5) What of the following is false about water? a. Water contains no H* or OH ions b. Water has a pH of 7 c. Water is a neutral substance d. In water, the concentration of H* is equal to the concentration of OH-

Q: A chemistry student needs to standardize a fresh solution of sodium hydroxide. He carefully weighs…

A: The reaction of oxalic acid and NaOH is H2C2O4 +2NaOH →Na2C2O4 + 2H2O

Q: What factor affects the rate of a chemical reaction? pH Absorbance Addition of a catalyst Wavelength

A: Rate Of a chemical reaction is defined as the speed at which a chemical reaction continues is mainly…

Q: Given these reactions and their AG° values, COCI2(g) + 4NH3(g) → CO(NH₂)2(s) + 2NH4CI(s), AGº =…

A:

Q: X NO₂ Br j k OH g 0=0 C=N H O=C h m

A: Ortho substituted compounds are the compounds in which functional groups are attached to the next…

Q: Reeded for this question. Draw a structural formula for lithium 2-ethylbenzoate, showing the charges…

A: Structural formula  is the graphic representation of the molecular structure  showing how the atoms…

Q: ited Complete the following reaction and write the IUPAC names of the two products. o CH₂CH3 Submit…

A: IUPAC nomenclature is a system of naming chemical compounds according to a set of rules established…

Q: What is the pH of a 0.138 M C6H5CO₂H M solution if the K₂ of C6H5CO₂H is 6.5 x 10-5? Your Answer:

A:

Q: Assign a structure for the nitrogen-containing compound whose spectra are shown below. It is very…

A: We have to determine the structure of given compound by analysing IR , NMR and mass spectra.

Q: A chemist performs a gravimetric analysis. The chemist combines 1.00 L of 2.00 M AgNO3(aq) with 1.00…

A: A chemist mixes AgNO3  and NaCl in erlenmeyer flask .

Q: Problem 5 To heat up my coffee (150.0mL) from room temperature (21.0°C) to 40.0°C, I use my Coleman…

A: The question is based on the concept of specific heat capacity.  it is defined as the amount of heat…

Q: 152 A 352.44 Your Answer: 155 T 362.31 Answer 153 units G 355.67 156 X 365.88 154 D 359.12 157 You…

A: Here, this problem is based on general chemistry and we have to find out the molar mass of the new…

Q: What is the mass difference in a nuclear reaction if the energy released is 2.98 ◊ 10-¹¹J?

A: The equation relating mass and energy is given below, E=(∆m)c2 where, E = Energy in J ∆m = mass…

Q: A 1.20 L weather balloon on the ground has a temperature of 25.0 °C and is at atmospheric pressure…

A: The given problem is concerned with the decrease in atmospheric pressure as we go up from the ground…

Q: How many molecules of formic acid (HCO₂H) would be generated if the following molecule was treated…

A: HIO4 (periodic acid) is a strong oxidizing agent commonly used in organic chemistry for oxidative…

Q: Some measurements of the initial rate of a certain reaction are given in the table below. initial…

A: Rate of a reaction is directly proportional to concentration of reactant it is given by  Rate = K […

Q: Consider the following reaction at 298K. Hg2+ (aq) + 2 Cr2+ (aq) Hg (1) + 2 Cr³+ (aq) Which of the…

A:

Q: Reaktio B Cl₂, FeCl3

A:

Q: B) Linolenic acid has cis double bonds with the formula CH3CH2CH=CHCH2CH=CHCH2CH-CH(CH2)7COOH. Write…

A: This problem is based on naming of fatty acids.

Q: • Provide a synthesis route to the desired products starting from benzene._. .OH

A:

Q: 16. XeF4 Lewis structure Drawing of shape (label angles) Name of shape d. Polar or nonpolar? e.…

A: A Lewis Structure is a very simplified representation of the valence shell electrons in a molecule.…

Q: Consider the balanced reaction 3 A + 7 B → 4 C + 2 D and the absolute entropies provided in the…

A:

Q: Calculate the cell potential for this reaction, in the direction shown, at 298 K. A1³+ (1.13 M) →…

A: Reaction : AI3+(1.13 M) → AI3+(2.30×10-5M)

Q: What is K for a reaction if AG =86.0 kJ/mol at 25.0 °C? (R = 8.314 J/mol K) .

A:

Q: Tutored Practice Problem 10.1.1 Convert between pressure units. COUNTS TOWARDS GRADE A gas sample…

A: Gas sample Pressure =1.55 atm Hints: 1 atm= 101.3 kPa = 1.013 bar = 760 torr = 760 mm Hg = 14.7 psi…

Q: Consider the reaction A → B with ΔS° = -22.140 J/(K·molrxn) and the reaction B → C with ΔS° = 1.200…

A:

Q: Predict the MAJOR organic product of the following reaction. OEt 1) LDA in THF 2) 3) H₂O* OEt

A:

Q: A reaction A(aq)+B(aq)↽−−⇀C(aq) A ( aq ) + B ( aq ) ⁢ ↽ − − ⇀ C ( aq ) has a standard free‑energy…

A: Answer: Value of equilibrium constant is always equal to the ratio of molar concentration gf product…

Q: Be sure to answer all parts. For the reaction depicted in the molecular scenes, X is red and Y is…

A:

Q: If a solution of 0.10 M Mn²+ and 0.10 M Cd²+ is gradually made basic, what will the concentration of…

A: The question is based on the concept of solubility product principle.  It that states that when a…

Q: What is the origin of the discrepancy between the theoretical and experimental values of the molar…

A: The ideal gas law is a fundamental concept in the field of chemistry that describes the behavior of…

Q: What is K for a reaction if AGº =-226.1 kJ/mol at 25 °C (or 298 K)? (R = 8.314 J/mol · K) .

A:

Q: A sample of a gas mixture contains the following quantities of three gases. compound CO CO₂ SF6 mass…

A: Volume = 2.50 L Temperature = 16.6°C

Q: Dr. A needs to make 163 mL of a 1.55 M solution of XCI2. What mass of XCl₂ is needed to prepare this…

A:

Q: The Δ?vap of a certain compound is 14.17 kJ·mol−1 and its Δ?vap is 93.89 J·mol−1·K−1. What is the…

A: The entropy change accompanying the change in phase from liquid phase to vapor phase is called the…

Q: Draw the major product of this reaction. Ignore inorganic byproducts. excess CH3NH2 Select to Draw 9

A: A question based on introduction to organic chemistry. An acyl chloride and an alkyl amine is given…

Q: how many V is the E (answer?)

A:

Q: The equation AG = -nFE also can be applied to half-reactions. Use standard reduction potentials to…

A:

Q: HBr HI Heat

A:

Q: Propose arrow-pushing mechanisms for the following transformations: CI H2N-NH2 pyridine (xs) NH I ΝΗ

A: In the given reaction NH2NH2 acts as a nucleophile and it can attack the carbon centres of the acid…

Q: HO OCH3 te - 2e с Ho осн (M+ = 152) Molecular ion но +h' оснз (m/2=(51) Base peak

A: Given compound is m-methoxy, p-hydroxy benzaldehyde. First step of the reaction is ionization of the…

Q: Use the equation of sodium chloride dissolving in water to complete NaCl(s) ⇄ Na+(aq) + Cl–(aq) A…

A: Two questions are given. One is based equilibrium concept and the another one based on introduction…

Q: Assign configurations to the C-2 & C-3 carbons in the following molecule. 2 3 CHO HO H HOH CH₂OH…

A: To assign R/S configuration to the molecule, following Cahn-Ingold-Prelog rules must be followed:…

Q: بلدي بلدند Write the mechanism for the Claisen reaction. NaOCH3 HO

A:

Q: Chromate ions react according to the following equation, where the left side of the reaction is…

A: =>CrO42– + 2H+    ⇄   Cr2O72– + H2O    [Yellow]                       [Orange] •So this system…

Q: What is the freezing point in °C of a solution prepared by dissolving 6.60 g of MgCl₂ in 110 g of…

A: we have to calculate the freezing point of the solution

Q: a. Convert 731 millimeters of mercury to atmospheres. atm b. Convert 16.1 psi to millimeters of…

A:

Q: since Paling and also not setric. SP How many "central" atoms are part of methanol (CH,OH)? What are…

A: In methanol (CH3OH), there is one "central" atom, which is the carbon atom (C) bonded to three…

Q: Liquid octane (CH₂(CH₂) CH₂) will react with gaseous oxygen (O₂) to produce gaseous carbon dioxide…

A:

Q: 1. 2. ¹H NMR Analysis of 1,4-Di-t-butyl-2,5-Dimethoxybenzene 3. CH3 CH3 CH3 Provide in your report…

A:

Q: Are there thiols or sulfides in the picture? If so, point them out and state which compounds they…

A:

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red. 

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.