2,6 A rhodium metal centre undergoes cyclometallation with two units of C=C, what is the expected product of this reaction?O A. 5-membered rhodacycle ring is formedO B. 6-membered rhodacycle ring is formedO C. the two units of C=C are reduced to alkane C-C bond.O D. the two units of C=C are inserted to the rhodium metal centre Why can an organometallic complex perform the reactions such as insertion where normal coordination complex could not perform?O A. Because of the intramolecular pi-electron charge transfer in the ligand.OB.Because of the intermolecular pi-electron charge transfer in the ligand.Because the presence of dorbitals in the metal centre.O D. Because of the metal to ligand pi-electron charge transfer.

Correct choice is option ( A) 5 membered rhodacycle ring is formed.

A rhodium metal centre undergoes cyclometallation with two units of C=C, what is the expected product of this reaction? O A. 5-membered rhodacycle ring is formed O B. 6-membered rhodacycle ring is formed O C. the two units of C=C are reduced to alkane C-C bond. O D. the two units of C=C are inserted to the rhodium metal centre

A rhodium metal centre undergoes cyclometallation with two units of C=C, what is the expected product of this reaction? O A. 5-membered rhodacycle ring is formed O B. 6-membered rhodacycle ring is formed O C. the two units of C=C are reduced to alkane C-C bond. O D. the two units of C=C are inserted to the rhodium metal centre

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 4ALQ

See similar textbooks

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
The complex trans-[Co(en)2Cl2]+ undergoes substitution of Cl- by H2O slower than the complex trans-[Co(en)2Cl2]. explain the reason for the difference
Determine the formula for a complex ion with metal ion X+2 and ligand Y-1 from the following Job's plot. A) XY+1 B) XY4-2 C) XY6-4 D) XY5-3 E) XY2 F) XY3-1
Association reaction is less preferable than dissociation reaction in forming an octahedral complex especially for late transition metals because
Which complex(es) is/are NOT stable? * [RhCl3] RhCl3 & [RhHCl3(PMe3)2]¯ [RhHCl3(PMe3)2]¯ [RhHCl3]3¯
Tp 2Fe is a low-spin Fe(II) complex with Fe-N bonds of 1.97 Å. Tp Ph 2Fe is a similar complex that is high-spin Fe(II) and has Fe-N bonds of 2.25 Å. Explain why the high-spin complex would have longer (i.e., weaker) Fe-N bonds than the low-spin complex.
The complex [FeBr6]-4 exhibits π-donor behavior. Using ligand field theory, draw the molecular orbital diagram mixing the d-orbitals on the metal and the molecular orbitals on the ligands and fill in the available electrons. What is the nature of the t2g orbitals that are part of Δo, bonding, antibonding, or non-bonding? Explain your answer. Is this molecule high spin or low spin? Explain your answer.
Calculate the electron in the following complexes. a,b,c,d
Explain why the complex [Fe(H2O)6]3+ has Do = 14,000 cm-1, while [Fe(H2O)6]2+ has Do = 9,350 cm-1.
(c) In the given complex of [Fe(CO)] having CO ligand, carbon and oxygen both having lone pair of electrons, but carbon lone pair take part in bonding with the central Fe atom rather than oxygen. Explain why in details? (ii) The bond distance and angle in SO2Cl2 and S2Cl2 and how many lone pairs are in ICL4-??