A sample of PCI, was placed in a container and the following reaction was allowed to come to equilibrium. PCI (g) =PC13(g) + Cl₂(g) The equilibrium concentrations were found to be [PCI,] = 4.55 M and [PCI3] = [Cl₂] = 0.437 M. Calculate the equilibrium constant, Kc, for the reaction.

A sample of PCI, was placed in a container and the following reaction was allowed to come to equilibrium. PCI (g) =PC13(g) + Cl₂(g) The equilibrium concentrations were found to be [PCI,] = 4.55 M and [PCI3] = [Cl₂] = 0.437 M. Calculate the equilibrium constant, Kc, for the reaction.

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter17: Equilibrium

Section: Chapter Questions

Problem 19QAP: . Suppose that for the reaction PCl5(g)PCl3(g)+Cl2(g)it is determined, at a particular temperature....

See similar textbooks

Related questions

Q: Kry’s experiment involves preparing oxygen gas from the decomposition of solid potassium chlorate as…

Q: 30) Which of the following reactions will not produce an ester А) B) А Е) F OH ОН ОН ОН + + + CH₂N₂…

A: When acidic acid is react with alcohol then it give ester as a major product.

Q: 4) Identify the reagents/conditions necessary to carry out the following transformations CH3CH₂OH…

A: When ethanol is oxidised one step then it is converted to ethanal. And further oxidation results…

Q: If 10 units of Mg(CIO3)2 are dissolved in water how may units of ions will be in solution? O 10 20…

Q: Specify the electron configuration for V³+.

A: Since, To write the electronic configuration, we use Aufbau principle. According to this, Electron…

Q: 1. The multifunctional molecule below can undergo both nucleophilc addition reactions and…

A: In the given molecule, the free aldehyde group and the free ketone group will undergo Nucleophilic…

Q: Which of the following reactions of antimony can be described as single displacement? Select…

A: A single displacement reaction is that Reaction in which one element is replaced by another element.…

Q: 4 In the prior problem set we used the regular solution model to show that oil and water do not mix…

A: Solution: In this problem we have to calculate ΔSMIX , ΔHMIX

Q: Check the box under each structure in the table that is an enantiomer of the molecule shown below.…

A: Here we are required to find the enantiomer of the given molecule.

Q: 13) Complete the following reaction + O-C₂H5 2 eq. PhMgBr 1) Et₂0 2) H3O+

A: Esters react with Phenyl magnesium bromide in dry ether followed by hydrolysis give tertiary…

Q: Rank the following diatomic species of carbon in order of bond length and bond strength. A. C₂ B.…

A: Higher the bond order lower will be the bond length and higher bond strength.

Q: Select the gas that would have the highest average molecular speed. Assume all are at the same…

A: Average molecular speed is inversely proportional to square root of molecular mass

Q: 14) Do a retrosynthetic analysis for the following target molecule. Identify the synthetic…

Q: The following alkene is treated with one equivalent of N-Bromosuccinimide in dichloromethane in the…

Q: In the ground-state electron configuration of Fe³+, how many unpaired electrons are present? Express…

A: Unpaired electron can be figure out from electronic configuration.

Q: How is the mass of water in a hydrate measured? Group of answer choices The mass of the hydrate is…

A: Hydrated water is a form of mositure which is present when we prepared compound.

Q: QUESTION 3 You were tasked to determine the percentages of citric acid in the freshly squeezed and…

A: Mass of freshly squeezed lemon juice of 25ml is 25.6 Mass(25ml juice) = 25.6g Percentage ( C6H8O7)=…

Q: [Cu] [Cu] Construct the expression for Kc for the following reaction. 2 Cut (aq) + Zn(s) = 2 Cu(s) +…

A: In the rate constant formula , Concentration of solid and liquids are not considered .

Q: Draw a structural formula for the product of this Diels-Alder reaction, including all stereoisomers…

Q: What volume (in mL) of a 0.100 M HNO3 solution is required to completely react with 43.5 mL of a…

Q: Name this compound.

Q: Product C CHOICES: MAT BAT cold, dilute, neutral KMnO4 OH Product A is Product B is Product C is H₂,…

Q: Propose a route to 1-butyl-4-nitrobenzene, using benzene as your only aromatic starting material. A…

Q: Balance the following redox equation and determine the sum of the coefficients of the reactants and…

A: Redox reaction is the combination of oxidation and reduction reaction. It means that, When oxidation…

Q: Which is the anti-conformer of pentane? O O O O H H H H CH₂CH3 H CH₂ AMA CH₂CH3 H AYA LID AMA AYA H…

A: We can show newmann projection of alkanes in different way. In alkane C-C bond can easily rotate.…

Q: What are the structures of the products below? Type the letter labels of your answers. Type NONE if…

Q: ma-Q 1) NaH 2) H₂O -XX OH (c) (d) H₂N NO₂ HS. H NO₂ hint: consider that NO₂ can stabilize an…

A: This reaction follows Cyclization Reaction. In the first step Strong Base NaH abstracts proton. Then…

Q: Enter the complete ionic equation to show the reaction of aqueous lead(II) nitrate with aqueous…

A: Given that, there is a reaction between aqueous lead(ll) nitrate (Pb(NO3)2 with aqueous potassium…

Q: How is the equivalence point experimentally determined? Group of answer choices Color change from…

A: Equivalence point is a point where the chemical reaction comes to an end while the endpoint is the…

Q: (c) Provide the reagents required and the intermediate compounds involved in the following…

Q: Supply the IUPAC name of the following structure. Type your answer on the blank. COOH H₂N CH₂CH₂CH3…

Q: Select the two Brønsted-Lowry acids in the equation: HCO3(aq) + H₂O(aq) H₂CO3(aq) + OH(aq)

A: Bronsted-Lowry Acid-Base Theory: According to this theory acid and base can be classified on the…

Q: Experiment 1 2 3 4 HgCl₂ (M) 0.105 0.105 0.052 0.052 C₂04² (M) b. What is the rate constant k? 0.15…

Q: H3C CH3 CH3 H3C H3C LOCH 3 н H CH3 Lou ОН H3C H3C OCH 3 H₂CCN CH3 CN

Q: Show the calculation of the molecular weight of an unknown gas if the rate of effusion of carbon…

A: Here we have used Graham's law of effusion- it states that the rate of effusion of a gas is…

Q: F CH3 H OH H Br Br when More Br Br CH3 Br HO NH₂ Br Ch NH CH3 ▸

Q: 1. Identify a neutral atom, a negatively charged atom (anion) and a positively charged atom (cation)…

Q: Which of the following images shows a distant object moving towards Earth? The continuous spectra…

A: To answer: Which of the following images shows a distant object moving towards Earth?

Q: Find Kc for the reaction 2 NO(g) + O2(g) ↔ 2NO2(g), given Kp = 2.2 x 1012 @ 25 °C. R = 0.08206…

Q: Write the equilibrium constant expressions, K, and predict the position of equilibrium for the…

Q: Hybrid Orbitals Hybrid orbitals are formed by combining the valence orbitals on an atom. For each…

A: sp3 hybridised orbital have 4 lobes sp2 will have 3 hybridised orbital And sp will have 2 hybridised…

Q: Calculate the solubility (in g/L) of CaSO4(s) in 0.450 M Na2SO4(aq) at 25°C. The ?sp of CaSO4 is…

Q: 1. If 8.5 g of pure ammonium phosphate, (NH₂),PO,(s), is dissolved in distilled water to make 400 mL…

A: Dear student , since you have posted multiple questions we are allowed to solve only first question…

Q: For the reaction: N2(g) + 2O2(g) + 16.2 kJ ➜ 2 NO2(g) As nitrogen reacts with oxygen, the heat of…

A: Nitrogen dioxide = N2O Heat of formation of N2 = 0 kJ Heat of formation of O2 = 0 kJ If heat is…

Q: Is the following compound aromatic, antiaromatic, nonaromatic, or is it not possible to tell? O a.…

Q: Which of the following structures is the cis configuration of 1,3-dimethylcyclohexane with both…

A: We can solve this question by considering the position of the substituents in the given compounds.

Q: A skeletal structure for perchlorate (CIO) is shown below. Starting from this structure, complete…

Q: Time OS 7.05 REACTION RATES 26 S 43 S 65 S 86 s Concentration 1.60 M 0.80 M 0.40 M 0.20 M 0.10 M A…

A: These are the graphical representations of the reactions. In which a product is formed and the…

Q: (c) H₂N S HS. -N H

A: C. Given that, a transformation reaction is We have to give the mechanism for the above…

Q: Write the name of the functional group indicated in the following molecule.

Question

100%

A sample of PCI, was placed in a
container and the following
reaction was allowed to come to
equilibrium.
PCI (g) =PC13(g) + Cl₂(g)
The equilibrium concentrations
were found to be [PCI,] = 4.55 M
and [PCI3] = [Cl₂] = 0.437 M.
Calculate the equilibrium
constant, Kc, for the reaction.
Tap here or pull up for additional resources

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Nitrogen, hydrogen, and ammonia are in equilibrium in a 1000-L reactor at 550 K. The concentration of N2 is 0.00485 M, H2 is 0.022 M, and NH3 is 0.0016 M. The volume of the container is halved, to 500 L. (a) Calculate the equilibrium constant. (b) Define y as the change in the concentration of nitrogen in the 500-L container. Is y positive or negative? (c) Write the iCe table and express the equilibrium constant in a polynomial in terms of y.
Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were allowed to react at 300. K. At equilibrium the total pressure was 110.5 torr. The reaction is 2NO(g)+Br2(g)2NOBr(g) a. Calculate the value of Kp. b. What would be the partial pressures of all species if NO and Br2, both at an initial partial pressure of 0.30 atm, were allowed to come to equilibrium at this temperature?
In Table 12.1 (←Sec. 12-3a) the equilibrium constant for the reaction ⇋ is given as 4.2 × 1052. If this reaction is so product-favored, why can large piles of yellow sulfur exist in our environment (as they do in Louisiana and Texas)?
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
For the reaction 2NO(g)+2H2(g)N2(g)+2H2O(g) it is determined that, at equilibrium at a particular temperature, the concentrations are as follows: [NO(g)] = 8.1 103 M, [H2(g)] = 4.1 105 M, [N2(g)] = 5.3 102 M, and [H2O(g)] = 2.9 103 M. Calculate the value of K for the reaction at this temperature.
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
The density of trifluoroacetic acid vapor was determined at 118.1 C and 468.5 torr, and found to be 2.784 g/L. Calculate KC for the association of the acid.