25. The standard molar enthalpy of formation of glucose, C,H12Os), is -1274.4 kJ/mol. a) Is the formation of glucose from its elements exothermic or endothermic? b) Write a balanced equation depicting the formation of glucose from its elements and for which the enthalpy of reaction is -1274.4 kJ.

25. The standard molar enthalpy of formation of glucose, C,H12Os), is -1274.4 kJ/mol. a) Is the formation of glucose from its elements exothermic or endothermic? b) Write a balanced equation depicting the formation of glucose from its elements and for which the enthalpy of reaction is -1274.4 kJ.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter7: Chemical Energy

Section: Chapter Questions

Problem 15Q: The enthalpy change for the reaction CH4(g)+2O2(g)CO2(g)+2H2O(l) is 891 kJ for the reaction as...

See similar textbooks

Related questions

Q: 2. A 7.35 g sample of quinone (C6H4O2) is burned in a bomb calorimeter whose total heat capacity is…

A: 2. Given that, 7.35 g of sample of quinone (C6H4O2) is burned in a bomb calorimeter. The heat…

Q: 5.62 Write the equation for calculating the enthalpy of a reaction. Define all the terms.

A: The equation for calculating the enthalpy of a reaction has to be given and all the terms have to…

Q: (a) Elemental boron reacts with fluorine to form BF3, a gas. Write a balanced chemical equation for…

A: (a) Elemental boron react with fluorine to form BF3 , which is a gas. The reaction equation is ,…

Q: If ΔHr for the following reaction is -36.40 kJ/mol, a) what is the enthalpy of formation of HBr(g)?…

A: a. The enthalpy of the reaction can be related to enthalpy of formation of the involved species as:…

Q: C 2H 5OH() + 30 2( g)→ 2CO 2( g) + 3H 20( ) AH=-1.37 x 10 3 kJ I. The reaction is endothermic II.…

A: Exothermic reaction is the reaction in which energy is released in the formation of products while…

Q: Lightweight camping stoves typically use a mixture of Cs and C6 hydrocarbons, which is called white…

A: Molecular mass of C5H12 = 72.15g/mol Enthalpy of combustion = -3550kJ/mol Volume of water = 1.5L Ti…

Q: The standard heat of formation, ΔH∘fΔHf∘, is defined as the enthalpy change for the formation of one…

A: The given reaction is, C2H4(g) + 3O2(g) → 2CO2(g) + 2H2O(g) The heat of formation values given by…

Q: A 0.3423 g sample of pentane, C5H12. was burned in a bomb calorimeter. The temperature of the…

Q: A scientist measures the standard enthalpy change for the following reaction to be -111.2 kJ :…

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction? CO(g) +…

Q: A scientist measures the standard enthalpy change for the following reaction to be -820.7 kJ…

Q: The principal component of LPG is butane, C4H10(g). If combustion of 1 mole of butane produces 126…

Q: 3. A 1.25-g sample of ammonium nitrate dissolves in water to make 35.0 mL of solution in an…

A: Given, Mass of NH4NO3 = 1.25 g Volume of the solution = 35.0 mL Initial temperature= Ti = 24.6 0C…

Q: Propane (C3H8) burns according to the following balanced equation: C3H8(g)+5O2(g)→3CO2(g)+4H2O(g)…

A: The given combustion reaction is given below : C3H8(g) + 5O2(g) → 3CO2(g) + 4H2O(g) Given…

Q: According to the following thermochemical equation, what mass of HF (in g) must react in order to…

A: The given reaction is, SiO2s+4HFg→SiF4g+2H2Ol

Q: Many portable gas heater and grills use propane as a fuel. Using standard enthalpies of formation,…

A: Thermodynamic is the branch of chemistry that mainly deals with the heat transfer between system and…

Q: For which of the following reactions is ΔH∘rxnΔHrxn∘ equal to ΔH∘fΔHf∘ of the product(s)?You do not…

Q: 1. Calculate the value of ΔE in joules for a system that loses 50 J of heat and has 150 J of work…

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub- parts for…

Q: Why do we measure the enthalpy of a chemical reaction?

A: A thermodynamic property of a system is known as enthalpy. The sum of internal energy and product of…

Q: (a) Consider the hypothetical element X. XO reacts with hydrogen gas to form XH;OH. Calculate the…

A: Here we have to find out the enthalpy of the reaction of XO with the hydrogen gas to form XH3OH. XO…

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction?…

A: Given reaction:

Q: Many portable gas heaters and grills use propane, C3H8(g). Using enthalpies of formation, calculate…

A: C3H8+5O2(g)→3CO2(g)+4H2O(l) ∆H°rxn=?Known values:-∆H°fCO2=-393.3 KJmol∆H°fH2O…

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction? CO(g) +…

Q: The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore.…

A: The balanced reaction is as follows - 2PbS(s) + 3O2(g) ---> 2SO2(g) + 2PbO(s) The standard…

Q: 49. When 2.50 g of methane burns in oxygen, 125 kJ of heat is produced. What is the enthalpy of…

Q: The work done when a gas is compressed in a cylinder is 455 J. During this process, there is a heat…

A: To find the energy change, we need to use the formula which contains change in energy, work done and…

Q: combustion for each of the gases and then balance. Are these reactions endothermic or exothermic?…

A: Hydrocarbons burns in presence of air to give CO2 and water. C3H8 + 5O2 -> 3CO2 + 4H2O + heat…

Q: What is the definition of enthalpy? O a. Heat flow in a chemical reaction at constant temperature O…

A: Enthalpy is Heat flow in a chemical reaction at constant pressure.

Q: How much heat is produced when 6.26 g of zinc metal reacts with oxygen gas under standard…

A: Given, 2Zn(s) + O2(g) → 2ZnO(s) Standard enthalpy of formation of species are; Species…

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction?…

A: Enthalpy change of a reaction is calculated by subtracting the sum of enthalpies of formation of…

Q: A scientist measures the standard enthalpy change for the following reaction to be -901.8 k) :…

A: Given, the standard enthalpy change for this reaction = -901.8 kJ We have to calculate the standard…

Q: When 10.00 g of phosphorus is burned in O2( g) to form P4O10(s), enough heat is generated to raise…

A: Given; M = 10.0 g c = 4.2jgC ∆T = (38-18)oC

Q: Many cigarette lighters contain liquid butane, C4H10(l), which has a ∆Hƒ = -147.6 kJ/mol. Burned in…

A: Given,*…

Q: 1. 25 g of sodium (Na) is put into 200 mL of water. The reaction between the two produces sodium…

A: Enthalpy change calculated As heat chage(q) of the system.

Q: 1. Why is it necessary to indicate the physical state of all reactants and products when giving the…

A: Enthalpy change of the reaction (ΔHrxn) is the amount of energy change during a chemical reaction.

Q: Consider the hypothetical thermochemical equation 3 A + B → 2 C for which ΔH = 63.1 kJ/mol. If the…

A: 3A + B -> 2C

Q: Soapstone is a type of metamorphic rock that is used as an ice alternative to cool drinks without…

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction? CO(g) +…

Q: 19. The combustion of hydrogen-oxygen mixtures is used to produce very high temperatures (approxi-…

A: Given,

Q: A scientist measures the standard enthalpy change for the following reaction to be -67.6 kJ :…

A: The expression for the calculation of change in enthalpy is shown below: where; ∆Hproducts =…

Q: What is the working definition of enthalpy change? A) The change in energy that occurs when…

A: Enthalpy change (∆H) is a state function.

Q: What is meant by the term enthalpy of formation?

A: Thermodynamics is related to the flow of heat. It tells about the feasibility of the reaction.…

Q: Consider the following reaction: 2CH3OH(g)→2 CH4(g) + O2(g) H=+252.8 kJ a. Is this reaction…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: When 1.42 g of iron reacts with 1.80 g of chlorine, 3.22 g of FeCl2(s) and 8.60 kJ of heat is…

A: Iron reacts with chlorine to form iron(II) chloride. When 3.22 g of FeCl2s is formed, 8.60 kJ of…

Q: Propane (C3H8) is the commonly used fuel in our barbeques at home. It is a great fuel because it…

Q: Acetic acid, CH3COOH, is contained in vinegar. Suppose acetic acid was formed from its elements,…

A: The given Reactions and data are- 1. CH3COOH(l) + 2 O2(g) -> 2 CO2(g) + 2 H2O(l) , ∆H° = -871…

Q: A 0.403-g sample of xanthone (C13H8O2) is burned in a bomb calorimeter and the temperature increases…

Question

100%

Please refer to the attached photo. Thank youuu

25. The standard molar enthalpy of formation of glucose, C,H1,0,(s), is –1274.4 kJ/mol.
a) Is the formation of glucose from its elements exothermic or endothermic?
b) Write a balanced equation depicting the formation of glucose from its elements and for which the enthalpy of reaction
is –1274.4 kJ.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Answer to part a.

VIEW

answer to part b.

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Quality Assurance and Calibration Methods

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

When 2.50 g of methane burns in oxygen, 125 kJ of heat is produced. What is the enthalpy of combustion per mole of methane under these conditions?
Assume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)
A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.
Which of the enthalpies of combustion in Table 5.2 the table are also standard enthalpies of formation?
9.41 Under what conditions does the enthalpy change equal the heat of a process?
In the process of isolating iron from its ores, carbon monoxide reacts with iron(III) oxide, as described by the following equation: Fe2O3(s)+3CO(g)2Fe(s)+3CO2(g)H=24.8kJ The enthalpy change for the combustion of carbon monoxide is 2CO(g)+O2(g)2CO2(g)H=566kJ Use this information to calculate the enthalpy change for the equation 4Fe(s)+3O2(g)2Fe2O3(s)H=?
The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).
The enthalpy change for the reaction CH4(g)+2O2(g)CO2(g)+2H2O(l) is 891 kJ for the reaction as written. a. What quantity of heat is released for each mole of water formed? b. What quantity of heat is released for each mole of oxygen reacted?
Using the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)
A sample of nickel is heated to 99.8C and placed in a coffee-cup calorimeter containing 150.0 g water at 23.5C. After the metal cools, the final temperature of metal and water mixture is 25.0C. If the specific heat capacity of nickel is 0.444 J/C g, what mass of nickel was originally heated? Assume no heat loss to the surroundings.
The combustion of 1.00 mol liquid methyl alcohol (CH3OH) in excess oxygen is exothermic, giving 727 kJ of heat. (a) Write the thermochemical equation for this reaction. (b) Calculate the enthalpy change that accompanies the burning 10.0 g methanol. (c) Compare this with the amount of heat produced by 10.0 g octane, C8H18, a component of gasoline (see Exercise 5.41).