59. Methanol (CH3OH) burns in oxygen to form carbon dioxide and water. Write a balanced equation for the combustion of liq- uid methanol and calculate AHan, ASs and AG at 25 C. Is the combustion of methanol spontaneous?

59. Methanol (CH3OH) burns in oxygen to form carbon dioxide and water. Write a balanced equation for the combustion of liq- uid methanol and calculate AHan, ASs and AG at 25 C. Is the combustion of methanol spontaneous?

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter16: Spontaneity Of Reaction

Section: Chapter Questions

Problem 80QAP

See similar textbooks

Related questions

Q: For a certain chemical reaction, AH" = +9.8 kJ and AS = +30.0 J/K. a) Is the reaction endothermic or…

A: The More the Negative value Of gibbs free energy more spontaneous will be reaction.

Q: For the reaction: 2NO2 (g) ↔ N2O4 (g) at 298 K, The value of ∆H⁰ and ∆S⁰ are -58.03 kJ and -176.6…

Q: 2 AgNO3 (s) + SO2 (g) → Ag2S (s) + 2 NO2 (g) + 2 O2 (g) Is the reaction spontaneous…

Q: Consider the reaction below at constant pressure. Use the information provided to determine the…

A: If delta S surrounding is positive then reaction will be spontaneous.

Q: Sodium carbonate can be made by heating sodium bicarbonate:…

A: Standard free energy change, standard enthalpy and standard entropy have the following relationship.…

Q: 13) Calculate AG° spontaneous in each case? for the reaction above at a) -50.0 °C and at b) 675 °C.…

Q: By is an exothermic reaction. 1) Ag) Analyze when this reaction is spontaneous (i.e. spontaneous at…

Q: For a particular reaction, AH = 20.1 kJ and AS = 45.9 J/K. Assuming these values change very little…

A: Applying concept of spontaneity and formula ∆S=∆H /T

Q: Copper Metal is obtained by smelting copper(I) sulfide ores: Cu2S(s) + O2(g) → 2 Cu(s) + SO2(g) Use…

Q: Which one of the following is always positive when a spontaneous process occurs? * AH(sys +sur)…

A: The second law of thermodynamics gves the insight of the direction of any spontaneous process.

Q: Consider the reaction: H2S(g)+SO2(g)---> 3S(g)+2H2O(l) for which delta H is -233 kJ and delta S…

A: Given:

Q: 10) Show that it is a spontaneous process for water to boil at 110 °C.

A: When we superheat liquid water at 110°C, the nature of the reaction can be stated by following it's…

Q: For a certain reaction at 15°C, ∆H = −10.5 kJ/mol and ∆S = 30. J/mol•K. Calculate ∆G for the…

A: ∆G is the change in gibbs free energy. The value of ∆G is given by following expression : ∆G = ∆H -…

Q: 1. N2(g}+3H2(g) --->2NH3(g) If AH = -92.2kJ and AS= -0.1987KJ/K, what is AG for the reaction at…

A: The free energy change,ΔG can be calculated using the formula: ΔG = ΔH - TΔS ΔH = enthalpy change ΔS…

Q: Methanol (CH3OH) burns in oxygen to form carbon dioxide and water. Write a balanced equation for the…

Q: 1. Consider a reaction: C₂H₂(g) + 4Cl2(g) → 2CCL4 (1) + H₂(g) Calculate the following by using the…

Q: For the reaction C6H6 (1) + 3 H2 (g) C6H12 (1) AHO = -206.7 kJ/mol What statement is true? (Hint:…

A: A reaction would be spontaneous if ∆G (reaction) is negative.

Q: 10. A reaction at 45 °C has the following enthalpy and entropy: AH° = -86.6 kJ and AS = 382J/K. a.…

A: ∆G°=∆H°-T∆S° If ∆G° = -ve, the reaction will be spontaneous. If ∆G° = +ve, the reaction will be…

Q: Solid N205 reacts with water to form liquid HNO3. Consider the reaction with all substances in their…

Q: Calculate the ASuni and determine whether the following reaction is spontaneous at 25.0°C. Al2O3(s)…

A: The relation between ∆G, ∆H and ∆S is given as;∆G=∆H-T∆S

Q: Octene (C8H16) can be converted into octane (C8H18) following the reaction below. ΔH° for the…

A: For spontaneous reaction ∆G is negative

Q: For the reaction of 2SO2(g) + O2(g) → 2SO3(g) having the following conditions: Temperature = 25°C AG…

A: Given: ∆H = -198.4 kJ ∆S = -187.8 JK

Q: In photosynthesis, plants form glucose (C,H1206) and oxygen from carbon dioxide and water. Write a…

A: The balanced equation for photosynthesis is: 6CO2(g)+6H2O(l)→hvC6H12O6(s)+6O2(g) Determination of…

Q: What is the entropy when 1.36 moles of CCl¿F2 vaporize at 25°C? [AH(vap) = 17.2 kJ/mol at 25°C]

Q: For each reaction, calculate AH AS, and AG at 25 °C and state whether or not the reaction is…

A: To find out the value of ΔHrxn°, ΔSrxn° and ΔGrxn° at 25°C that is 298 K and also predict whether…

Q: 2.2.Predict if the following reaction is spontaneous or not. CO26)CO(g) at 25°C

A: We have given that Predict if the reaction is Spontaneous or Not CO2(s) ------> CO2(g) at 25°C…

Q: Is the formation of ozone (O,(g)) from oxygen (O2(g)) spontaneous at room temperature under standard…

A: Spontaneity of a reaction is decided by the sign of ∆G° of reaction.

Q: 57. For each reaction, calculate AHan, AS, and AGan at 25 °C and state whether or not the reaction…

A: Note - Since you have asked multiple questions (multiple reactions), we are supposed to solve only…

Q: Calculate Delta G^o for the following reaction at 25Celsius. What is k of reaction? What type of…

A: The reaction given is, => C2H4 (g) + O2 (g) → CO2 (g) + H2O (g)

Q: If the AH = 287 kJ/mol and AS = 57 J/K mol for a nonspontaneous reaction, at what temperature does…

A: Thermodynamics is branch of chemistry in which we deal with amount of heat evolved or absorbed by…

Q: 12. For a particular chemical reaction ΔΗ= 6.8 kJ and A--29 JK. Under what temperature condition Is…

A: Enthalpy of the given reaction is defined as the difference in the enthalpy of reactants and…

Q: of methane in oxygen is CH,(g) + 2O2(g) → CO,(g) + 2H,O(I) The combustion spontaneous at 25 °C: What…

A: 1 .Combusion reaction is reaction in presence of oxygen to give carbon dioxide and water .…

Q: 11.13 For a certain reaction at 15°C, AH = -10.5 kJ/mol and AS = 30. J/mol•K. Calculate AG for the…

A: From the equation of Gibb's free energy change, we know ∆G = ∆H -T×∆S where ∆G = Gibb's the free…

Q: Our atmosphere is composed primarily of nitrogen and oxygen, which coexist at 25 °C without reacting…

A: The relation between Gibbs free energy and equilibrium constant is shown below: ∆G0 = -RTln Kp…

Q: For which set of values of AH and AS will a reaction be spontaneous at all temperatures? O AH = +10…

A: For a reaction to be spontaneous, change in free energy for a reaction must be negative.

Q: What must the sign of ∆G be for any spontaneous process

A: Dear student I have given answer to your question in the image format.

Q: 2. Define and give an example: Spontaneous, exergonic 3. Define and give an example:…

A: These all are the terms related with chemical thermodynamics. There are many reactions which occur…

Q: 8e. Consider the following reaction: CacO3 (s) → Cao (s) + CO2 (g) Data: A,H = +177.5 kJ mol1 AS =…

A: Given: To find: The temperature of the spontaneous reaction Formula: Where is the entropy is…

Q: For a particular reaction, AH° = 20.1 kJ/mol and AS° = 45.9 J/(mol·K). Assuming these values change…

A: Answer:- This question is answered by using the simple concept of spontaneity of the reaction which…

Q: For the reaction 2 PF5(g) + 5 H2(g) → 2 P(g) + 10 HF(g), calculate ΔGº and determine whether the…

A: Given,

Q: For a particular reaction, AH° = 67.7 kJ and AS° = 126.9 J/K. Assuming these values change very…

Q: Calculate AGO at 25°C, given the values of AHO = - 844 kJ/mol and -165 J/mol-K.wt a. AS° b. At what…

A: According to the second law of thermodynamics, the spontaneous nature of the reaction is determined…

Q: The figure represents the spontaneous deposition of iodine in which iodine vapor, I2(g), becomes…

Q: þetermine the values of AH', AS'and AG'for the following two reactions at 25 °C, using the data…

A: A spontaneous reaction is a reaction that favors the production of compounds under the conditions…

Q: -Find AH, AS, and AG. Is this reaction exothermic and is it spontaneous? NO (g) + ½ O2 (g) -> NO2…

A: The given reaction is: From the given values- ΔH and ΔS can be calculated as follows: where m and…

Q: 9) For which set of values of AH and AS• will a reaction be non-spontaneous at 25°C? a) AH• = -10…

A: Multiple question

Q: For a chemical reaction to be spontaneous at all temperatures, which of the following conditions…

A: According to the second law of thermodynamics, the spontaneous nature of the reaction is determined…

Q: Consider the following reaction at constant P. Use the information here to determine the value of AS…

Q: Consider the reaction for the decomposition of carbon tetrachloride gas:CCl4(g)¡C(s, graphite) + 2…

A: (a) The given reaction is, CCl4g→Cs,graphite+2Cl2g ∆H=+95.7 kJ∆S=+142.2 J/KT=25°C=25+273K=298 K

Q: Question attached

A: A reaction is considered as spontaneous when the Gibbs free energy of the reaction (∆Gorxn) is…

Question

59. Methanol (CH3OH) burns in oxygen to form carbon dioxide
and water. Write a balanced equation for the combustion of liq-
uid methanol and calculate AHan, ASs and AG at 25 C. Is
the combustion of methanol spontaneous?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step 5

Step 6

Trending now

This is a popular solution!

Step by step

Solved in 6 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Many plastic materials are organic polymers that contain carbon and hydrogen. The oxidation of these plastics in air to farm carbon dioxide and water is a spontaneous process; however, plastic materials tend to persist in the environment. Explain.
On the basis of your experience, predict which of the following reactions are spontaneous. (a) CO2(s)CO2(g) at 25°C (b) NaCl(s)NaCl(l) at 25°C (c) 2NaCl(s)2Na(s)+Cl2(g) (d) CO2(g)C(s)+O2(g)
10.104 (a) When a chemical bond forms, what happens to the entropy of the system? (b) Thermodynamically, what allows any bond formation to occur? (c) What do your answers to parts (a) and (b) suggest must be true about the formation of chemical bonds for the octet rule to hold?
What happens to the entropy of the universe during a spontaneous process?
10.51 The combustion of acetylene was used in welder's torches for many years because it produces a very hot flame: C2H2(g)+52O2(g)2CO2(g)+H2O(g) H= -1255.5 kJ (a) Use data in Appendix E to calculate S for this reaction, (b) Calculate G and show that the reaction is spontaneous at 25°C. (c) Ls there any temperature range in which this reaction is not spontaneous? (d) Do you think you could use Equation 10.4 to calculate such a temperature range reliably? Explain your answer.
What is the second law of thermodynamics? For any process, there are four possible sign combinations for Ssys and Ssurr. Which sign combination(s) always give a spontaneous process? Which sign combination(s) always give a non-spontaneous process? Which sign combination(s) may or may not give a spontaneous process?
For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
Consider the following reaction at 25C: Cl2(g)2Cl(g)K=1.01037 (a) Calculate G for the reaction at 25C. (b) Calculate G f for Cl(g) at 25C.
Consider two processes: sublimation of I2(s) and melting of I2(s) (Note: the latter process can occur at the same temperature but somewhat higher pressure). I2(s)I2(g)I2(s)I2(l) Is S positive or negative in these processes? In which of the processes will the magnitude of the entropy change be greater?
Calculate H and G for the following reactions at 25C, using thermodynamic data from Appendix C; interpret the signs of H and G. a 2PbO(s)+N2(g)2Pb(s)+2NO(g)\ b CS2(l)+2H2O(l)CO2(g)+2H2S(g)
Thermite reactions have been used for welding metal parts such as railway rails and in metal refining. One such thermite reaction is Fe2O3(s)+2Al(s)Al2O3(s)+2Fe(s). Is the reaction spontaneous at room temperature under standard conditions? During the reaction, the surroundings absorb 851.8 kJ/mol of heat.
Use the standard entropy data in Appendix G to determine the change in entropy for each of the reactions listed in Exercise 16.34. All the processes occur at the standard conditions and 25 C.