A chemical reaction takes place inside a flask submerged in a water bath. The water bath contains 7.60 kg of water at 29.4 °C. During the reaction 71.4 kJ of heat flows out of the flask and into the bath. Calculate the new temperature of the water bath. You can assume the specific heat capacity of water under these conditions is 4.18 J-g¹K¹. Round your answer to 3 significant digits. °C 4 X S

A chemical reaction takes place inside a flask submerged in a water bath. The water bath contains 7.60 kg of water at 29.4 °C. During the reaction 71.4 kJ of heat flows out of the flask and into the bath. Calculate the new temperature of the water bath. You can assume the specific heat capacity of water under these conditions is 4.18 J-g¹K¹. Round your answer to 3 significant digits. °C 4 X S

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter12: Thermodynamic Processes And Thermochemistry

Section: Chapter Questions

Problem 14P

See similar textbooks

Similar questions

Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5 C and then dropped into a coffee-cup calorimeter containing 75.0 g of water at 21.7 C. When thermal equilibrium is reached, the final temperature is 24.3 C. Calculate the specific heat capacity of titanium.
Dry ice is solid carbon dioxide; it vaporizes at room temperature and normal pressures to the gas. Suppose you put 21.5 g of dry ice in a vessel fitted with a piston (similar to the one in Figure 6.9 but with the weight replaced by the atmosphere), and it vaporizes completely to the gas, pushing the piston upward until its pressure and temperature equal those of the surrounding atmosphere at 24.0C and 751 mmHg. Calculate the work done by the gas in expanding against the atmosphere. Neglect the volume of the solid carbon dioxide, which is very small in comparison to the volume of the gas phase.
The temperature of the cooling water as it leaves the hot engine of an automobile is 240 F. After it passes through the radiator it has a temperature of 175 F. Calculate the amount of heat transferred from the engine to the surroundings by one gallon of water with a specific heat of 4.184 J/g oC.
In the 1880s, Frederick Trouton noted that the enthalpy of vaporization of 1 mol pure liquid is approximately 88 times the boiling point, Tb, of the liquid on the Kelvin scale. This relationship is called Troutons rule and is represented by the thermochemical equation liquid gas H = 88 Tb, joules Combined with an empirical formula from chemical analysis, Troutons rule can be used to find the molecular formula of a compound, as illustrated here. A compound that contains only carbon and hydrogen is 85.6% C and 14.4% H. Its enthalpy of vaporization is 389 J/g, and it boils at a temperature of 322 K. (a) What is the empirical formula of this compound? (b) Use Troutons rule to calculate the approximate enthalpy or vaporization or one mole of the compound. Combine the enthalpy of vaporization per mole with that same quantity per gram to obtain an approximate molar mass of the compound. (c) Use the results of parts (a) and (b) to find the molecular formula of this compound. Remember that the molecular mass must be exactly a whole-number multiple of the empirical formula mass, so considerable rounding may be needed.
A 237-g piece of molybdenum, initially at 100.0 C, is dropped into 244 g of water at 10.0 C. When the system comes to thermal equilibrium, the temperature is 15.3 C. What is the specific heat capacity of molybdenum?
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?