preparation of hexyl ethanoate from an acid and an alcohol 7) the hydrolysis of methyl…

A: (6) The reaction in which alcohal and acid react and form Ester

Q: e) Draw the structure of a cyclic compound formed in the following reaction. i) NaOEt, ELOH Br i)…

A: i) NaOEt act as a base abstract acidic alpha-proton, forming enolate ion. ii) intramolecular…

Q: which reaction will lead to the formation of sodium benzoate? a) phenol + NaOH b) benzoic acid +…

A: An acid and a base undergoes neutralisation reaction to form salt and water.

Q: 20) What is the major product from the following reaction? + H H 2 eq COOH COOH + 1 eq heat heat…

A:

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: % Yield of the reaction is a measure of reaction efficiency in terms of the amount of product formed…

Q: Which choice does not produce 2-propanol? OH (2-propanol) 1) LIAIH4. Et,0 2) H20 1) MeMgBr, Et,O H.…

A:

Q: Synthesis the compound 4-hydroxybenzoic acid

A: Synthesis of 4-hydroxybenzoic acid -  When benzene is treated with methyl chloride in presence of…

Q: Starting from Benzene prepare each of the following compounds: (a) (b) (с) Br „NH2 Cl (the only…

A: Applying concept of reagents and reaction of organic chemistry.

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: Given Chemical reaction: CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Mass of butanoic…

Q: Heat Draw Your Solution

A: Since, you have asked multiple question, we will solve the first question for you. If you want any…

Q: What do you mean by Michael reaction ?

A: A chemical reaction involves the reaction of the substrate with a reagent under experimental…

Q: Draw the organic products formed in each reaction. [1] NaH (2) Br (1] NANH, [2]

A: The reactions given are,

Q: Write the reagents used to synthesise the following compound starting from the benzoic acid ? CH, OH

A: So we need to convert a carboxylic acid to an amide.

Q: Provide the name of the product after heptanoyl chloride reacts with propan-1-ol under acidic…

A: The product of reaction between heptanoyl chloride and propanol can be predicted by its mechanism

Q: 1.Name and draw the products of each reaction. (a) 1-propanol + hydrobromic acid → H,SO , (b)…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Butylchloride + HI \Pa CH3COONA + NaOH

A: The reaction of butyl chloride with HI/P4 is CH3CH2CH2CH2Cl + HI/P4 --->CH3CH2CH2CH2I + HCl

Q: the Aldehydes or Ketones from an Acetal or OH OH Aldehydes

A: Acetals and hemiacetals are madeup from aldehyde or ketone reacting with Alcohols.

Q: Write reactions of 3-hydroxybutanoic acid with the following reagents: a. HBr; b. NaOH

A:

Q: Hydration of aldehydes and ketones can be catalyzed by acid or base. Bases catalyze hydration by: O…

A: Hydration of aldehyde or ketone can take place in basic medium. Let,       Base =  NaOH ,   it is a…

Q: 7) What is the product of the following reaction? 1) NaOEt, EtOH 2) H', Д -O. Et Et

A:

Q: Write reactions of acetone with the following reagents: a. HCN/OH-

A:

Q: Draw the structure of the major organic products of the reaction.

A: The given reaction is an example of Bromoform reaction in which Acetophenon is converted into a…

Q: 11. What is the major organic product obtained from the following reaction? 2 almo 3

A: Esters are formed when acyl chloride is react with alcohol. • carbonyls get nucleophilic…

Q: Ques- what is the product of the following reaction? CH₂- that рад ether эх у OH (A) 0 € 04 B D D OH…

A:

Q: 6. Which of the following molecules can be oxidized to a carboxylic acid? НО HO- ОН ОН b. ОН d. a.…

A: Since for oxidising the molecules to carboxylic acid we need 2 H at least on the C with OH so that…

Q: Which reagents would you use for the following reaction? OH CI O HCI in water O NAOH in acetonitrile…

A: Nucleophlic substitution reaction is a reaction in which strong nucleophile substitute weak…

Q: Explain why metal hydride reduction gives an endo alcohol as the major product in one reaction and…

A: LiAlH4 is a reducing agent it is used to reduce carbonyl group to alcoholic group.   First reaction…

Q: OH O H.

A: fullscreen

Q: Predict the product or products from the hydroformylation of cyclohexene.

A: Cyclohexene is an alkene having cyclic 6-membered ring structure. Here we have to find out the…

Q: 4. Please distinguish the following compounds using test reactions. HC=CCH2CH3

A: The above compounds can be distinguished by various chemical test.

Q: 10. Explain why aldehydes and ketones are electrophiles. In your discussion use resonance…

A:

Q: Draw the structure of the neutral product formed in the following reaction. C,H,O¯ C,H̟OH +

A:

Q: 1. What is the role of the acetic acid in the oxidation of Cyclohexanol to Cyclohexanone? Write the…

A: Neutralization reaction is the reaction of acid and base to form salt and water. Example: Reaction…

Q: Predict and draw the products or starting material for the following reactions. Only the major…

A: Given are organic reactions.

Q: Explain why metal hydride reduction gives an endo alcohol as the major product in one reaction and…

A: LiAlH4 is a reducing agent it is used to reduce carbonyl group to alcoholic group.   First reaction…

Q: Reaction of bromoethane + KOH ( in alcoholic medium ) forming O ethene O ethane ethyne

A: We need to find which of these hydrocarbon is formed when bromoethane reacts with alcoholic KOH.

Q: 1) 0.9 eq. LDA 2) MegSiCI 3) TICL, 4) H2SO4 H20 ř of oř OH OH QUESTION 9 what is the major product…

A: First LDA abstracts 1° hydrogen from ketone because it is highly stable than 2° hydrogen. Now anion…

Q: Hydration of aldehydes and ketones can be catalyzed by acid or base. Acids catalyze hydration by:…

A: To choose: The correct option for acid catalyzed hydration of aldehyde and ketone by acid.

Q: 1. Draw clear structures for the organic products of the following reactions. NaOEt EHOH b. HNO,…

A: while getting the product, once needs to take care of reagent given. Product of each reaction is…

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".