3. Which of the following statements is FALSE for the chemical equation given below in which nitrogen gas reacts withhydrogen gas to form ammonia gas assuming the reaction goes to completion?N, + 3H, 2NH,(a) The reaction of one mole of H, will produce 2/3 moles of NH,.(b) One mole of N, will produce two moles of NH,.(c) One molecule of nitrogen requires three molecules of hydrogen for complete reaction.(d) The reaction of 14 g of nitrogen produces 17 g of ammonia.(e) The reaction of three moles of hydrogen gas will produce 17of ammonia.

Answered: Image /qna-images/answer/98bc8fca-1a56-43ba-89c7-af8f4ac7a1da.jpg

3. Which of the following statements is FALSE for the chemical equation given below in which nitrogen gas reacts with hydrogen gas to form ammonia gas assuming the reaction goes to completion? N, + 3H, 2NH, (a) The reaction of one mole of H, will produce 2/3 moles of NH,. 2. (b) One mole of N, will produce two moles of NH,. (c) One molecule of nitrogen requires three molecules of hydrogen for complete reaction. (d) The reaction of 14 g of nitrogen produces 17 g of ammonia. (e) The reaction of three moles of hydrogen gas will produce 17 g of ammonia.

3. Which of the following statements is FALSE for the chemical equation given below in which nitrogen gas reacts with hydrogen gas to form ammonia gas assuming the reaction goes to completion? N, + 3H, 2NH, (a) The reaction of one mole of H, will produce 2/3 moles of NH,. 2. (b) One mole of N, will produce two moles of NH,. (c) One molecule of nitrogen requires three molecules of hydrogen for complete reaction. (d) The reaction of 14 g of nitrogen produces 17 g of ammonia. (e) The reaction of three moles of hydrogen gas will produce 17 g of ammonia.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter5: Stoichiometry

Section: Chapter Questions

Problem 178CP: You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen),...

See similar textbooks

Similar questions

Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
3.122 What type of reasoning were we using when we developed the equation for dilution, MiVi=MfVf ?
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. D Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Write an equation from the following description: reactants are gaseous NH3 and O2, products are gaseous NO2 and liquid H2O, and the stoichiometric coefficients are 4, 7, 4, and 6, respectively.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
4.12 In petroleum refining, hydrocarbons are often manipulated by reacting them with H2(g). If hexene, C6H12, is reacted with hydrogen to form hexane, C6H14, how many moles of hydrogen are needed to react with 453 moles of hexene?
4.21 Ammonium nitrate, NH4NO3, will decompose explosively to form N2, O2, and H2O, a fact that has been exploited in terrorist bombings. What mass of nitrogen is formed by the decomposition of 2.6 kg of ammonium nitrate?