A statement of the second law of thermodynamics is that a. energy is conserved in a chemical reaction. b. the entropy of the universe is continually increasing. c. the enthalpy of reaction is the difference between product and reactant enthalpies. d. spontaneous reactions are always exothermic. e. the Gibbs free energy is a function of both enthalpy and entropy.

A statement of the second law of thermodynamics is that a. energy is conserved in a chemical reaction. b. the entropy of the universe is continually increasing. c. the enthalpy of reaction is the difference between product and reactant enthalpies. d. spontaneous reactions are always exothermic. e. the Gibbs free energy is a function of both enthalpy and entropy.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter16: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 1ALQ: For the process A(l) A(g), which direction is favored by changes in energy probability? Positional...

See similar textbooks

Similar questions

What happens to the entropy of the universe during a spontaneous process?
1. For the reaction 2 Hg(l) + O2(g) → 2 HgO(s), ∆rH° = 181.6 kJ/mol-rxn. What is the enthalpy change to decompose 1.00 mol of HgO(s) to O2(g) and Hg(l)? 3633 kJ −90.8 kJ 90.8 kJ 363.3 kJ
How does the second law of thermodynamics explain a spontaneous change in a system that becomes more ordered when that process is exothermic?
For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
For the process A(l) A(g), which direction is favored by changes in energy probability? Positional probability? Explain your answers. If you wanted to favor the process as written, would you raise or lower the temperature of the system? Explain.
9.54 The phase change between graphite and diamond is difficult to observe directly. Both substances can be hurned, however. From these equations, calculate H for the conversion of diamond into graphite. C(s,graphite)+O2(g)CO2(g) H= -393.51 kJ C(s,diamond)+O2(g)CO2(g) H= -395.94 kJ
What is the second law of thermodynamics? For any process, there are four possible sign combinations for Ssys and Ssurr. Which sign combination(s) always give a spontaneous process? Which sign combination(s) always give a non-spontaneous process? Which sign combination(s) may or may not give a spontaneous process?
In a coffee-cup calorimeter, 1.60 g NH4NO3 is mixed with 75.0 g water at an initial temperature of 25.00C. After dissolution of the salt, the final temperature of the calorimeter contents is 23.34C. Assuming the solution has a heat capacity of 4.18 J/C g and assuming no heat loss to the calorimeter, calculate the enthalpy change for the dissolution of NH4NO3 in units of kJ/mol.
Thermite reactions have been used for welding metal parts such as railway rails and in metal refining. One such thermite reaction is Fe2O3(s)+2Al(s)Al2O3(s)+2Fe(s). Is the reaction spontaneous at room temperature under standard conditions? During the reaction, the surroundings absorb 851.8 kJ/mol of heat.
When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
From the data given in Appendix I, determine the standard enthalpy change and the standard free energy change for each of the following reactions: (a) BF3(g)+3H2O(l)B(OH)3(s)+3HF(g) (b) BCl3(g)+3H2O(l)B(OH)3+3HCl(g) (c) B2H6(g)+6H2O(l)2B(OH)3(s)+6H2(g)