12.2 A scientist measures the standard enthalpy change for the following reaction to be -223.2 kJ :2502(g) + 02(g)→2503(g)Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of SO3(g) iskJ/mol.

Answered: Image /qna-images/answer/c40b12a7-982d-493f-a1b4-1cd7ffa0e893.jpg

A scientist measures the standard enthalpy change for the following reaction to be -223.2 kJ : 250-(g) + O2(g)–→2503(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of SO2(g) is kJ/mol.

A scientist measures the standard enthalpy change for the following reaction to be -223.2 kJ : 250-(g) + O2(g)–→2503(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of SO2(g) is kJ/mol.

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter5: Thermochemistry

Section: Chapter Questions

Problem 5.72QE: In the process of isolating iron from its ores, carbon monoxide reacts with iron(III) oxide, as...

See similar textbooks

Related questions

Q: A scientist measures the standard enthalpy change for the following reaction to be -171.6 kJ :…

A: Given;

Q: A scientist measures the standard enthalpy change for the following reaction to be -910.7 kJ:…

A: Standard enthalpy (∆H°f) of formation of a substance is furnished as the enthalpy change associated…

Q: A scientist measures the standard enthalpy change for the following reaction to be -1142.2 kJ:…

A: Standard enthalpy of formation of H2S (g) = -20.1 kJ/molStandard enthalpy of formation of O2 (g) = 0…

Q: (a) Elemental boron reacts with fluorine to form BF3, a gas. Write a balanced chemical equation for…

A: (a) Elemental boron react with fluorine to form BF3 , which is a gas. The reaction equation is ,…

Q: A scientist measures the standard enthalpy change for the following reaction to be -1053.4 kJ :…

Q: If ΔHr for the following reaction is -36.40 kJ/mol, a) what is the enthalpy of formation of HBr(g)?…

A: a. The enthalpy of the reaction can be related to enthalpy of formation of the involved species as:…

Q: Nitric oxide (NO) can be formed from nitrogen, hydrogen and oxygen in two steps. In the first step,…

A: The reactions given are, 1) N2 (g) + 3 H2 (g) -------> 2 NH3 (g) ΔH = -92…

Q: A scientist measures the standard enthalpy change for the following reaction to be 14.5 kJ: 2CO2(g)…

Q: A scientist measures the standard enthalpy change for the following reaction to be 16.5 kJ :CO(g) +…

Q: A scientist measures the standard enthalpy change for the following reaction to be -138.8 kJ : H2(g)…

A: The given reaction is as follows: H2(g)+C2H4(g) → C2H6(g) The standard enthalpy change for the…

Q: A scientist measures the standard enthalpy change for the following reaction to be -1142.2 kJ:…

Q: A scientist measures the standard enthalpy change for the following reaction to be -29.5 kJ: I2(g)…

Q: A scientist measures the standard enthalpy change for the following reaction to be -601.8 k) : 20(g)…

A: Enthalpy of a formation This is refers to the change in enthalpy for the formation of one mole of a…

Q: A scientist measures the standard enthalpy change for the following reaction to be -773.2 k) :…

Q: A scientist measures the standard enthalpy change for the following reaction to be -820.7 kJ…

Q: There are all one question. A scientist measures the standard enthalpy change for the following…

A: Standard enthalpy of formation, ΔH◦f – NH3 = -46.1 kJ/mol H2O (l) = -285.8 kJ/mol H2 (g) = 0 kJ/mol…

Q: A scientist measures the standard enthalpy change for the following reaction to be -888.5 kJ :…

Q: A scientist measures the standard enthalpy change for this reaction to be -1149.8 kJ/mol. 2H,S(g) +…

A: Consider the given reaction is as follows; 2 H2S g + 3 O2g → 2 H2Ol + 2 SO2g…

Q: A scientist measures the standard enthalpy change for the following reaction to be -956.8 kJ:4NH3(g)…

A: Given: 4NH3(g) + 5 O2(g)4NO(g) + 6 H2O(g) ΔH= –956.8 KJ ΔHf of NH3 = –46.11 KJ ΔHf of O2 = 0 KJ ΔHf…

Q: Propane (C3H8) burns according to the following balanced equation: C3H8(g)+5O2(g)→3CO2(g)+4H2O(g)…

A: The given combustion reaction is given below : C3H8(g) + 5O2(g) → 3CO2(g) + 4H2O(g) Given…

Q: A scientist measures the standard enthalpy change for the following reaction to be -146.4 kJ:…

A: The standard enthalpy of formation of a compound is the enthalpy change that occurs when 1 mole of…

Q: The enthalpy of combustion of solid carbon to form carbon dioxide is - 393.7 kg / m * o * l…

A: Given, Enthalpy of combustion of solid carbon to form carbon dioxide is -393.7 kJ/mol. Carbon…

Q: enthalpy change for the following reaction to be -826.6 kJ : Fe2O3(s) + 2 Al(s)Al2O3(s) + 2 Fe(s)…

A: Heat of reaction is defined as difference of energy of product and energy of Reactant. If heat of…

Q: A scientist measures the standard enthalpy change for the following reaction to be 209.8 kJ :…

A: Given: CH4(g) + H2O(g) --> 3H2(g) + CO(g) ∆H=209.8 kJ ∆H = ∑∆Hf (product) -∑∆Hf (Reactant) 209.8…

Q: A scientist measures the standard enthalpy change for the following reaction to be -145.7 kJ :…

A: The enthalpy of the reaction is considered as the state function that is it depends only on the…

Q: A scientist measures the standard enthalpy change for the following reaction to be -679.4 kJ :…

A: The given chemical reaction is as follows: 2NH3(g) + 2O2(g) → N2O(g) + 3H2O(l) ,…

Q: A scientist measures the standard enthalpy change for the following reaction to be 4.4 k) : Fe(s) +…

Q: A scientist measures the standard enthalpy change for the following reaction to be -967.6 kJ:…

A: Given: The reaction is as follows: 4NH3(g) + 5 O2(g)-------->4NO(g) + 6 H2O(g) The standard…

Q: A scientist measures the standard enthalpy change for the following reaction to be -780.8 kJ :…

A: The difference between the change in enthalpy of products and the reactants is known as change in…

Q: A scientist measures the standard enthalpy change for the following reaction to be -168.0 kJ:…

Q: A scientist measures the standard enthalpy change for the following reaction to be -129.8 kJ :…

A: The given chemical reaction is as follows 4HCl(g) + O2(g)------->2H2O(g) + 2 Cl2(g)

Q: A scientist measures the standard enthalpy change for the following reaction to be -52.7 k) :…

Q: A scientist measures the standard enthalpy change for the following reaction to be -1057.0 kJ :…

Q: A scientist measures the standard enthalpy change for the following reaction to be -57.0 kJ:…

A: Given balanced chemical equation, Ca(OH)2(aq) + 2 HCl(aq) → CaCl2(s) + 2 H2O(l) The enthalpy change…

Q: A scientist measures the standard enthalpy change for the following reaction to be -559.7 kJ :…

A: The given chemical reaction is, H2COg+O2g→CO2g+H2Ol The standard enthalpy change of the above…

Q: A scientist measures the standard enthalpy change for the following reaction to be 11.0 kJ…

A: Standard Enthalpy change of a reaction is the sum of the standard enthalpies of products minus the…

Q: A scientist measures the standard enthalpy change for the following reaction to be -901.8 k) :…

A: Given, the standard enthalpy change for this reaction = -901.8 kJ We have to calculate the standard…

Q: A scientist measures the standard enthalpy change for this reaction to be 134.5 kJ/mol: Fe2O3(s) + 3…

A: The expression of change in enthalpy is shown below:

Q: A scientist measures the standard enthalpy change for the following reaction to be -348.6 kJ :…

A: The given reaction is : 2Na(s) + 2H2O(l) → 2NaOH(aq) + H2(g) The standard enthalpy change for…

Q: the standard enthalpy change for the following reaction to be -896.4 kJ : 4NH3(g) + 5 O2(g)4NO(g) +…

A: Given, 4 NH3(g) + 5 O2(g) ------> 4 NO(g) + 6 H2O(g) ∆H0Reaction = -896.4 kJ The standard…

Q: determine the enthalpy change for the complete combustion of one mole of ethane with oxygen gas to…

Q: A scientist measures the standard enthalpy change for the following reaction to be 209.4 kJ : CHĄ(g)…

A: Given chemical equation: CH4g+H2Og→3H2g+COg

Q: A scientist measures the standard enthalpy change for the following reaction to be -67.6 kJ :…

A: The expression for the calculation of change in enthalpy is shown below: where; ∆Hproducts =…

Q: A scientist measures the standard enthalpy change for the following reaction to be -901.4 kJ:…

Q: A scientist measures the standard enthalpy change for the following reaction to be -104.0 kJ : CO(g)…

A: The given chemical reaction is as follows: CO(g) + Cl2(g) → COCl2(g) ∆rH°=-104 kJ The…

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction? CO(g) +…

A: The reaction given is Standard enthalpies of formation ΔHof of species are 1) ΔHof (CO(g)) =…

Q: A scientist measures the standard enthalpy change for the following reaction to be -234.6 k) :…

A: Answer: To solve this question we have to use the relation between enthalpies of formation of…

Q: A scientist measures the standard enthalpy change for the following reaction to be -737.2 kJ :…

A: 2CO (g) + 2NO (g) → 2CO2 (g) + N2 (g) The standard enthalpy change for the reaction is : - 737.2 KJ…

Q: A scientist measures the standard enthalpy change for the following reaction to be -48.4 kJ:…

A: Data taken using appendix are standard enthalpy of formation of CaCl2(s) = -795.4 kJ/mol standard…

Q: A scientist measures the standard enthalpy change for the following reaction to be -876.3 kJ:…

A: Solution:- Balanced chemical reaction:- 2NH3(g) + 3N2O(g) → 4N2(g) + 3H2O(g) ∆Hf = -876.3 kJ…

Question

12.2

A scientist measures the standard enthalpy change for the following reaction to be -223.2 kJ :
2502(g) + 02(g)→2503(g)
Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of SO3(g) is
kJ/mol.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
The standard molar enthalpy of formation of diborane, B2H6(g), cannot be determined directly because the compound cannot be prepared by the reaction of boron and hydrogen. It can be calculated from other enthalpy changes, however. The following enthalpy changes can be measured. 4 B(s) + 3 O2(g) 2 B2O3(s) rH = 2543.8 kJ/mol-rxn H2(g) + O2(g) H2O(g) rH = 241.8 kl/mol-rxn B2H6(g) + 3 O2(g) B2O3(s) + 3 H2O(g) rH = 2032.9 kJ/mol-rxn (a) Show how these equations can be added together to give the equation for the formation of B2H6(g) from B(s) and H2(g) in their standard states. Assign enthalpy changes to each reaction. (b) Calculate fH for B2H6(g). (c) Draw an energy level diagram that shows how the various enthalpies in this problem are related. (d) Is the formation of B2H6(g) from its elements exo- or endothermic?
A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.
The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.
Assume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)
The Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?
In the process of isolating iron from its ores, carbon monoxide reacts with iron(III) oxide, as described by the following equation: Fe2O3(s)+3CO(g)2Fe(s)+3CO2(g)H=24.8kJ The enthalpy change for the combustion of carbon monoxide is 2CO(g)+O2(g)2CO2(g)H=566kJ Use this information to calculate the enthalpy change for the equation 4Fe(s)+3O2(g)2Fe2O3(s)H=?
Methanol (CH3OH) has also been proposed as an alternative fuel. Calculate the standard enthalpy of combustion per gram of liquid methanol, and compare this answer to that for ethanol in Exercise 87.
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.