500.0 mL of 0.020 M Mn(NO3)2 are mixed with 1.0 L of 1.0 M Na2C204. The oxalate ion, C2042-, acts as a ligand to form complex ions with the Mn2+ ion. Mn2+ + C2042- MnC204 K1 = 7.9 x 103 [Mn(C204)2]2-2 MnC204 + C2042- K2 = 1.26 x 10-2 What is the equilibrium constant for the reaction below? Mn2+ + 2C2042-2 [Mn(C204)2]2-

500.0 mL of 0.020 M Mn(NO3)2 are mixed with 1.0 L of 1.0 M Na2C204. The oxalate ion, C2042-, acts as a ligand to form complex ions with the Mn2+ ion. Mn2+ + C2042- MnC204 K1 = 7.9 x 103 [Mn(C204)2]2-2 MnC204 + C2042- K2 = 1.26 x 10-2 What is the equilibrium constant for the reaction below? Mn2+ + 2C2042-2 [Mn(C204)2]2-

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter20: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 80AE

See similar textbooks

Similar questions

Five-coordinate coordination complexes are known, including [CuCl5]3 and [Ni(CN)5]3. Write the structuralformulas and identify a plausible geometry for thesecomplexes.
The transition metals form a class of compounds called metal carbonyls, an example of which is the tetrahedral complex Ni(CO)4. Given the following thermodynamic data (at 298 K): (a) Calculate the equilibrium constant for the formation of Ni(CO)4(g) from nickel metal and CO gas. (b) Is the reaction of Ni(s) and CO(g) product- or reactant-favored at equilibrium? (c) Is the reaction more or less product-favored at higher temperatures? How could this reaction be used in the purification of nickel metal?
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Ethylenediaminetetraacetate (EDTA4 ) is used as a complexing agent in chemical analysis with the structure shown in Fig. 21.7. Solutions of EDTA4 are used to treat heavy metal poisoning by removing the heavy metal in the form of a soluble complex ion. The complex ion virtually prevents the heavy metal ions from reacting with biochemical systems. The reaction of EDTA4 with Pb2+ is Pb2+(aq) + EDTA4(aq) iPbEDTA2(aq) K = 1.1 1018 Consider a solution with 0.010 mol of Pb(NO3)? added to 1.0 L of an aqueous solution buffered at pH = 13.00 and containing 0.050 M Na1EDTA. Does Pb(OH)2 precipitate from this solution? [Ksp for Pb(OH)2 = 1.2 1015.
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
A certain coordination compound has the simplest formula PtN2H6Cl2. It has a molar mass of about 600 g/mol and contains both a complex cation and a complex anion. What is its structure?
Give the coordination number for each metal ion in the following compounds: (a) [Co(CO3)3]3- (note that CO32- is bidentate in this complex). (b) [Cu(NH3)4]2+. (c) [Co(NH3)4Br2]2(SO4)3. (d) [Pt(NH3)4][PtCl4]. (e) [Cr(en)3](NO3)3. (f) [Pd(NH3)2Br2] (square planar). (g) K3[Cu(Cl)5]. (h) [Zn(NH3)2Cl2]
The complex ion PdCl42is diamagnetic. Propose a structure for PdCl42.
The glycinate ion, H2NCH2CO2, formed by deprotonation of the amino acid glycine, can function as a bidentate ligand, coordinating to a metal through the nitrogen of the amino group and one of the oxygen atoms. Glycinate ion, a bidentate ligand A copper complex of this ligand has the formula Cu(H2NCH2CO2)2(H2O)2. For this complex, determine the following: (a) the oxidation state of copper (b) the coordination number of copper (c) the number of unpaired electrons (d) whether the complex is diamagnetic or paramagnetic
(a) Name this coordination compound: [Ag(NH3)2]NO3. (b) Write the formula of pentaaquaisothiocyanatoiron(III) chloride.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?