92150 Le Chatelier's PrinciplePart 5-Concentration and Temperature Effects on an Equilibrium:Co(H₂O)62+ + 4C1 Co(CI)² + 6H₂OAH=?What color is Co(H₂O)62 in solution?What color is this solution after heating?PinnWhat color is Co(Cl)42 in solution?What color is this solution after water is addd?PinkBased on your observations on heating this mixture, is this reaction exothermic orendothermic? Explain your answer.Exothermic reactionDOCK PinkDarn Plue / PurpleWhat happened to the equilibrium when you added water? Explain your answer keepingin mind that this is an aqueous solution.

Answered: Image /qna-images/answer/a2edf826-792c-45e3-a149-8b3fe9ad5a42.jpg

92 Le Chatelier's Principle Part 5-Concentration and Temperature Effects on an Equilibrium: Co(H₂O)2+ + 4C1 Co(CI)² + 6H₂O AH=? What color is Co(H₂O)62 in solution? What color is this solution after heating? Pinn What color is Co(CI)42 in solution? What color is this solution after water is addd? Dink Based on your observations on heating this mixture, is this reaction exothermic or endothermic? Explain your answer. Exothermic reaction DOUCK Pink Darn Blue/Purple What happened to the equilibrium when you added water? Explain your answer keeping in mind that this is an aqueous solution.

92 Le Chatelier's Principle Part 5-Concentration and Temperature Effects on an Equilibrium: Co(H₂O)2+ + 4C1 Co(CI)² + 6H₂O AH=? What color is Co(H₂O)62 in solution? What color is this solution after heating? Pinn What color is Co(CI)42 in solution? What color is this solution after water is addd? Dink Based on your observations on heating this mixture, is this reaction exothermic or endothermic? Explain your answer. Exothermic reaction DOUCK Pink Darn Blue/Purple What happened to the equilibrium when you added water? Explain your answer keeping in mind that this is an aqueous solution.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 9RQ: What is Le Chteliers principle? Consider the reaction 2NOCI(g)2NO(g)+Cl2(g) If this reaction is at...

See similar textbooks

Similar questions

The equilibrium constant for the dissociation of iodine molecules to iodine atoms I2(g) 2 I(g) is 3.76 103 at 1000 K. Suppose 0.105 mol of I2 is placed in a 12.3-L flask at 1000 K. What are the concentrations of I2 and I when the system comes to equilibrium?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
Suppose a reaction has the equilibrium constant K = 1.7 108 at a particular temperature. Will there be a large or small amount of unreacted starting material present when this reaction reaches equilibrium? Is this reaction likely to be a good source of products at this temperature?
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
What is the law of mass action? Is it true that the value of K depends on the amounts of reactants and products mixed together initially? Explain. Is it true that reactions with large equilibrium constant values are very fast? Explain. There is only one value of the equilibrium constant for a particular system at a particular temperature, but there is an infinite number of equilibrium positions. Explain.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
The decomposition of NH4HS NH4HS(s) NH3(g) + H2S(g) is an endothermic process. Using Le Chateliers principle, explain how increasing the temperature would affect the equilibrium. If more NH4HS is added to a flask in which this equilibrium exists, how is the equilibrium affected? What if some additional NH3 is placed in the flask? What will happen to the pressure of NH3 if some H2S is removed from the flask?
Hydrogen and carbon dioxide react at a high temperature to give water and carbon monoxide. H2(g) + CO2(g) H2O(g) + CO(g) (a) Laboratory measurements at 986 C show that there are 0.11 mol each of CO and H2O vapor and 0.087 mol each of H2 and CO2 at equilibrium in a 50.0-L container. Calculate the equilibrium constant for the reaction at 986 C. (b) Suppose 0.010 mol each of H2 and CO2 are placed in a 200.0-L container. When equilibrium is achieved at 986 C, what amounts of CO(g) and H2O(g), in moles, would be present? [Use the value of Kc from part (a).]
What is Le Chteliers principle? Consider the reaction 2NOCI(g)2NO(g)+Cl2(g) If this reaction is at equilibrium. what happens when the following changes occur? a. NOCI(g) is added. b. NO(g) is added. c. NOCI(g) is removed. d. Cl2(g) is removed. e. The container volume is decreased. For each of these changes, what happens to the value of K for the reaction as equilibrium is reached again? Give an example of a reaction for which the addition or removal of one of the reactants or products has no effect on the equilibrium position. In general, how will the equilibrium position of a gas-phase reaction be affected if the volume of the reaction vessel changes? Are there reactions that will not have their equilibria shifted by a change in volume? Explain. Why does changing the pressure in a rigid container by adding an inert gas not shift the equilibrium position for a gas-phase reaction?