3. Metal ion complexation is known to affect the half-wave potential for the reduction ofa metal ion.M+ + Hg+ne → M(Hg)MxAMAX (n-x)+[1][2]The relationship between the molar concentrations of the ligand CL and the shift in thehalf-wave potential is:=(E) E (-0.0592/n)logK - (0.0592x/n)logcL[3]Where (E) and E½ are half-wave potentials for the complexed and uncomplexedcation, respectively, K, is the formation constant for the complex, and x is the molarcombining ratio of the complexing agent to cation.The following polarographic data were obtained for the reduction of Pb2+ to itsamalgam from solutions that were 2.00 x 10-3 M in Pb2+, 0.100 M in KNO3, anddifferent concentrations of the anion A. From the half-wave potentials, find (i) theformula of the complex, and (ii) its formation constant Kſ.Concentration A, M0.0000E vs. SCE, V-0.4050.0200-0.4730.0600-0.5070.1007-0.5160.3000-0.5470.5000-0.558

To solve this problem, we will use the given polarographic data and the provided relationship…

3. Metal ion complexation is known to affect the half-wave potential for the reduction of a metal ion. M++Hg+ne → M(Hg) MxAMAX (n-x)+ [1] [2] The relationship between the molar concentrations of the ligand CL and the shift in the half-wave potential is: = (E) E (-0.0592/n)logK - (0.0592x/n)logcL - [3] Where (E) and E½ are half-wave potentials for the complexed and uncomplexed

3. Metal ion complexation is known to affect the half-wave potential for the reduction of a metal ion. M++Hg+ne → M(Hg) MxAMAX (n-x)+ [1] [2] The relationship between the molar concentrations of the ligand CL and the shift in the half-wave potential is: = (E) E (-0.0592/n)logK - (0.0592x/n)logcL - [3] Where (E) and E½ are half-wave potentials for the complexed and uncomplexed

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter22: The Chemistry Of The Transistion Elements

Section: Chapter Questions

Problem 82GQ: The transition metals form a class of compounds called metal carbonyls, an example of which is the...

See similar textbooks

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
The transition metals form a class of compounds called metal carbonyls, an example of which is the tetrahedral complex Ni(CO)4. Given the following thermodynamic data (at 298 K): (a) Calculate the equilibrium constant for the formation of Ni(CO)4(g) from nickel metal and CO gas. (b) Is the reaction of Ni(s) and CO(g) product- or reactant-favored at equilibrium? (c) Is the reaction more or less product-favored at higher temperatures? How could this reaction be used in the purification of nickel metal?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Calculate the standard potential for the half-reaction Al (C2O4)2- + 3e- Al(s ) + 2C2O42- if the formation constant for the complex is 1.3 1013.
Why is the pH of the medium important for the formation of chelated complexes between metal ions and ligands? Choose the best answer: Select one: a. Because the ligands give rise to acid-base reactions that influence the stability of the chelate b. Because if the pH is not very acidic, the ligands do not protonate and the complex cannot form c. Because the pH of the medium is always important for any type of reaction. d. Because in the absence of pH there is no reaction of any kind
In which of the below reactions is metal sulfide dissolution more energetically favorable? MnS + H+ <--> Mn2+ + HS- CuS + H+ <-->Cu2+ + HS-
Fill in the blanks : (i) When a ligand has a two-complexing or donor group in its structure, it is said to be————— (ii) ___________are compounds whose colour changes when they bind to a metal ion. (ii) If you double the wavelength, you will observe. ________the energy. (iv) In_____________ titration, we monitor changes in absorbance during the titration to find out the equivalence point. (v) Two liquids are_____________ if they form a single phase when they are mixed in any ratio. (vi) The efficiency of Chromatographic Columns can be described by____________Equation.
Calculate the standard potential E0 for the process Ni(CN)42- + 2e- ⇄ Ni(s) + 4CN- given that the formation constant for the complex is 1.0x1022
Is there a way to tell which ligands are strong-field and which are weak-field, or is that just something I need to memorize?
(a) Which metal in the first transition series (3d series) exhibits +1 oxidation state most frequency and why?(b) Which of the following cations are coloured in aqueous solutions and why?SC3+, V3+, Ti4+, Mn2+.(At. nos. Sc = 21, V = 23, Ti = 22, Mn = 25)
Which of the following ligands would have the greatest affinity for Al3+? a) SH- b) F- c) NH3 d) Cl- Can you please explain How I would determine this even with other metals, does this have to do with the like things like each other, the soft acids like soft bases?
The concentration of iron in a solution can be determined using UV?Vis spectrophotometry by reacting the iron with 1.10-phenanthroline to produce a colored complex. The following data were obtained for a series of standard solutions of iron/1,10-phenanthroline complex measured in a 1.00 cm cell. Concentration (M) Absorption 0.50x10-4 0.109 1.0x10-4 0.218 2.0x10-4 0.436 3.0x10-4 0.656 4.0x10-4 0.872 a.Prepare a Beer’s law plot using the above data b.Calculate the concentration of an iron 1, 10-phenanthroline complex solution that has an absorbance of 0.317 c.Calculate the molar absorptivity of the iron/1, 10-phenanthroline complex