Questions 7 and 8 A SelectParagraphStylesEditingVoiceSensitivity7. Lactic acid, also known as a-hydroxy propionic acid, is an a-hydroxy acid (AHA)found in some skin care products. What is its structure?OHA) CH3-CH-C-HOHB) CH;CH,CH-OHOHC) CH,-CH-C-OHOHID) CH,CH, -C-OHHO-CH,CH-HE)OH8. Which statement best explains why propanoic acid (M.W. = 74) boils at a much highertemperature than hexane (M.W. = 86)?A)Lower molecular weights tend toat higher temperatures.B)Propanoic acid has weaker intermolecular forces than hexane.C)Propanoic acid molecules can hydrogen bond with other propanoic molecules buthexane is non-polar and cannot hydrogen bond.D)Chains with fewer carbon atoms tend to boil at higher temperatures than ones withmore carbon atoms.None of the choices are correct.E)Accessibility: InvestigateOFocusprt schomeendInsertF11F1296&378.PDGK

7. Lactic acid, also known as a-hydroxy propionic acid, is an a-hydroxy acid (AHA) found in some skin care products. What is its structure? OH O A) CH,-CH-ċ-H OH B) CH,CH,CH-OH OH O C) CHy OH -CH-C- HO- D) CH,CH, HO-CH,CH-C- H- E) OH 8. Which statement best explains why propanoic acid (M.W. = 74) boils at a much higher temperature than hexane (M.W. = 86)? A) Lower molecular weights tend to boil at higher temperatures. Propanoic acid has weaker intermolecular forces than hexane. Propanoic acid molecules can hydrogen bond with other propanoic molecules but hexane is non-polar and cannot hydrogen bond. D) B) Chains with fewer carbon atoms tend to boil at higher temperatures than ones with more carbon atoms. None of the choices are correct. E) wility: Investigate DFocus

7. Lactic acid, also known as a-hydroxy propionic acid, is an a-hydroxy acid (AHA) found in some skin care products. What is its structure? OH O A) CH,-CH-ċ-H OH B) CH,CH,CH-OH OH O C) CHy OH -CH-C- HO- D) CH,CH, HO-CH,CH-C- H- E) OH 8. Which statement best explains why propanoic acid (M.W. = 74) boils at a much higher temperature than hexane (M.W. = 86)? A) Lower molecular weights tend to boil at higher temperatures. Propanoic acid has weaker intermolecular forces than hexane. Propanoic acid molecules can hydrogen bond with other propanoic molecules but hexane is non-polar and cannot hydrogen bond. D) B) Chains with fewer carbon atoms tend to boil at higher temperatures than ones with more carbon atoms. None of the choices are correct. E) wility: Investigate DFocus

Organic Chemistry

9th Edition

ISBN:9781305080485

Author:John E. McMurry

Publisher:John E. McMurry

Chapter27: Biomolecules: Lipids

Section27.SE: Something Extra

Problem 42AP: Eleostearic acid, C18H30O2, is a rare fatty acid found in the tung oil used for finishing furniture....

See similar textbooks

Similar questions

Eleostearic acid, C18H30O2, is a rare fatty acid found in the tung oil used for finishing furniture. On ozonolysis followed by treatment with zinc, eleostearic acid furnishes one part pentanal, two parts glyoxal (OHC-CHO), and one part 9-oxononanoic acid [OHC(CH2)7CO2H]. What is the structure of eleostearic acid?
Thioglycolic acid, HSCH2CO2H, a substance used in depilatory agents (hair removers) has pKa = 3.42. What is the percent dissociation of thioglycolic acid in a buffer solution at pH = 3.0?
What reagent is necessary to complete the reaction? CH3-CH2-CH-C-OH ? CHỊCH,CH C-0- Na* CH3 CH3 NaO O NaCl O Na O NaOH + H₂O
Which reagent could be used to prepare propanoic acid from propan-1-ol?a.) periodaneb.) mCPBAc.) CrO3/H2SOAd.) Cl2
1. what priority functional group of ff organic compound? a. carboxyl b. hydroxide c. hydroxyl d. carbonyl 2. what group does the ff organic compound belong? a. azo b. diazo c. aromatic d. organosulfur 3. what group does the ff organic compound belong? a. azo b. amines c. diazo d. nitriles
Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…
Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…
Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?
HCN HPO4 2- CN-1 + HPO4-1 Which specie is bronsted base?
OChem help with IUPAC names involving Ph and Bn The phenyl group (Ph-R, C6H5-R) can be formed by removing a hydrogen from benzene and attaching a substituent to where the hydrogen was removed. The benzyl group (abbv. Bn), similar to the phenyl group, is formed by manipulating the benzene ring. In the case of the benzyl group, it is formed by taking the phenyl group and adding a CH2 group to where the hydrogen was removed. Its molecular fragment can be written as C6H5CH2-R, PhCH2-R, or Bn-R. Please provide the IUPAC name for the following: (Ph)2CHC(CH3)2CC(CH2)3CH(Bn)CHO
Draw the structure of the major products if the given compound (Compound A) reacts with BH3:THF, then, H2O2, NaOH
Give a common name (when possible) and a systematic name for each compound.(a) CH3OCH“CH2