help Hydration of aldehydes and ketones canbe catalyzed by acid or base. Acidscatalyze hydration by:removing water as the reaction proceedsmaking the carbonyl group moreelectrophilicshifting the equilibrium position of thereaction to favor productsemploying hydronium ion as a nucleophilemaking the carbonyl group lesselectrophilic

To choose: The correct option for acid catalyzed hydration of aldehyde and ketone by acid.

Hydration of aldehydes and ketones can be catalyzed by acid or base. Acids catalyze hydration by: removing water as the reaction proceeds making the carbonyl group more electrophilic O shifting the equilibrium position of the reaction to favor products employing hydronium ion as a nucleophile making the carbonyl group less electrophilic

Hydration of aldehydes and ketones can be catalyzed by acid or base. Acids catalyze hydration by: removing water as the reaction proceeds making the carbonyl group more electrophilic O shifting the equilibrium position of the reaction to favor products employing hydronium ion as a nucleophile making the carbonyl group less electrophilic

Organic Chemistry

9th Edition

ISBN:9781305080485

Author:John E. McMurry

Publisher:John E. McMurry

Chapter19: Aldehydes And Ketones: Nucleophilic Addition Reactions

Section19.SE: Something Extra

Problem 28VC

See similar textbooks

Similar questions

Synthesize the product from the given material. Give the reagents necessary and draw out any intermediate products along the way.
From naphthalene and any other organic or inorganic reagent synthesize the following molecule.
acidity and bascity of carboxylic acids and its derivatives
Consider the structure of cyclobutyne, if it undergoes hydration, which of the following final product is formed? a. Cyclobutane b. Cyclobutanol c. Cyclobutenol d. Cyclobutanone
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?
A problem often encountered in the oxidation of primary alcohols to acids is that esters are sometimes produced as by-products. For example, oxidation of ethanol yields acetic acid and ethyl acetate: Propose a mechanism to account for the formation of ethyl acetate. Take into account the reversible reaction between aldehydes and alcohols:
The following molecule undergoes an intramolecular reaction in the presence of pyrrolidinium acetate, the protonated form of pyrrolidine. Draw the product of this reaction, assuming that a dehydration reaction takes place.
Give the name (common name or IUPAC name) of intermediate product (a) in the following reaction.
Acid hydrolysis of esters produces____ and____?
Explain why methyl trifluoroacetate, CF3CO2CH3, is more reactive than methyl acetate, CH3CO2CH3, in nucleophilic acyl substitution reactions.