6. Predict the position of the equilibrium and calculate the equilibrium constant, Keq, for the followingacid-base reaction.CH3NH₂+ + CH3COO-CH3NH₂ + CH3COOHmethylamine acetic acidacetate ionpK₂ = 4.74methylammoniumionpK₂ = 10.64

Answered: Image /qna-images/answer/f7fc1a3b-527c-4e9b-b1b9-f812f5c6867a.jpg

6. Predict the position of the equilibrium and calculate the equilibrium constant, Keq, for the following acid-base reaction. CH3NH₂ + CH₂COOH methylamine acetic acid CH3NH3 + methylammonium ion + CH3COO- acetate ion pK₁ = 4.74 pK₁ = 10.64

6. Predict the position of the equilibrium and calculate the equilibrium constant, Keq, for the following acid-base reaction. CH3NH₂ + CH₂COOH methylamine acetic acid CH3NH3 + methylammonium ion + CH3COO- acetate ion pK₁ = 4.74 pK₁ = 10.64

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter7: Alkynes

Section: Chapter Questions

Problem 7.10P: Complete each acid-base reaction and predict whether the position of equilibrium lies toward the...

See similar textbooks

Related questions

Q: A 10.0 mL solution of 0.050 M AgNO3 was titrated with 0.0250 M NaBr in the cell: S.C.E || titration…

Q: 5. The mass of metal deposited by the electrolysis of an aqueous solution of metal ions increases in…

Q: N₂O5 decomposes into NO2 and NO3 with a rate constant of 1.96 X 1014 exp [-10,660/T]s-¹. At t = 0,…

A: Given : Initial pressure (P) = 2 atm T = 273 K Time = 1 min = 60 sec

Q: 4 Which of the following statements is TRUE about the complex, diaquabis(oxalato)ruthenate(II)? The…

Q: What is the common name of the ether that has the structure shown? H3C 0 CH₂CH3 common name:

Q: 3.5. Give the names of the following compounds; (a) K4[Fe(CN)6] (b) Na2[NiCl4] (c)…

Q: Solve AHpn for 2NOCI(g) —> N₂(g)+O₂(g)+Cl₂(g) given the ff set of reactions 1/2 N₂(g)+1/2 O₂(g) —>…

Q: Titration Curves. Solve the ff. Problems 1. A 25mL aliquot of 0.1M NaOH is titrated with 0.10M HCl.…

Q: Question 3 Consider the set of elementary reactions k₁ A B k2 A + B C k3 A+D 2E At time t = 0, a…

Q: NaHCO3 from label of Alka Seltzer tablet: 1916mg Data Sheet: Run #1 Run #2 Run #3 Run #4 Run #5 Run…

A: #Calculation for Run#1: The balanced equation for the formation of CO2(g) from NaHCO3(aq) and acetic…

Q: Which is a structural isomer of 3-ethyl-3-methylhexane? O2,7-dimethyloctane…

A: Here we are required to find the structural isomer of the given compound

Q: 4 Which of the following statements is TRUE about the complex, diaquabis(oxalato)ruthenate(II)? The…

Q: Which of the following secondary valence for complexes matches the expected structure of the…

A: Which of the following secondary valence for complexes matches the expected structure of the…

Q: The structure of cyclohexane is shown. H₂C | H₂C CH₂ | CH₂

A: Cyclohexane is known as cycloalkane having the formula C6H12

Q: 1. Define sparging. What is the significance of this step in an HPLC analysis?

Q: Intermolecular forces of attraction, such as hydrogen bonding and van der Waals forces, are…

A: A question based on intermolecular forces of attraction that is to be accomplished.

Q: 1. State all the products formed from Hofmann elimination of the following amine. Choose the major…

A: Hofmann's elimination : Hofmann's elimination is the process of creating tertiary amines and alkenes…

Q: An aqueous solution at 25 °C has a H₂O concentration of 2. x 10 M. Calculate the OH concentration.…

Q: An aqueous solution at 25 °C has a pH of 5.8. Calculate the pOH. Be sure your answer has the correct…

A: given pH = 5.8, we know that pH + pOH = 14

Q: Which half-reaction can occur at the anode in a voltaic cell? A Ni+² +2e → Ni B Sn + 2e Sn+2 С Zn →…

A: Solution: Oxidation : It is defined as the process in which lose of electrons took place and it…

Q: 7 How would you expect the molecule 1,10-phenanthroline (shown below) to function as a ligand? H H H…

A: A ligand is a ion or molecule which donates the loan pair of electrons to other to form a bond…

Q: NH₂ 1. NaNO₂, HCI 2. HBF4

Q: When naming organic compounds, there are strict rules regarding punctuation. 1. A comma is used to…

A: While writing IUPAC name, the numbers should be separated using commas ( , )and a number and letter…

Q: Name the three alkenes using systematic names. H3C CH3 A. H3C The name of compound A is: B. چہ آپ…

Q: Classify these alcohols as primary (1°), secondary (2°), or tertiary (3⁰). 1° 2° CH₂CH3 OH CH,CCH₂OH…

Q: Nitrogen and Hyd eact to nd, like this. N₂(g)+3H₂(g)2NH3(g) The reaction is exothermic. Suppose a…

Q: Examine the potential energy diagram below. Use text boxes to respond. C B F e. Which step is the…

A: Using the potential energy diagram, answer the given questions e. Which step is the rate determining…

Q: NH₂ 1. NaNO₂, HCI 2. HBF4

A: The reaction is Balz schiemann reaction.

Q: A 10.0-gram 2-hydroxybenzoic acid was reacted with 36.0 g of ethnic anhydride. The air-dried crude…

A: Given that - Mass of 2-hydroxybenzoic acid = 10.0 g Mass of ethnic anhydride = 36.0 g Mass of air…

Q: Name the alkyne. Spelling and punctuation count.

Q: 20 mL of 0.01 M V2+ is titrated by 0.01 M Ce4+ in 1 M HCI using SHE reference electrode to find the…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Does a reaction occur when aqueous solutions of zinc sulfate and silver(I) acetate are combined?…

Q: Show your reaction mechanisms for the formation of: a. RCNOH, from the reaction of RCOOR' with NH₂…

Q: The formula for the oxide of a metal is La203. The formula for the chloride of the same metal O LaCl…

Q: Propose a preparation reaction for the formation of CH NHCH CH from organic compounds with only 1 or…

Q: NH₂ 1. NaNO₂, HCI 2. HBF4

Q: CALCULATIONS: 1. Prepare a Temperature vs Time cooling curve for each of the two trials performed…

A: Solution: We know the stearic acid a fatty acid with IUPAC name octadecanoic acid. Its melting point…

Q: 2. Joey was tasked to ensure that an enzyme responsible for keeping his species from extinction…

A: Since you have asked a question with multiple subparts, we will answer only first 3 subparts for…

Q: What would you use to prove that copper is reduced in the following reaction? Fe) + CuSO4(q) →…

A: Given reaction: Fe(s) + CuSO4 (aq) → FeSO4 (aq) + Cu(s) We have to prove why copper is reduced in…

Q: 2) The graph shows the energy reaction curves with and without a catalyst for a certain reaction.…

Q: Draw the product of the oxidation of the given aldehyde. Include all hydrogen atoms. Select Draw /…

A: Oxidation of Alcohols gives the formation of carboxylic acids. Following reagents can be used for…

Q: A3 During photosynthesis water molecule is split into 2H+ + 2e- + 1/2O2. If the e- moves from its…

Q: Choose the complex that has the greater splitting parameter. Complex A [Cul6]4 [Fe(CN)6]4-…

Q: 2 H₂O + O2 → 2 H₂O₂ O 0.81 mol H₂O2 O 81 g H₂0₂ O 13 mol H₂O₂ O 6.5 mol H₂O₂

Q: Part C - Comparing and Contrasting the Two Types of Voltage-Gated lon Channels Sort the phrases into…

Q: Which of the following statements is TRUE about the complex, diaquabis(oxalato)ruthenate(II)? The…

A: Given complex: diaquabis(oxalato)ruthenate(II) To determine the true statement

Q: In the steam distillation of lemon grass, the mixture boils at 95.00C at 1 atm pressure. If the…

A: Here steam distillation is applicable for organic compounds which is immiscible in water. Ptotal =…

Q: The structure of a chiral isomer is given. Draw the mirror image isomer. Use wedge-and-dash bonds…

A: The molecules with the same molecular formula but different structures are known as isomers. If the…

Q: Which of the following ligands is an example of an ambidentate ligand? nitrite, NO₂ chloride, Cl…

A: A coordination compound is formed by a complex ion and a simple oppositely charged ion. In a complex…

Concept explainers

Acid Base Titration

An acid-base titration is the method of quantitative analysis for determining the concentration of an acid and base by exactly neutralizing it with a standard solution of base or acid having known concentration.

Question

6. Predict the position of the equilibrium and calculate the equilibrium constant, Keq, for the following
acid-base reaction.
CH3NH₂+ + CH3COO-
CH3NH₂ + CH3COOH
methylamine acetic acid
acetate ion
pK₂ = 4.74
methylammonium
ion
pK₂ = 10.64

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

1. Write the equilibrium-constant expressions and obtain numerical values for each constant in(a) the basic dissociation of aniline, C6H5NH2 .(b) the acidic dissociation of hypochlorous acid, HClO.(c) the acidic dissociation of methyl ammonium hydrochloride, CH3NH3Cl.(d) the basic dissociation of NaNO2 .(e) the dissociation of H3AsO3 to H3O + and AsO33- 2. The chemicals A and B react as follows to produce C and D: A + B ↔ C + DKe = [C] [D] [A] [B] The equilibrium constant Ke has a value of 0.30. Assume 0.20 mol of A and 0.50 mol of B are dissolved in 1.00 L, and the reaction proceeds. Calculate the concentrations of reactants [A], [B] and products [C], [D] at equilibrium. Using step-by-step process
Write the equilibrium-constant expressions and obtainnumerical values for each constant in. (a) the basic dissociation of aniline, C6H5NH2. (b) the acidic dissociation of hypochlorous acid,HClO. (c) the acidic dissociation of methyl ammoniumhydrochloride, CH3NH3Cl. (d) the basic dissociation of NaNO2. (e) the dissociation of H3AsO3to H3O+and AsO33-. (f) the reaction of C2O42-with H2O to give H2C2O4and OH-. show solution
Identify the acid and conjugate base in each reaction. Calculate the pKA for each acid. List them in order from the strongest to weakest acid. The acid-ionization constants, KA, at 25°C are provided for each. C6H5OH + H2O Û H3O+ + C6H5O-, KA = 1.2589254 x 10-10 CH3CO2H + H2O Û H3O+ CH3CO2-, KA = 1.5848 x 10-5 CF6CO2H+H2O Û H3O+ + CF6CO2-, KA = 0.6309
Write equations for the following acid-base reactions. Label the conjugate acids and bases, and show any inductive stabilization. Predict whether the equilibrium favors the reactants or products. Try to do this without using a table of pKa values, (a) CH3CH2OH + CH3NH- (b) F3CCOONa + Br3C¬COOH(c) CH3OH + H2SO4 (d) NaOH + H2S(e) CH3NH3+ + CH3O- (f) BrCH2CH2OH + F3C¬CH2O-(g) NaOCH2CH3 + Cl2CHCH2OH (h) H2Se + NaNH2(i) CH3CHFCOOH + FCH2CH2COO- (j) CF3CH2O- + FCH2CH2OH
dentify the conjugate base in the reaction of propanoic acid CH3CH3COOH reacting with methyl amine, CH3NH2. a. CH3NH2 b. CH3CH3COOH c. CH3NH3+ d. OH-1 e. CH3CH3COO-1
Using pKa Values to Predict the Direction of Equilibrium Determine the direction of equilibrium when acetylene (HC≡CH) reacts with −NH2 in a proton transfer reaction.
Write the equilibrium-constant expressions and obtain numerical values for each constant in(a) The basic dissociation of aniline, C6H5NH2.(b) The acidic dissociation of methyl ammonium hydrochloride, CH3NH3Cl.(c) The dissociation of H3AsO3 to H3O+ and AsO3^3-.
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
Will 3- methylhexanoic acid be negative or neutral at pH of 6.38?
Given the following reversible reactions and Kc values: (I) Self-ionization of water: H2O + H2O H3O+ + OH-, Kc = Kw = 1.0 x 10-14. (II) Ionization of a weak base: NH3 + H2O NH4+ + OH-, Kc (= Kb) = 1.8 x 10-5. a) Determine the Kc for the reaction: NH3 + H3O+ NH4+ + H2O b) Would you assess the Kc value as LARGE or small? Does your assessment make sense for this reaction, i.e. think about the species involved?
Which is true regarding the direction of the following reaction? CH3COOH (aq) + H2PO-4 <<>>> CH3COO- + H3PO4 a) the reaction favors the reactant side b) the reaction favors the product side c) the reaction favors both reactants and products equally d) the table of acidity does not proviede enough information to answer this question
Calculate the pKa of each acid and indicate which is the stronger acid. C6O2H8, Ka = 1.7 x 10–5 C2O4H2, Ka = 5.9 x 10–2