A mixture of gases consists of 0.4 kg of oxygen, 0.7 kg of carbon dioxide, and 0.2 kg of helium. This mixture is maintained at 100 kPa and 27 °C. Determine the apparent molecular weight of this mixture the volume it occupies, the partial volume of the oxygen, and the partial pressure of the helium. ( I

Q: 5: What is the concentration of CT ions in a solution formed by mixing 55 ml. of 0.500 M CaC); and…

A:

Q: Using the table on page 1, answer the following questions. NaCl is [more / less] soluble at low…

A: Solubility Table given is: As per the data given for solubility of NaCl at various temperature NaCl…

Q: Q25: The SO3²- ion has how many total valence electrons? A. 24 B. 26 C. 32 D. 36

A: The electrons present in outer shell of an atom are called valance electrons.  Both Sulfur(S) and…

Q: How many grams of nitric acid are required to react with 2.75 g of copper?

A:

Q: Name the type ligands in the complexes () or L type) and calculate the ligand bond number, electron…

A: Since you have asked a question with multiple subparts we will answer the first three for you. To…

Q: The synthesis: Prepare 25 mL of a 2.0 M solution of FeCl₂ and a 1.0 M FeCl3 solution, both in 2M…

A:

Q: separate bulbs contain ideal gases A and B, respectively. The density of gas A is twice that of gas…

A: Given -> -> Density of gas A is twice that of gas B . -> molecular weight of gas A is half…

Q: 1) A mixture of benzoic acid, para-xylene and benzaldehyde is spotted on a silica gel TLC plate and…

A: A question based on analytical separations that is to be accomplished.

Q: Part 2 Modify the given structure of the starting material to draw the major product. Use the single…

A:

Q: (a) Write the equation for the dissolution of sulphur dioxide in water. For this problem, assume…

A:

Q: 2. Consider the reaction scheme kı A k², 2C k-1 in which A undergoes reversible dimerisation into B…

A: Reversible reaction: A reversible reaction is one that involves a simultaneous transformation of…

Q: A) He C) 3p 16: Which of the following orbitals has the highest energy? B) 4s D) 34 A) 4p 17:A…

A:

Q: A) Write the Henderson-Hasselbalch equation for the acid dissociation reaction of guanine. Identify…

A: Since you have asked a question with multiple sub-parts, we will solve first 3 sub-parts for you.…

Q: 20: Element Re has in its nucleus A. 75 protons, 75 neutrons and 75 electrons C. 130 protons, 75…

A: 185Re   Atomic number of Rhenium (Re) is 72 in a periodic table. Here, Atomic mass of Re is 185

Q: QUESTION 8 What is the molar mass of the [Cu(NH3)4]SO4 H₂O product that you will isolate at end of…

A: Given metal complex is [Cu(NH3)4] SO4.H2O  We have to calculate the molar mass of this metal…

Q: Use the equation for the net reaction that occurs in photosynthesis. 6 CO2 + 6 H2O → C6H1206 + 6 02

A:

Q: Consider two disaccharides OH CH₂OH OH maltose OH CH OH OH - OH OH OH CH₂OH OH fructose OH OH CH OH…

A: A Hemiacetal is formed when one mole of alcohol reacts with carbonyl group that means one alcohol…

Q: ithout doing any detailed calculations (but using a periodic table to give atomic weights), rank the…

A: H2O has three atoms in it i.e two hydrogen atoms and one oxygen atoms. Na has only one atom in it N2…

Q: A gaseous reaction occurs at a constant pressure of 35.0 atmatm and releases 57.8 kJkJ of heat.…

A: According to first law of thermodynamics, the internal energy change of a system is equal to the sum…

Q: Molecular hydrogen (H2) and molecular oxygen (02) can also react to form hydrogen peroxide (H2O2).…

A: Given in following question to form H2O2 by molecule of H2 and O2 how many moles use to form 1 mole…

Q: What is the final temperature (in Celsius) of 610.1 g of water (specific heat = 4.184 j/g Celsius)…

A:

Q: CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2C…

A: CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2C…

Q: You know the equilibrium constant (at 25 °C) for the dissolution of Fe(OH)3(s) Fe³+ + 3 OH¯ is…

A:

Q: Consider the following carbohydrate H- H- H- CH₂OH C=0 -OH -OH -OH CH₂OH What is the classification…

A:

Q: Which term is incorrectly matched with its description? a. Activation Energy / kinetic energy…

A: Answer: This question is based on terminologies related to energy exchange during the chemical…

Q: Draw as many structures as for the formulas below using notation. Determine what the degree of…

A: “Since you have posted a question with multiple sub-parts, we will solve the first three sub-parts…

Q: Compound Description J K L colorless, odorless gas 3-33 g colorless, odorless gas 3.52 g Mass of…

A: To answer following questions, we would first determine the chemical formula of all compounds by…

Q: 5. Epsom salt is commonly purchased in the pharmacy for a variety of uses, anti-inflammatory,…

A:

Q: Give the systematic IUPAC name for the following compound. SHOW ALL WORK PLEASE

A:

Q: Determine the molar mass of the hydrate CaCl2⋅2H2O.CaCl2⋅2H2O. molar mass:   g/mol

A:

Q: HI has a normal boiling point of -35.7 and its ΔvapH is 21.16 KJ/mol. Calculate the molar entropy…

A: Chemical thermodynamics is branch of chemistry in which we deal with amount of heat evolved or…

Q: When 1.34 g of KClO3 was added to 142.07 g of water in a calorimeter, the  temperature dropped by…

A: mole = massmolar mass heat = m * s * ∆Twherem = mass of solutions = specific heat of solution∆T =…

Q: Write the acidic ionization equation for HBr. Be sure to include the proper phases for all species…

A: The Ionization of a general acid HA ,can be written as follows - HA(aq) ---> H+(aq) + A-(aq)

Q: Compute the radius r of an impurity atom that will fit into an FCC (100)  plane (This is called…

A: We need to find Compute the radius r of an impurity atom that will fit into an FCC (100) plane which…

Q: Write the reduction half-cell reaction and their corresponding standard reduction potentials (E°) in…

A:

Q: Write down the names and symbols of all the elements that are metals

A: There are 92 metals in the periodic table.

Q: -33. The decomposition of nitrosyl chloride was studied: 2NO(g) + Cl₂(g) 2NOCI(g) The following data…

A:

Q: Match the following aqueous solutions with the appropriate letter from the column on the right.…

A: Answer: Depression in freezing point of a solution is: ∆Tf=i×Kf×m Here: ∆Tf=depression in freezing…

Q: C. Morphine (an extremely potent analegesic) HO H HO N-CH3 CI- D. Claritin (an antihistamine)

A: we have to calculate IHD for the given molecules and identify the functional groups in the structure…

Q: Convert 3.65 x 1043 micro seconds into kiloyears.

A: INTRODUCTION: It is the step by step conversion process to get microsecond to kiloyears. We have to…

Q: 5. Ytterbium (Yb) has an electron configuration that is an exception to the Aufbau Principle. Based…

A: The  Concept used in taken from INNER TRANSITION ELEMENTS of Inorganic chemistry. First of all we…

Q: A space probe was designed to see 13CO in the atmosphere of Saturn by looking for lines in its…

A: GIVEN: bond length of 13CO is 112.8 pm TO FIND: at what wave number do the first three rotational…

Q: Does decreasing the total energy of the system make the atoms more or less likely to stick together?…

A: Since ,internal energy is a function of temperature . If we decrease internal energy temperature…

Q: Determine the mass in grams of CO2 that are produced by the complete reaction of 10.49 grams of…

A:

Q: Express the equilibrium constant for the following reaction. CH4(g) + 2 O2(g) → CO₂(g) + 2 H₂O(g)…

A: we have to determine the expression for equilibrium constant for the given reaction

Q: Calculate the pH of a 0.42M CH3COOH solution, given that K(CH³COOH) = 1.8x10-5 Data: Kb x Ka = Kw =…

A: Given: Concentration of acid =0.42M  Ka of acid = 1.8 × 10-5 pH = ?

Q: D. 25:The VSEPR model can be used to predict B) bond order A) electronegativity afhabrid orbitals…

A: Q.25)  VSEPR=> (Valence shell electron pair repulsion):- This theory says that there is repulsion…

Q: Problem 3-3 Draw structures corresponding to the following IUPAC names: (b) 4,4-Dimethylpent-2-yne…

A:

Q: Part 1: How many valence electrons does each atom have in its neutral and ground state? Type one…

A: The electrons present in the outermost shell of an atom, which participate in bond formation are…

Q: q Preq Visited 2req [Review Topics] [References] Use the References to access important values if…

A: B.p of ethanol= 78.500 0C B.p of solution= 78.723 0C Kb of ethanol =1.22 0C/m Mass of ethanol=204.5…