3. a) One mole of each of hydrogen, iodine vapor, and HI gas are allowed to react at 1200 K (odd) and 2000 K (even) and P = 1 atm. Calculate the mole fractions of H2, I2, and HI in the equilibrium mixture. The temperature is then changed to that value at which p HI in the equilibrated gas is three times pH2. What is this temperature? b) Plot Ln Kp vs. 1/T and comment on the slope and intercept. Explain How Kp changes in part (a) with temperature.

3. a) One mole of each of hydrogen, iodine vapor, and HI gas are allowed to react at 1200 K (odd) and 2000 K (even) and P = 1 atm. Calculate the mole fractions of H2, I2, and HI in the equilibrium mixture. The temperature is then changed to that value at which p HI in the equilibrated gas is three times pH2. What is this temperature? b) Plot Ln Kp vs. 1/T and comment on the slope and intercept. Explain How Kp changes in part (a) with temperature.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter13: Chemical Equilibrium

Section: Chapter Questions

Problem 112CP: Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were...

See similar textbooks

Similar questions

Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were allowed to react at 300. K. At equilibrium the total pressure was 110.5 torr. The reaction is 2NO(g)+Br2(g)2NOBr(g) a. Calculate the value of Kp. b. What would be the partial pressures of all species if NO and Br2, both at an initial partial pressure of 0.30 atm, were allowed to come to equilibrium at this temperature?
In Table 12.1 (←Sec. 12-3a) the equilibrium constant for the reaction ⇋ is given as 4.2 × 1052. If this reaction is so product-favored, why can large piles of yellow sulfur exist in our environment (as they do in Louisiana and Texas)?
For the system SO3(g)SO2(g)+12 O2(g)at 1000 K, K=0.45. Sulfur trioxide, originally at 1.00 atm pressure, partially dissociates to SO2 and O2 at 1000 K. What is its partial pressure at equilibrium?
The density of trifluoroacetic acid vapor was determined at 118.1 C and 468.5 torr, and found to be 2.784 g/L. Calculate KC for the association of the acid.
Nitrogen, hydrogen, and ammonia are in equilibrium in a 1000-L reactor at 550 K. The concentration of N2 is 0.00485 M, H2 is 0.022 M, and NH3 is 0.0016 M. The volume of the container is halved, to 500 L. (a) Calculate the equilibrium constant. (b) Define y as the change in the concentration of nitrogen in the 500-L container. Is y positive or negative? (c) Write the iCe table and express the equilibrium constant in a polynomial in terms of y.
Explain why there may be an infinite number of values for the reaction quotient of a reaction at a given temperature but theme can he only one value for the equilibrium constant at that temperature.
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
The ore cinnabar (HgS) is an important source of mercury. Cinnabar is a red solid whose solubility in water is 5.5 X 10-2 mol L-1. Calculate its \p. What is its solubility' in grams per 100 g of water?
Ammonia is produced by the Haber process, in which nitrogen and hydrogen are reacted directly using an iron mesh impregnated with oxides as a catalyst. For the reaction N2(g)+3H2(g)2NH3(g) equilibrium constants (Kp values) as a function of temperature are 300C, 4.34 103 500C, 1.45 105 600C, 2.25 106 Is the reaction exothermic or endothermic?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?