-2. Express the equilibrium constant for the following reaction. 16 CH3CI(g) + 8 Cl2(g) → 16 CH2C12(g) + 8 H2(g) [CH2C12]16[H2 ]8 B) K = [CH3CI]16[Cl2]8 [CH2C12][H2] A) K = TCH3CI][Cl2] [CH3C1]16[Cl2]8 C) K = [CH2C12]16[H2]8 D)K= [CH2C22][H2] [CH3CI][Cl2] [CH3CI]1/2[Cl2] E) K = [CH2C12]l/2[H2]

-2. Express the equilibrium constant for the following reaction. 16 CH3CI(g) + 8 Cl2(g) → 16 CH2C12(g) + 8 H2(g) [CH2C12]16[H2 ]8 B) K = [CH3CI]16[Cl2]8 [CH2C12][H2] A) K = TCH3CI][Cl2] [CH3C1]16[Cl2]8 C) K = [CH2C12]16[H2]8 D)K= [CH2C22][H2] [CH3CI][Cl2] [CH3CI]1/2[Cl2] E) K = [CH2C12]l/2[H2]

Appl Of Ms Excel In Analytical Chemistry

2nd Edition

ISBN:9781285686691

Author:Crouch

Publisher:Crouch

Chapter10: Potentiometry And Redox Titrations

Section: Chapter Questions

Problem 5P

See similar textbooks

Related questions

Q: Write the ionic equation for dissolution and the solubility product (Kp) expression for the slightly…

A: To write the ionic equation

Q: What would be the equilibrium constant expression for the following equations? Br2(g) +…

Q: The ΔG°rxn for the reaction: N2(g) + O2(g) 2 NO(g) is +173 kJ/mol at 25 °C. What is the…

Q: CaSO4(s) Ca²+ (aq) + SO² (aq) K = [Ca²+][SO4²-] K = 3.2 x 10-5 R CaSO4(s) Ca²+ (aq) + SO 2 (aq) I(M)…

A: We have to calculate concentration of Ca2+ ion.

Q: Calculate the Ka for lactic acid, HC3H5O3, if in a 1.0000 M solution there is 0.9884 M HC3H5O3 left…

A: We have to predict the equilibrium constant value.

Q: PART 1- Determination of solubility product (Kp) of different salts Table 1 - Solubility of Ag:SO4…

A: The balanced chemical equation for the solubility of Ag2SO4 is Ag2SO4(s)+H2O(s)…

Q: Write an expression for the equilibrium constant for this reaction. a) Zn2+(aq) + 2NH3(aq) ↔…

A: a) Zn2+(aq) + 2NH3(aq) ⇌ Zn(NH3)2+(aq) Equilibrium constant: K = Zn(NH3)2+Zn2+.NH32 b)…

Q: What is the equilibrium constant expression for the following reaction? 2N2O(g) + 4H2O(l) ⇌…

A: The given chemical reaction is as equilibrium and the reaction is as follows: 2N2O(g) + 4H2O(l) ⇌…

Q: Acetic acid: ka = 1.75x105 Ammonia: ko = 1.8x105. Hydrofluoric acid: 7.2 x104 Hydrogen sulfide: kal…

A: Since you have asked multiple questions we will answer the first one for you. To get the remaining…

Q: 1) O2 + 4NO2 2N2O5 K= 3.5 x 10° What concentration of N2O5 would be in equilibrium with 0.55M O2 and…

A: Nitrogen dioxide reacts with oxygen to form dinitrogen pentaoxide. The equilibrium reaction is as…

Q: Express the equilibrium constant for the following reaction: 2 CH2CI2 (9) + Clz (9) 32 СHC\з + H2 ()…

A: Equilibrium constant (k) expression:

Q: 2. Consider the following equilibrium: Br2(1) + H20(1) = 2H*(aq) + Br(aq) + BrO (aq) Write the Kc…

A: The state of reversible where the rate of forward and reverse reaction becomes equal is known as…

Q: In the gas phase, methyl isocyanate (CH3NC) isomerizes to acetonitrile (CH3CN), H3C-N-C (g) H3C-C-N…

A: Temperature Dependence of the Equilibrium Constant: For a gaseous reaction the relation between…

Q: What is the solubility-product expression for La(IO3)3 (s)? a. Ksp = [La3+] [IO3-]1/3 b. Ksp =…

Q: Consider the reaction:PCl3(g) + Cl2(g) <----> PCl5(g) Write the equilibrium constant for this…

A: Given:

Q: Calculate the concentration of [Ag(S2O3)2]3- in a solution which contains 8.5E-6 M Ag+ ions and…

Q: Calculate the molar solubility of zinc carbonate in ZnCO3(s) Zn2+(aq) + CO32-(aq)…

Q: The equilibrium constant for the reaction2 NO(g) + Br2(g) ⇌ 2 NOBr(g)is Kc = 1.3 x 10-2 at 1000 K.…

Q: NiCO3 (s) ---> Ni^2+(aq) + CO3^2-(aq) K1 = 6.6 x 10^-9 HCO3^-(aq) + H2O(ℓ) CO3^2-(aq)…

Q: What is the equilibrium constant for equilibrium 2H2(g) + O2(g) 2H2O(l)

A: The equilibrium reaction for the formation of water is given. That is, 2H2 + O2 --------> 2H2O

Q: .

A: Equillibrium constant is the ratio of concentaration of products to the concentration of reactants.

Q: What is the solubility product constant, Ksp? [Ag+] = 2.30 x 10-4 M [CO3-] = 1.15 x 10-4 M Ksp = [ ?…

Q: 3) Based on the information below, determine the value of the unknown equilibrium constant, Kc. 4…

A: The given data is as follows: 4CO2(g) + 2H2O(g) → 4O2(g) + 2CH2CO(g) Kc'=3.7×1017…

Q: What is the solubility product expression for Ca5(PO4)3(Cl)?

A: For the given expression Initially we are drafting dissociation equation and from that Ksp is found…

Q: 13.0 mL of 0.19 M MgCl2 are mixed with 21.9 mL of 0.54 M NaOH, what will be the final concentration…

Q: The solubility product of CaS04 is 10-4 .5. What is the solubility of Ca2 + at equilibrium with…

A: Solubility product of CaSO4 is 10-4 We have to find solubility of Ca2+

Q: Consider the reaction of NH3 and I2 to give N2 and HI. 2NH3(g)+3I2(g)−⇀↽−N2(g)+6HI(g)K Using two or…

A: Given Chemical equation:

Q: Both glucose (corn sugar) and fructose (fruit sugar) taste sweet, but fructose tastes sweeter. Each…

A: In first experimentInitial concentration of glucose = 0.2564 MFinal concentration of fructose =…

Q: Consider the following solubility product constants (Ksp). Which compound will be the most soluble?…

A: Introduction : Solubility product constant or ksp can be defined as the product of the soluble ions…

Q: Solid Cag(PO4)2 is added to a solution of 0.080 M Na3PO4 and the system is allowed to come to…

A: Na3PO4 is a strong electrolyte and hence will dissociate completely into Na+ and PO43–. The…

Q: What is the equilibrium constant expression for the following reaction? (Pay careful attention to…

A: The equilibrium reaction given is, => 2 HCl (g) + Mg(OH)2 (s) ⇔ MgCl2 (aq) + 2 H2O (l)

Q: hydroxide solution is combined with 22.0 mL of a 8.53×10-4 M nickel(II) fluoride solution does a…

Q: Given the following solubility equilibrium, BaC2O4(s)Ba^2+(aq)+ C₂O4^2-(aq) Kps= 2.3 x10^-8…

A: In this question we have to tell the molar solubility of compound BaC2CO4.

Q: Use the data shown here to find the equilibrium constant (Kc) for the reaction A( g)Δ2 B( g) + C(…

Q: Write the expression for the equilibrium constant for the following reaction. 2 CH3CI(g) + Cl2 (9) =…

A: Equilibrium Constant: Equilibrium Constant is written as the ratio of product and reactant…

Q: Calculate the value of the equilibrium constant, Kc , for the reaction Q(g)+X(g)↽−−⇀2M(g)+N(g)…

A: the value of the equilibrium constant, Kc , for the reaction Q(g)+X(g)↽−−⇀2M(g)+N(g)........(0)…

Q: solubility of silver chloride is 1.3 x 10-5 mol L-1. What is the Ksp for silver chloride at 25 °C?

A: Given solubility of AgCl = 1.3 x 10-5 mol L-1 Ksp = ?

Q: What is the concentration of [Ag(S2O3)2]3- in a solution which contains 7.5 x 10-7 M Ag+ ions and…

A: Complete balanced equation = Ag+(aq.) + 2S2O32-(aq.) → [Ag(S2O3)2]3- (aq.) Given in the…

Q: Find the pH of the solution containing 0.0004 M H3PO4 without neglecting it. (Ka1= 7x10-3, Ka2=…

Q: The solubility product expression for La2(CO3)3 is Ksp = __. a) [La3+]3[CO32-]2 b) [La2+]3[CO32-]2…

Q: A. Determine the value of the equilibrium constant, Kgoal for the reaction…

A: Since you have asked multiple question, we will solve the first question for you as per our…

Q: What concentration of SO is in equilibrium with Ag, SO, (s) and 5.10 x 10-3 M Ag+? The Ksp of Ag,…

A: Given: [Ag+] = 5.10 x 10-3 M KSp of Ag2SO3 = 1.50 x 10-14 So we have to determine concentration of…

Q: the equilibrium constant for the authorization of water at 25°C is 1.00 X 10^-14…

Q: Part A Determine the value of the equilibrium constant, Kal. for the reaction CO2(g) = C(s) + 02(g).…

Q: Acetic acid: ka= 1.75x10$ Ammonia: ko = 1.8x10-5. Hydrofluoric acid: 7.2 x10 + Hydrogen sulfide: kai…

A: We are authorised to solve only one question at a time. Please post rest of the questions…

Q: Part 1 out of 4 (a) Write equilibrium constant expressions for Kc for the following process.…

A: Writing equilibrium constant expression (Kc) for the given reaction .

Q: Express the equilibrium constant for the following reaction. N2(8) + 3 H2(g) = 2 NH3(8). Select one:…

A: Equilibrium constant: The equilibrium constant for a general reaction is defined as the ratio of…

Q: 10) When reaction (1) and (2) below are added together, the result is reaction (3). 1) H200)…

Q: Assuming the equilibrium constants at 200°C for the following reactions are given below, NH4"(aq) +…

Question

Express the equilibrium constant for the following reaction.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is the law of mass action? Is it true that the value of K depends on the amounts of reactants and products mixed together initially? Explain. Is it true that reactions with large equilibrium constant values are very fast? Explain. There is only one value of the equilibrium constant for a particular system at a particular temperature, but there is an infinite number of equilibrium positions. Explain.
Initially 3.0 mol of nitrosyl bromide, NOBr, is placed in a 5.0 L container and allowed to come to equilibrium at 25°C. If the nitrosyl bromide is 12% dissociated, calculate Kc. 2 NOBr(g) ⇌ 2 NO(g) + Br2(g) Kc should equal 6.7 x 10-4
Express the equilibrium constant for this reaction: N2(g) + 3 H2(g) <=> 2 NH3(g) K = [NH3]2 / ([NH3]2 x [N2]) K = ([NH3]2 x [N2]) / [H2]3 K = ([N2] x [H2]3) / [NH3]2
If the equilibrium constants for the two reactions 2 HCl(g)  H2(g) + Cl2(g) K1 = 4.36x10-2 and I2(g) + Cl2(g)  2 ICl(g) K2 = 8.92x10-6 are denoted K1 and K2 respectively, then the equilibrium constant, K3, for the reaction below is 2 HCl(g) + I2(g)  2 ICl(g) + H2(g) K3= ?
3) Based on the information below, determine the value of the unknown equilibrium constant, Kc. 4 CO2 (g) + 2 H2O (g) « 4 O2 (g) + 2 CH2CO (g)Kc = 3.7 x 1017 CO2 (g) + 2 H2O (g) « CH4 (g) + 2 O2 (g)Kc = 8.3 x 10-15 CH4 (g) + CO2 (g) « CH2CO (g) + H2O (g)Kc = ?
A. Determine the value of the equilibrium constant, Kgoal for the reaction CO2(g)⇌C(s)+O2(g)CO2(g)⇌C(s)+O2(g), Kgoal=? by making use of the following information: 1. 2CO2(g)+2H2O(l)⇌CH3COOH(l)+2O2(g)2CO2(g)+2H2O(l)⇌CH3COOH(l)+2O2(g), K1 = K1 = 5.40×10−165.40×10−16 2. 2H2(g)+O2(g)⇌2H2O(l)2H2(g)+O2(g)⇌2H2O(l), K2 = K2 = 1.06×10101.06×1010 3. CH3COOH(l)⇌2C(s)+2H2(g)+O2(g)CH3COOH(l)⇌2C(s)+2H2(g)+O2(g), K3 = K3 = 2.68×10−92.68×10−9 Express your answer numerically. B. Determine the equilibrium constant, Kgoal for the reaction 4PCl5(g)⇌P4(s)+10Cl2(g), Kgoal=?4PCl5(g)⇌P4(s)+10Cl2(g), Kgoal=? by making use of the following information: P4(s)+6Cl2(g)⇌4PCl3(g), K1=2.00×1019P4(s)+6Cl2(g)⇌4PCl3(g), K1=2.00×1019 PCl5(g)⇌PCl3(g)+Cl2(g), K2=1.13×10−2PCl5(g)⇌PCl3(g)+Cl2(g), K2=1.13×10−2 Express your answer numerically.
PbCrO4 is a common pigment called chrome yellow (or school bus yellow). It has a solubility of 1.71 x 10-4 g/L. The solubility product of PbCrO4, Ksp = ________. Enter the result in scientific notation to 1 decimal. e.g. enter 5.6x10-5 as 5.6E-5.
What would be the equilibrium constant expression for the following equations? Br2(g) + CH4(g) ⇌ HBr(g) + CBr4(g) Fe(s) + H2O(g) ⇌ Fe3O4(s) + H2(g)
Write the correct equilibrium constant for the following reaction. 1.) C2H2(g) + 2H2(g) C2H6(g) 2.) 4NH3(g) + 5O2(g) 4NO(g) + 6H2O(g) 3.) 4HCl(g) + O2(g) H2O(l) + 2CL2(g)
2) Based on the information below, determine the value of the unknown equilibrium constant, Kc. 2 NOCl (g) « 2 NO (g) + Cl2 (g)Kc = 2.4 x 10-7 1/3 Cl2 (g) + 2/3 NO (g) « 2/3 NOCl (g)Kc = ?
Write the equilibrium constant expression (Kc) for the reaction below 2P2O5(g) + 10Cl2(g) ⇌ 4PCl5(aq) + 5O2(g)
The equilibrium constant for the reaction2 NO(g) + Br2(g) ⇌ 2 NOBr(g)is Kc = 1.3 x 10-2 at 1000 K. (a) At this temperature doesthe equilibrium favor NO and Br2, or does it favor NOBr?(b) Calculate Kc for 2 NOBr(g)⇌ 2 NO(g) + Br2(g).(c) Calculate Kc for NOBr(g)⇌ NO(g) + 1/2 Br2(g).