< >Q SearchCloseActivityChat29TeamsFrom the given information below, which expression gives the correct value in determining thestandard enthalpy change of combustion for liquid benzene (C6H6) in KJ/mole? * .AssignmentsDelta H of formation of Oxygen gas is zero.CalendarConsider the following information.CallsCompoundCH(1)CO(g)H,O(1)FilesAH / kJ mol+394+49-286CÇHe(1) + 702(g)→ 6CO,(g) + H0(1)12(-394) + (-286) + 2(49)12(394) + 6(286) – 2(-49)6(-394) + 3(286) – (-49)6(394) + 3(286) – (-49)00Apps(?Help>>1:57 PMDesktop12/13/2021

Answered: Image /qna-images/answer/878ec042-44e7-4234-b56c-02759fd9fb09.jpg

29 From the given information below, which expression gives the correct value in determining the standard enthalpy change of combustion for liquid benzene (C6H6) in KJ/mole? * A Delta H of formation of Oxygen gas is zero. Consider the following information. Compound CH(1) CO,(g) H,O(1) AH /kJ mol +394 -286 +49 CH(1) + 70;(g) → 6CO(g) + H,O(1) O 12(-394) + (-286) + 2(49) O 12(394) + 6(286) - 2(-49) O 6(-394) + 3(286) - (-49) O 6(394) + 3(286) - (-49)

29 From the given information below, which expression gives the correct value in determining the standard enthalpy change of combustion for liquid benzene (C6H6) in KJ/mole? * A Delta H of formation of Oxygen gas is zero. Consider the following information. Compound CH(1) CO,(g) H,O(1) AH /kJ mol +394 -286 +49 CH(1) + 70;(g) → 6CO(g) + H,O(1) O 12(-394) + (-286) + 2(49) O 12(394) + 6(286) - 2(-49) O 6(-394) + 3(286) - (-49) O 6(394) + 3(286) - (-49)

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter7: Chemical Energy

Section: Chapter Questions

Problem 61E: A coffee-cup calorimeter initially contains 125 g water at 24.2C. Potassium bromide (10.5 g), also...

See similar textbooks

Similar questions

When 1.0 g of fructose, C6H12O6(s), a sugar commonly found in fruits, is burned in oxygen in a bomb calorimeter, the temperature of the calorimeter increases by 1.58 C. If the heat capacity of the calorimeter and its contents is 9.90 kJ/C, what is q for this combustion?
Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
In a coffee-cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M HCI are mixed. Both solutions were originally at 24.6C. After the reaction, the final temperature is 31.3C. Assuming that all the solutions have a density of 1.0 g/cm3 and a specific heat capacity of 4.18 J/Cg, calculate the enthalpy change for the neutralization of HCl by NaOH. Assume that no heat is lost to the surroundings or to the calorimeter.
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
When 50.0 g of 0.200 M NaCl(aq) at 24.1 C is added to 100.0 g of 0.100 M AgNO3(aq) at 24.1 C in a calorimeter, the temperature increases to 25.2 C as AgCl(s) forms. Assuming the specific heat of the solution and products is 4.20 J/g C, calculate the approximate amount of heat in joules produced.
In earlier times, ethyl ether was commonly used as an anesthetic. It is, however, highly flammable. When five milliliters of ethyl ether, C4H10O(l)(d=0.714g/mL), are burned in a bomb calorimeter, the temperature rises from 23.5C to 39.7C. The calorimeter contains 1.200 kg of water and has a heat capacity of 5.32 kJ/C. (a) What is qH2o? (b) What is qcal? (c) What is q for the combustion of 5.00 mL of ethyl ether? (d) What is q for the combustion of one mole of ethyl ether?
The reaction SO3(g)+H2O(l)H2SO4(aq) is the last step in the commercial production of sulfuric acid. The enthalpy change for this reaction is 227 kJ. In designing a sulfuric acid plant, is it necessary to provide for heating or cooling of the reaction mixture? Explain.
9.50 When a 13.0-g sample of NaOH(s) dissolves in 400.0 mL of water in a coffee cup calorimeter, the temperature of the water changes from 22.6°C to 30.7C Assuming that the specific heat capacity of the solution is the same as for water, calculate (a) the heat transfer from system to surroundings and (b) H for the reaction NaOH(s)Na+(aq)+OH(aq)
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
Ethanol, C2H5OH, is used as a fuel for motor vehicles, particularly in Brazil. (a) Write the balanced equation for the combustion of ethanol to CO2(g) and H2O(g), and, using the data in Appendix G, calculate the enthalpy of combustion of 1 mole of ethanol. (b) The density of ethanol is 0.7893 g/mL. Calculate the enthalpy of combustion of exactly 1 L of ethanol. (c) Assuming that an automobile’s mileage is directly proportional to the heat of combustion of the fuel, calculate how much farther an automobile could be expected to travel on 1 L of gasoline than on 1 L of ethanol. Assume that gasoline has the heat of combustion and the density of n—octane, C8H18(Hf=208.4kJ/mol;density=0.7025g/mL).
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.