A student ran the following reaction in the laboratory at 658 K: 2 NH3 (g) N2 (g) + 3 H2 () When she introduced 7.58x102 moles of NH3 (g) into a 1.00 liter container, she found the equilibrium concentration of H (g) to be 0.105 M. Calculate the equilibrium constant, Ke, she obtained for this reaction. K. =

A student ran the following reaction in the laboratory at 658 K: 2 NH3 (g) N2 (g) + 3 H2 () When she introduced 7.58x102 moles of NH3 (g) into a 1.00 liter container, she found the equilibrium concentration of H (g) to be 0.105 M. Calculate the equilibrium constant, Ke, she obtained for this reaction. K. =

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter17: Equilibrium

Section: Chapter Questions

Problem 19QAP: . Suppose that for the reaction PCl5(g)PCl3(g)+Cl2(g)it is determined, at a particular temperature....

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
. At high temperatures, elemental nitrogen and oxygen react with each other to form nitrogen monoxide. N2(g)+O2(g)2NO(g)Suppose the system is analyzed at a particular temperature, and the equilibrium concentrations arc found to be [N2]=0.041M. [O2]=0.0078M, and [NO]=4.710M. Calculate the value of K for the reaction.
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.
The following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1
Describe a nonchemical system that is not in equilibrium, and explain why equilibrium has not been achieved.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
. Suppose that for the reaction PCl5(g)PCl3(g)+Cl2(g)it is determined, at a particular temperature. that the equilibrium concentrations are [PCl5(g)]=0.0711M,[PCl3(g)]=0.0302M, and [Cl2(g)]=0.0491M. Calculate the value of K for he reaction at this temperature.
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The equilibrium constant for the dissociation of iodine molecules to iodine atoms I2(g) 2 I(g) is 3.76 103 at 1000 K. Suppose 0.105 mol of I2 is placed in a 12.3-L flask at 1000 K. What are the concentrations of I2 and I when the system comes to equilibrium?
Write the expression of the reaction quotient for the ionization of HOCN in water.
The atmosphere consists of about 80% N2 and 20% O2, yet there are many oxides of nitrogen that are stable and can be isolated in the laboratory. (a) Is the atmosphere at chemical equilibrium with respect to forming NO? (b) If not, why doesnt NO form? If so, how is it that NO can be made and kept in the laboratory for long periods?