5) You discover a small block of an unknown metal in an old cabinet you purchased from a garage sale. It is silver, shiny and relatively dense (~21 g/mL). Drawing upon your knowledge of chemistry you decide to determine its specific heat capacity (C-p) to help identify it. You make a simple coffee cup calorimeter and fill it with 150.0 mL of deionized water purchased from a grocery store. You check the temperature of the water; it is initially 24.4 °C. You then weigh the block; it is 100.0 grams in mass. Using a stovetop gas range you boiling up some water and suspend the block in the middle of the water using a tea strainer. After 15 minutes or so you remove the metal block (wearing oven mitts) quickly wipe it dry and place it in the coffee cup calorimeter. The temperature inside the calorimeter slowly rises to 25.9 °C and does not go any higher. Assuming the heat capacity of the calorimeter itself is 11.5 J/°C and it started at the same initial temperature as the water, what is the specific heat capacity of the unknown metal?

5) You discover a small block of an unknown metal in an old cabinet you purchased from a garage sale. It is silver, shiny and relatively dense (~21 g/mL). Drawing upon your knowledge of chemistry you decide to determine its specific heat capacity (C-p) to help identify it. You make a simple coffee cup calorimeter and fill it with 150.0 mL of deionized water purchased from a grocery store. You check the temperature of the water; it is initially 24.4 °C. You then weigh the block; it is 100.0 grams in mass. Using a stovetop gas range you boiling up some water and suspend the block in the middle of the water using a tea strainer. After 15 minutes or so you remove the metal block (wearing oven mitts) quickly wipe it dry and place it in the coffee cup calorimeter. The temperature inside the calorimeter slowly rises to 25.9 °C and does not go any higher. Assuming the heat capacity of the calorimeter itself is 11.5 J/°C and it started at the same initial temperature as the water, what is the specific heat capacity of the unknown metal?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter4: Energy And Chemical Reactions

Section4.8: Measuring Reaction Enthalpies: Calorimetry

Problem 4.17E

See similar textbooks

Similar questions

9.35 A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5°C and then dropped into a coffee cup calorimeter containing 75.0 g of water at 2 1.7°C. When thermal equilibrium is reached, the final temperature is 24.3°C. Calculate the specific heat capacity of titanium.
A 237-g piece of molybdenum, initially at 100.0 C, is dropped into 244 g of water at 10.0 C. When the system comes to thermal equilibrium, the temperature is 15.3 C. What is the specific heat capacity of molybdenum?
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
You did an experiment in which you found that 59.8 J was required to raise the temperature of 25.0 g of ethylene glycol (a compound used as antifreeze in automobile engines) by 1.00 K. Calculate the specific heat capacity of ethylene glycol from these data.
9.91 You want to heat the air in your house with natural gas (CH4). Assume your house has 275 m2(ahout 2800 ft2) of floor area and that the ceilings are 2.50 m from the floors. The air in the house has a molar heat capacity of 29.1 J mol-l K-l. (The number of moles of air in the house may he found by assuming that the average molar mass of air is 28.9 g/mol and that the density of air at these temperatures is 1.22 g/L.) What mass of methane do you have to burn to heat the air from 15.0 to 22.0°C?
In a bomb calorimeter, the reaction vessel is surrounded by water that must be added for each experiment. Since the amount of water is not constant from experiment to experiment, the mass of water must be measured in each case. The heat capacity of the calorimeter is broken down into two parts: the water and the calorimeter components. If a calorimeter contains 1.00 kg water and has a total heat capacity of 10.84 kJ/C, what is the heat capacity of the calorimeter components?
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
9.104 An engineer is using sodium metal as a cooling agent in a design because it has useful thermal properties. Looting up the heat capacity, the engineer finds a value of 28.2 J mol-l °C-l. Carelessly, he wrote this number down without units. As a result, it was later taken as specific heat. (a) What would he the difference between these two values? (b) Would the engineer overestimate the ability of sodium to remove heat from the system or underestimate it because of this error? Be sure to explain your reasoning.
A sample of sucrose, C12H22O11, is contaminated by sodium chloride. When the contaminated sample is burned in a bomb calorimeter, sodium chloride does not burn. What is the percentage of sucrose in the sample if a temperature increase of 1.67C is observed when 3.000 g of the sample are burned in the calorimeter? Sucrose gives off 5.64103kJ/mol when burned. The heat capacity of the calorimeter and water is 22.51 kJ/C.
Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
Nitric acid, HNO3, can be prepared by the following sequence of reactions: 4NH3(g)+5O2(g)4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) How much heat is evolved when 1 mol of NH3(g) is converted to HNO3(l)? Assume standard states at 25 C.