a) Pick an electronic device, what elements form part of the device and give an explanation. (e.g. The glass of a phone is an aluminosilicate sheet. It therefore has aluminium and silicon.) b) Give an example of an explosive and write down the chemical formulae or draw the structure?

Q: Why does sodium fluoride have a melting point of 993°C but nitrogen has a melting point of -210°C?

A: Please find your solution below : Melting point of any substance is defined as the temperature at…

Q: Would a solution of ethanol conduct electricity?

A: ethanol is a weak electrolyte that feebly dissociate in a solution or we can say that it remains as…

Q: State Stevenson's rules. Apply this rule to elucidate the structure of inorganic compounds.

A: This Question is based upon Mass Spectrometry.

Q: Why are lithium compounds soluble in organic solvents?

A:

Q: Why is there objection in the use of Hydrogen Sulfide in group cations?

A:

Q: Provide the Lewis structure and name of this molecules

A: a) Since the parent carbon chain is of  6 carbon as shown below. And there are 2 methyl substitutes…

Q: Iodine monochloride and elemental bromine have nearly the same molar mass and liquid density but…

A:

Q: (b) Discuss the silicon crystal as shown in Fig. (a). [2]

A: Semiconductors are those having conductivity between metals and non-metals. Semiconductors include…

Q: How are carbon nanotubes formed? What are some interesting properties and applications for carbon…

A: Carbon Nano Tubes formation: Carbon nanotubes (CNTs) are developed using different methods in the…

Q: Discuss nanocarbons and its three classes: fullerenes, carbon nanotubes, and graphene.

A: Nanocarbons are carbon-based nanomaterials, and have unique physico-chemical properties.

Q: Magnesium oxide exists as Mg2+ O2- and not as Mg*O. Explain.

A: magnesium has atomic number 12 ,so it's electronic configuration is 2,8,2  having two electrons in…

Q: Use a Lewis dot structure to predict the structure of PO43-  Include an analysis of bonding, i.e.…

A: The correct Lewis structure of PO43-

Q: Why is there only a double bond between the oxygen and carbon but not the chlorine?

A: We have to answer why only a double bond is formed between the carbon and oxygen atoms but not…

Q: Explain your understanding about the Biomaterial and its structure compared to the inorganic…

A: A question about biomaterial, inorganic material and the classification of biofuels.

Q: Briefly explain why steel, an alloy of iron, is usedto build the supporting structure of many…

A: Given: Why steel, an alloy of iron, is used to build the supporting structure of many buildings.

Q: Carbon dioxide is non-polar, despite the fact that oxygen is much more electronegative than carbon.…

A: Given : The compound carbon dioxide i.e CO2 is non-polar despite it has high electronegativity…

Q: what type of crystalline solid would form for Br2?

A: Answer: There are four type of crystalline solids: 1. Ionic solids 2. Metallic solids 3. Network…

Q: Why does maleic acid react with mg metal?

A: Maleic acid is a dicarboxylic acid. It is cis- isomer which can attain intra-molecular bonding with…

Q: Nitrogen is found in nature as N2(g). Would you expect phosphorus to be found innature as P2(g)?…

A: Nitrogen has a smaller size due to which it forms p∏-p∏ multiple bonds with itself. It has high bond…

Q: the reaction

A: Bismuth is the metal that belongs to group 15 in the periodic table. It has the atomic number 83 and…

Q: Knowing what you do about Magnesium and oxygen, what type of compound (ionic or covalent) should…

A: Magnesium is a chemical element with atomic number 12. Its electronic configuration is 1s2 2s2 2p6…

Q: The triiodide (I3–), tribromide (Br3–), and trichloride (Cl3–) anions all exist, but the trifluoride…

A: Fluorine,Chlorine,Bromine and iodine all are halogens.They are situated in group 17 of modern…

Q: Predict the chemical formula for the ionic compound formed by Ca2+ and CIO,

A: There is two ion one is Ca^+2 and another is ClO3- ion . We have to predict the chemical formula…

Q: Which of the following compound is a Peroxide? (a) NO, (C)BaO, 20. (b) KO, (d) Mno,

A: Given: Which of the following compound is a peroxide? (a)  NO2                  (b) KO2         (c)…

Q: Iodine monochloride and elemental bromine have nearly the same molar mass and liquid density but…

A: (a) The intermolecular forces of attraction between the molecules are responsible for the boiling…

Q: n/takeAssignment/takeCovalentActivity.do?locator=assignment-take Review Topica) [References) Use the…

A:

Q: With the aid of a diagram, describe the covalent bonds that an oxygen atom with atomic number 8 can…

A: When two or more elements have incomplete octet ,then if they share their valence electrons in such…

Q: What is the chemical formula for both, dichlorine heptabromide and trinitrogen pentaphosphide?

A: Different type of compounds have different formula according to their respective valencies and…

Q: briefly explain why the oleic acid molecules organize themselves into a monolayer?

A: Oleic acid is a fatty acid with the molecular formula CH3(CH2)7CH=CH(CH2)7COOH.

Q: Why carbon does have a larger tendency of catenation than silicon although they have same number of…

A: To explain why carbon has a higher tendency of catenation than silicon even after both have the same…

Q: efine catenation and show this property in carbon by taking an example. Write down at least one name…

A:

Q: What is the only methyl halides which is a liquid

A: Introduction :  The group 17 elements are called halogens and halides are generally the ions of…

Q: Discuss the different types of bonding.  Be detailed and give an example where applicable.

A: The question is based on the concept of chemical bonding. we have to identify different types of…

Q: a) ? - iodine

A: A.  Conversion of cyclopentane to bromocyclopentane via free radical bromination E2 elimination…

Q: provide the fllowing information including the lewis structure and the 3d sketch for NO2- and BrF3

A: Molecular geometry, bond angle can be determined by using VSEPR theory. According to this theory,…

Q: In what sense is acetylene a protonic acid? Explain why its reactions with ammoniacal cuprous…

A: Protonic acid is the compound or molecule that has the ability to produce H+ ions in the solution.…

Q: Calcium Oxide (CaO) makes ionic bond while silicon (Si) makes covalent bond. By considering their…

A: Ionic Bond: Compounds that have ions are known as ionic compounds. These ions are atoms with a net…

Q: what you expect that anions would be physically closer to hydrogen or to oxygen atom of water…

A: In a water molecule, hydrogen has a partial positive charge whereas oxygen atom has partial negative…

Q: Alum is a(n) ……………….. compound which means that in the solid state ……………………. are held together by…

A: In general alum is nothing but hydrated Al2(SO4)3 of different cations (e.g. Na+, K+ etc.).

Q: the structure of

A:

Q: answer these questions with NaOH *State two examples of another substance of the same type with the…

A: 1.) Sodium hydroxide (NaOH) has ionic bonding and the examples similar to it are- a. Magnesium…

Q: The nature of Caesium chloride is?

A: Caesium chloride occurs naturally as carnallite sylvite and kainite. It is an inorganic compound…

Q: Write chemical formula of the following structure. Remember to arrange the element in the correct…

A: Given that : We have to write the chemical formula for the following compound :

Q: Reasoning: Why does reactivity increase down Group 1? Answer the following questions to help you as…

A: The electrons, protons, and neutrons are the basic constituents of an atom. They help in determining…

Q: How is coal form? 2.what are the type of coal?  3.historically the Electricity Supply Industry…

A: Naturally, Coal is formed mostly of Carbon, with a little bit of sulphur, hydrogen, oxygen and…