4. Use the balanced reaction to answer the Question,Use 14.01 g.mol-¹ 11.015 mol-¹ and 16.00 g.mol-1.4 NH319) +502 (9) -74N019) + 6H2019)what is the mass of water produced when 200.0gramsof oxygen react with excess ammonia?

Answered: Image /qna-images/answer/4a770fba-26e4-40c9-9568-44c8e9808698.jpg

4. Use the balanced reaction to answer the Question, Use 14.01 g.mol-¹ 11.015 mol-¹ and 16.00 g.mol-1. 4 NH3(g) +502 (9) -74N019) + 6H2019) what is the mass of water produced when 200.0grams of oxygen react with excess ammonia?

4. Use the balanced reaction to answer the Question, Use 14.01 g.mol-¹ 11.015 mol-¹ and 16.00 g.mol-1. 4 NH3(g) +502 (9) -74N019) + 6H2019) what is the mass of water produced when 200.0grams of oxygen react with excess ammonia?

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 9A

See similar textbooks

Related questions

Q: Draw the major product of this reaction. Ignore inorganic byproducts. HBr (excess) Drawing

Q: Draw the products of the reaction shown. Electron flow is indicated with curved arrows. Ö: HCI •…

A: STEP-1 The protonation by carbonyl Oxygen which accept proton from HCl. Step-2 Nucleophilic attack…

Q: ▾ Part A Carbonyl fluoride, COF2, is an important intermediate used in the production of…

A: concentration of COF2 concentration of HCONH2 Qc

Q: Complete and balance, using the half reaction method in acidic solution, the equation for the…

A: Half reaction method Reaction split into oxidation and reduction Then balance separately then add

Q: CIO3 + 2Fe³+ + H₂O2Fe2+ + CIO4 + 2H+ In the above redox reaction, use oxidation numbers to identify…

A: A reaction in which oxidation & reduction occurs simultaneously are called Redox reaction.…

Q: The Ksp of the salt MC204 was determined by titration with potassium permanganate. The balanced net…

A: Here the reaction is, 2MnO4-+5C2O42-+16H+→2Mn2++10CO2 +8H2O So, 2mol MnO4- reacts with 5 mol C2O42-…

Q: 3. Examine the reaction mechanism found below: Step 1: HCI + S₂ + Brz➜ HS₂BrCl + Br Step 2: HCl +…

A: we have to determine the reaction intermediates catalyst overall reaction rate law

Q: Provide the name for the following: ∙C

Q: What is the equation used in step 3 (mass of solute)

A: We are to calculate the minimum amount of solute required to prepare saturated solution.

Q: Which of the following chemical reactions is an ion exchange reaction? A. 2HgO→2Hg+O2 B.…

Q: Calculate AH for the reaction: HCl(g) + NaNO₂(s) → HNO₂(1) + NaCl(s) using the following data:…

Q: dentify the structure

A: IR, 1H-NMR, 13C-NMR and mass spectrometry are used for to identify the complete structure of the…

Q: Me S 1. Et₂CuLi 2. PhCH₂Br Ph. Me. Et * O ·S

A: R2CuLi reacts by conjugate addition to Alpha, beta-unsaturated Carbonyl compounds.

Q: If the pH of a 0.15 M acid is 3.6, what is the Ka? 10:3

A: Concentration (c) = 0.15 M pH = 3.6 Ka = ?

Q: What is the mass percent of water in Ca(NO3)₂ 4 H₂O? Provide an answer to two decimal places.

A: Mass percent: it can be define as the mass of the component in one mole of the compound divided by…

Q: Consider the reaction: I₂ (9) + Cl₂ (9)→ 21C1(g) Using standard absolute entropies at 298 K,…

A: we have to determine the entropy change for the system

Q: What volume, in mL, of 0.339 M Li2CO3 solution is required to react with 56.4 mL of 0.332 M HNO3.

Q: 1. Provide starting materials to synthesize the following amines by (a) Gabriel synthesis, (b) azide…

A: The question is based on the concept of organic synthesis. we need to synthesize the product using…

Q: Write the expression for the solubility-product constant for the following ionic compound, Hg2Br2

A: The solubility product constant, denoted as Ksp, is a measure of the extent to which a solid…

Q: Identify whether each of the following processes in the electron transport chain is an oxidation or…

A: The given reactions can be assigned as oxidation or reduction based on the flow of electrons and…

Q: A common buffer solution can be prepared by using ammonia and ammonium salts. The base equilibrium…

Q: Provide the correct IUPAC name for the compound shown here.

A: Since,Rule of IUPAC-1) Longest chain as parent chain.2) Numbering start from those side where more…

Q: Consider the reaction: 2Fe(s) + 3Cl2(g) → 2FeCl3 (s) Using standard thermodynamic data at 298 K,…

Q: 7 LiAlH H30+ F-N H

A: The given reaction describes the reduction of acid amide to form corresponding secondary amine.

Q: 1. Provide complete arrow pushing mechanisms for each of the following transformations. NaOEt EtOH…

A: Aldol condensation: Aldehyde or ketones having alpha-hydrogen undergo condensation in the presence…

Q: MISSED THIS? Read Section 15.2 (Page): Watch KCV 15.2 IWE 15.1. Consider the reaction 2A(g) + B(g) →…

A: Given reaction 2A(g) + B(g) → 3C(g)

Q: What noble gas structure is formed when an atom of each of these metals lose its Valence electron?…

A: When an atom loses its valence electrons, its electronic configuration brcomes that of a noble gas.

Q: Draw the skeletal (line-bond) structure of (Z)-4-ethylhept-4-en-1-yne.

A: Since, In skelton structure, not write the C and H atom when valency is not complete then assume…

Q: What is proton gradient? Why is it significant in the process of generating ATP?

A: This answer explains the concept of the proton gradient and its significance in the process of…

Q: Provide the correct systematic name for the compound shown here. w N- N,N- N,N,N- cyclo tri iso…

Q: 2. H₂ and I₂ are mixed at 400°C in a 1.0 L container and when equilibrium is established, the…

A: Volume of container = 1.0 LEquilibrium concentration :[HI]=0.8 M[H2]=0.8 M[I2]=0.8 M

Q: A 1.82 mol sample of H₂ gas is confined in a 44.7 liter container at 26.3 °C. If 1.82 mol of O₂ is…

Q: Choose the correct set of reagents that would lead to this major product under these conditions. 0…

A: The addition of HBr in the presence of peroxide to an unsaturated compound takes place through…

Q: Use the References to access important values if needed for this question. In the laboratory you…

A: mass of Chromium(III) nitrate = 22.4 g Volume of the solution = 500 mL = 0.5 L Molarity of the…

Q: Give the IUPAC name for the following structure. If appropriate, specify stereochemistry. O 01510…

Q: Part B The following reaction was performed in a sealed vessel at 721 °C: H₂(g) + I2(g) → 2HI(g)…

A: We have to calculate the equilibrium constant of the given reversible reactions

Q: What is the number of electrons transferred?

Q: 1. The enthalpy of the reaction N2(g) + 2O2(g) → 2NO2(g) can be calculated using the enthalpies of…

Q: Select the correct products for the first reaction. The second question is select the correct…

A: DIBAL (also known as DIBAL-H or DIBAH) is a strong, bulky reducing agent. It's most useful for the…

Q: In the following net ionic equation, identify each reactant as either a Bronsted-Lowry acid or a…

A: Given :- C6H15O3N(aq) + H2O(l) C6H15O3NH+(aq) + OH-(aq) According to Bronsted and Lowry…

Q: Use the balanced equation to answer the question Ca(s) + 2HCl(aq) -> H2(g) + CaC*l{2} (aq) How many…

A: Given :- Ca(s) + 2HCl(aq) -> H2 (g) + CaCl 2 (aq) How many grams of Ca(s) are required to…

Q: Use graphs of concentration and time to determine the order and calculate k of reaction. 2N₂O5(g) →…

A: To determine: Order of reaction and k

Q: What is the correct reagent for step 2? AICI, Zn(Hg), HCI KCN, HỘI CF COH NaOH, 350°C 2. ? Na₂Cr₂O7,…

A: Benzene on reaction with acid chloride in the presence of AlCl3 introduces acyl group in the benzene…

Q: Me Br Me -or- Me Br BI Me

Q: 1. NaNH2 Q

Q: Based on the phase diagram shown below, how will the melting point of the substance change if the…

A: We use the given phase diagram to find pressure effect on melting point.

Q: 546.0 mL of a 0.13 M solution of ammonia is mixed with 546.0 mL of a 0.13 M solution of HBr. What is…

A: The question is based on the titrations. we are titrating a strong acid hydrobromic acid with a…

Q: H N سلم III OH

A: Boiling point depends on intermolecular forces that is hydrogen bonding, hydrogen bonding increase…

Q: A 25.00 mLmL sample of an H2SO4H2SO4 solution of unknown concentration is titrated with a 0.1372 MM…

A: Given the data contains, Volume of sulfuric acid is 25.00 mL=0.025 L The molarity of potassium…

Q: Problems 1. Find the structures and melting points for the following compounds. a. Biphenyl b.…

A: As you have posted multiple questions, according to the guidelines only 1st question will be solved…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1: Given data

VIEW

Step 2: Mass of water produced

VIEW

Solution

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Fertilizer The compound calcium cyanamide (CaNCN) is used as a nitrogen source for crops. To obtain this compound, calcium carbide is reacted with nitrogen at high temperatures. CaC2(s)+N2(g)CaNCN(s)+C(s) What mass of CaNCN can be produced if 7.50 mol of CaC2 reacts With 5.00 molOf N2 ?
Chlorine and fluorine react to form gaseous chlorine trifluoride. Initially, 1.75 mol of chlorine and 3.68 mol of fluorine are combined. (Assume 100% yield for the reaction.) (a) Write a balanced equation for the reaction. (b) What is the limiting reactant? (c) What is the theoretical yield of chlorine trifluoride in moles? (d) How many moles of excess reactant remain after reaction is complete.
The phosphorus pentoxide used to produce phosphoric acid for cola soft drinks is prepared by burning phosphorus in oxygen. (a) What is the limiting reactant when 0.200 mol of P4 and 0.200 mol of 02 react according to P4+5O2P4O10 (b) Calculate the percent yield if 10.0 g of P4O10 is isolated from the reaction.
When solid phosphorus (P4) reacts with oxygen gas, diphosphorus pentoxide is formed. Initially 2.87 mol of phosphorus and 3.86 mol of oxygen are combined. (Assume 100% yield.) (a) Write a balanced equation for the reaction. (b) What is the limiting reactant? (c) How many moles of excess reactant remain after the reaction is complete?
Ammonia reacts with a limited amount of oxygen according to the equation 4NH3(g)+5O2(g)4NO(g)+6H2O(l)(a) How many moles of NO are obtained when 3.914 moles of oxygen are used? (b) How many moles of oxygen are required to react with 2.611 moles of ammonia? (c) How many moles of water are obtained when 0.8144 moles of ammonia are used? (d) How many moles of oxygen are required to produce 0.2179 mol of water?
Freon-12, CCl2F2, is prepared from CCl4 by reaction with HF. The other product of this reaction is HCl. Outline the steps needed to determine the percent yield of a reaction that produces 12.5 g of CCl2F2 from 32.9 g of Cd4. Freon-12 has been banned and is no longer used as a refrigerant because it catalyzes the decomposition of ozone and has a very long lifetime in the atmosphere. Determine the percent yield.
Sand is mainly silicon dioxide. When sand is heated with an excess of coke (carbon), pure silicon and carbon monoxide are produced. (a) Write a balanced equation for the reaction. (b) How many moles of silicon dioxide are required to form 20.00 g of silicon? (c) How many grams of carbon monoxide are formed when 98.76 g of silicon are produced?
DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
Outline the steps needed to determine the limiting reactant when 0.50 mol of Cr and 0.75 mol of H3PO4 react according to the following chemical equation. 2Cr+2H3PO42CrPO4+3H2 Determine the limiting reactant.
Hydrazine N2H4, emits a large quantity of energy when it reacts with oxygen, which has led to hydrazine’s use as a fuel for rockets: :math>N2H4(l)+O2(g)N2(g)+2H2O(g) w many moles of each of the gaseous products are produced when 20.0 g of pure hydrazine ¡s ignited in the presence of 20.0 g of pure oxygen? How many grams of each product are produced?
Solid copper can be produced by passing gaseous ammonia over solid copper (II) oxide al high temperatures. mg src=Images/HTML_99425-9-66QAP_image001.jpg alt="" align="top"/> e other products of the reaction are nitrogen gas and water Vapor. The balanced equation for this reaction is: :math>2NH3(g)+3CuO(s)N2(g)+3Cu(s)+3H2O(g) at is the theoretical yield of solid copper that should form when 18.1 g of NH3, is reacted with 90.4 g of CuO? If only 45.3 g of copper is actually collected, what is the percent yield? mg src=Images/HTML_99425-9-66QAP_image002.jpg alt="" align="top"/>
Citric acid, C6H5CH3, a component of jams, jellies, and fruity soft drinks, is prepared industrially via fermentation of sucrose by the mold Aspergillus niger . The equation representing this reaction is C12H22O11+H2O+3O22C6H8O7+4H2O What mass of citric acid is produced from exactly 1 metric ton (1.000103kg) of sucrose if the yield is 92.30%?