2. What is the molar mass of a gas if it diffuses 0.907 times the speed of argon gas? 1. (a) What is the ratio of diffusion of (CH,) and Hydrogen Chloride (HCI)? (b) 5. What is the molecular weight of a gas which diffuses 1/50 as fast as hydrogen? Show calculations and box the final answer. Which will diffuse faster? (c) How much faster? 3. If the density of hydrogen is 0.090 g/L and its rate of diffusion is 6 times that of chlorine, what is the density of chlorine? A Heis found to diffuse 1.25 times faster than Gas Y. What is the molecular weight of Gas Y?

2. What is the molar mass of a gas if it diffuses 0.907 times the speed of argon gas? 1. (a) What is the ratio of diffusion of (CH,) and Hydrogen Chloride (HCI)? (b) 5. What is the molecular weight of a gas which diffuses 1/50 as fast as hydrogen? Show calculations and box the final answer. Which will diffuse faster? (c) How much faster? 3. If the density of hydrogen is 0.090 g/L and its rate of diffusion is 6 times that of chlorine, what is the density of chlorine? A Heis found to diffuse 1.25 times faster than Gas Y. What is the molecular weight of Gas Y?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter5: Gases

Section: Chapter Questions

Problem 147AE: An organic compound contains C, H, N, and O. Combustion of 0.1023 g of the compound in excess oxygen...

See similar textbooks

Similar questions

54 One way to generate oxygen is to heat potassium chlorate, KClO3. (The other product is potassium chloride.) If 386 mL of oxygen at 41 C and 97.8 kPa is generated by this reaction, what is the minimum mass of KClO3used?
Helium gas, He, at 22C and 1.00 atm occupied a vessel whose volume was 2.54 L. What volume would this gas occupy if it were cooled to liquid-nitrogen temperature (197C)?
One method of analyzing amino acids is the van Slyke method. The characteristic amino groups (NH2) in protein material are allowed to react with nitrous acid. HNO2, to form N2 gas. From the volume of the gas, the amount of amino acid can be determined. A 0.0604-g sample of a biological sample containing glycine, CH2(NH2)COOH, was analyzed by the van Slyke method and yielded 3.70 mL of N2 collected over water at a pressure of 735 torr and 29 C. What was the percentage of glycine in the sample? CH2(NH2)CO2H+HNO2CH2(OH)CO2H+H2O+N2
When hydrogen peroxide decomposes, oxygen is produced: 2H2O2(aq)2H2O+O2(g)What volume of oxygen gas at 25C and 1.00 atm is produced from the decomposition of 25.00 mL of a 30.0% (by mass) solution of hydrogen peroxide (d=1.05g/mL)?
What volume, in milliliters, of hydrogen gas at 1.33 atm and 33 C is produced by the reaction of 0.0223 g lithium metal with excess water? The other product is LiOH.
A typical barometric pressure in Kansas City is 740 torr. What is this pressure in atmospheres, in millimeters of mercury, and in kilopascals?
5.26 How many moles of an ideal gas are there if the volume of the gas is 158 L at 14°C and a pressure of 89 kPa?
Before small batteries were available, carbide lamps were used for bicycle lights. Acetylene gas. C2H2, and solid calcium hydroxide were formed by the reaction of calcium carbide, CaC2. with water. The ignition of the acetylene gas provided the light. Currently, the same lamps are used by some cavers, and calcium carbide is used to produce acetylene for carbide cannons. (a) Outline the steps necessary to answer the following question: What volume of C2H2 at 1.005 atm and 12.2 C is formed by the reaction of 15.48 g of CaC2 with water? (b) Answer the question.
Ammonium nitrate can be used as an effective explosive because it decomposes into a large number of gaseous products. At a sufficiently high temperature, ammonium nitrate decomposes into nitrogen, oxygen, and steam. (a) Write a balanced net ionic equation for the decomposition of ammonium nitrate. (b) If 2.00 kg of ammonium nitrate are sealed in a 50.0-L steel drum and heated to 745C, what is the resulting pressure in the drum after decomposition? (Assume 100% decomposition.)
perform stoichiometric ca1cu1uions for reactions involving gases as reactants or products.
An organic compound contains C, H, N, and O. Combustion of 0.1023 g of the compound in excess oxygen yielded 0.2766 g CO2 and 0.0991 g H2O. A sample of 0.4831 g of the compound was analyzed for nitrogen by the Dumas method (see Exercise 129). At STP, 27.6 mL of dry N2 was obtained. In a third experiment, the density of the compound as a gas was found to be 4.02 g/L at 127C and 256 torr. What are the empirical and molecular formulas of the compound?
Ethanol, C2H5OH, is produced industrially from ethylene, C2H4, by the following sequence of reactions: 3C2H4+2H2SO4C2H5HSO4+( C 2 H 5)2SO4C2H5HSO4+( C 2 H 5)2SO4+3H2O3C2H5OH+2H2SO4 What volume of ethylene at STP is required to produce 1.000 metric ton (1000 kg) of ethanol if the overall yield of ethanol is 90.1%?