A student ran the following reaction in the laboratory at 643 K: 2HI(g) H2(g) + I2(g) When she introduced 0.367 moles of HI(g) into a 1.00 liter container, she found the equilibrium concentration of HI(g) to be 0.294 M. Calculate the equilibrium constant, Kc, she obtained for this reaction

A student ran the following reaction in the laboratory at 643 K: 2HI(g) H2(g) + I2(g) When she introduced 0.367 moles of HI(g) into a 1.00 liter container, she found the equilibrium concentration of HI(g) to be 0.294 M. Calculate the equilibrium constant, Kc, she obtained for this reaction

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter19: The Chemistry Of The Main-group Elements

Section: Chapter Questions

Problem 60QRT

See similar textbooks

Related questions

Q: A student ran the following reaction in the laboratory at 1098 K: 2 S03 (g) 2 So2 (g) + 02 (g) When…

A: 1.) To calculate equilibrium constant , we first need to calculate equilibrium concentrations of all…

Q: A student ran the following reaction in the laboratory at 389 K: CHa(9) + CCa(9) = 2CH,Cl(9) When…

Q: A student ran the following reaction in the laboratory at 617 K: Co(g) + Cl2(g) = cocl2(g) When she…

Q: A student ran the following reaction in the laboratory at 434 K: PCl5(g) PCl3(g) + Cl2(g) When she…

A: Given equation: PCl5 (g) ⇌ PCl3 (g) + Cl2 (g) The initial number of moles of PCl5(g) = 1.75 moles…

Q: A student ran the following reaction in the laboratory at 271 K: 2NO(g) + Br2(g) = 2NOBR(g) When she…

Q: A student ran the following reaction in the laboratory at 674 K: N2(g) + 3H2(g) = 2NH3(g) When she…

Q: A student ran the following reaction in the laboratory at 731 K: H2(g) + I2(g) = 2HI(g) When she…

A: Kc is the reaction quotient at equilibrium

Q: A student ran the following reaction in the laboratory at 247 K: 2NOBr(g)2NO(g) + Bry(g) When she…

A: For 1 L solution molarity is equal to moles. Using ICE table , we can find out Kc

Q: The equilibrium constant, K, for the following reaction is 1.80x10 2 at 698 K. 2HI(g) H,(9) + I2(g)…

Q: A student ran the following reaction in the laboratory at 507 K: PCI,(g) + Cly(g) PC(g) When she…

A: Given: Initial moles of PCl3 = 0.172 mol Initial moles of Cl2 = 0.208 mol volume of container = 1.0…

Q: The equilibrium constant, K., for the following reaction is 1.80×10² at 698 K. 2HI(g)=H2(g) + I½(g)…

A: Given, moles of HI = 0.256mol Kc = 0.0180

Q: A student ran the following reaction in the laboratory at 579 K: CO(g) + Cl2(g)=COCl,(g) When she…

A: Concentration of a chemical species (M) in a solution is obtained by dividing the number of moles of…

Q: A student ran the following reaction in the laboratory at 668 K: H2(g) + I2(g) 2HI(g) When she…

A: The concentration of a solution can be defined in terms of molarity as the ratio of the amount of…

Q: A student ran the following reaction in the laboratory at 427 K: PCl5(g) PCl3(g) + Cl2(g) When she…

A: PCl5(g) → PCl3(g) + Cl2(g)Initial 4.21 M 0 0 Initial…

Q: A student ran the following reaction in the laboratory at 284 K: 2NO(g) + Br2(g) = 2NOBr(g) When she…

Q: A student ran the following reaction in the laboratory at 658 K: 2 NH3 (g) N2 (g) + 3 H2 () When she…

Q: The equilibrium constant, K., for the following reaction is 83.3 at 500 K. PC|3(g) + Cl2(g) PPC!5(g)…

A: Given, Volume = 1.00 L Moles of PCl3 = 0.257 moles

Q: For the reaction 2 NH, (g) 3H,(g) + N,(g) the equilibrium concentrations were found to be [NH,] =…

A: Given: A reaction, 2 NH3(g)⇌3 H2(g)+N2(g) Concentration of NH3, [NH3]=0.250 M Concentration of H2,…

Q: Peptide decomposition is one of the key processes of digestion, where a peptide bond is broken into…

A: In our food protein are present and it's dissociation to amino acids takes place step by step.…

Q: A student ran the following reaction in the laboratory at 705 K: H2(g) + I2(g) =2HI(g) When she…

A: Equilibrium constant is the ratio of equilibrium concentration of product to the equilibrium…

Q: Consider the following reaction. CO(g)+2H2(g)⇄CH3OH(g) A mixture of this reaction at a certain…

A: Initial concentration of [CO]= 0.125 M Initial concentration of [H2] = 0.275 M Using ICE table ,

Q: A student ran the following reaction in the laboratory at 642 K: 2HI(g) H2(g) + I2(g) When she…

A: Let us first calculate the initial concentration of HI, [HI] =…

Q: The equilibrium concentrations for the reaction between carbon monoxide and molecular chlorine to…

A: using the given information to find kc then to find kp.

Q: A student ran the following reaction in the laboratory at 659 K: 2 NH3 (9) N₂ (9) + 3 H₂ (9) When…

Q: A student ran the following reaction in the laboratory at 244 K: 2NOBr(g) =2NO(g) + Br2(g) When she…

Q: A student ran the following reaction in the laboratory at 666 K:2NH3(g) N2(g) + 3H2(g)When she…

Q: A student ran the following reaction in the laboratory at 565 K: Co(g) + Cl2(g) = cocl2(g) When she…

A: Recall the given reaction : CO (g) + Cl2 (g) <------> COCl2 (g) The equilibrium…

Q: A student ran the following reaction in the laboratory at 566 K: CO(g) + Cl2(g) = COC2(g) When she…

Q: A student ran the following reaction in the laboratory at 1116 K: 2502(g) + 02(g) 2503(g) When she…

Q: Hypochlorous acid (HOCI) is produced by bubbling chlorine through an agitated suspension of…

A: The equilibrium reaction is:

Q: A student ran the following reaction in the laboratory at 375 K: CH4(g) + CCI4(g) = 2CH2CI2(g) When…

Q: The equilibrium constant, K, for the following reaction is 1.20x10 at 500 K. PClg(g)PC13(g) + Cl½(g)…

Q: A student ran the following reaction in the laboratory at 651 K: 2NH3(g) N2(g) + 3H2(g) When she…

A: The given reaction is: 2NH3 (g) ⇌ N2 (g) + 3H2 (g)Initial…

Q: A student ran the following reaction in the laboratory at 637 K: 2HI(g) H2(g) + I2(g) When she…

Q: A student ran the following reaction in the laboratory at 251 K: 2NO(g) + Brz(9) = 2NOBR(g) When she…

Q: A student ran the following reaction in the laboratory at 293 K: 2NO(g) + Br2(g) 2NOBr(g) When…

A: Given: Moles of NO = 0.145 mol Moles of Br2 = 0.109 mol Volume of container = 1.0 L Equilibrium…

Q: A student ran the following reaction in the laboratory at 245 K: 2NOBR(g) 2NO(g) + Br2(g) When she…

A: We are required to find the equilibrium constant value for the reaction

Q: The equilibrium constant, Ka, for the following reaction is 1.29x10-2 at 600 K. coCI2(g) co(g) +…

A: The balanced equilibrium reaction given is COCl2 (g) ⇌ CO (g) + Cl2 (g) The equilibrium constant…

Q: A student ran the following reaction in the laboratory at 288 K: 2NO(g) + Br2(g) = 2NOBr(g) When she…

A: Given data, Number of moles of NO = 0.140 mol Number of moles of Br2 = 0.117 mol volume of…

Q: A student ran the following reaction in the laboratory at 1152 K: 2502(g) + 02(g) = 2s03(g) When she…

Q: A 1.00-L flask was filled with 2.14 mol gaseous SO2 and 2.14 mol gaseous NO, and heated. After…

A: Equilibrium constant is defined as products concentration divided by reactant concentration to the…

Q: A student ran the following reaction in the laboratory at 281 K: 2 CH2CI2 (g) = CH4 (g) + CCl4 (g)…

Q: A student ran the following reaction in the laboratory at 709 K: N2(g) + 3H2(g)2NH3(g) When she…

Q: A student ran the following reaction in the laboratory at 1152 K: 2502(g) + 02(g) = 2503(g) When she…

A: We have to calculate the Kc value.

Q: A student ran the following reaction in the laboratory at 70 K: H2(g) + I2(g) 2HI(g) When she…

Q: A student ran the following reaction in the laboratory at 279 K: 2CH;Cl½(g)=CH(2) + CCL(g) When she…

A: The equilibrium constant depends on the concentration of reactants and the concentration of…

Q: A student ran the following reaction in the laboratory at 282 K: 2CH,Cl½(g) CH4(g) + CC14(g) When…

A: Given data,Initial moles of CH2Cl2=6.98×10-2molVolume of container=1.0LEquilibrium concentration of…

Q: A student ran the following reaction in the laboratory at 241 K:2NOBr(g) 2NO(g) + Br2(g) When she…

A: Given: Moles of NOBr = 0.140 mol Volume of container = 1.0 L Equilibrium concentration of NOBr =…

Q: The equilibrium constant, K. for the following reaction is 83.3 at 500 K. PC13(g) + Cl,(g)=PC!5(g)…

A: Equilibrium Constant Ratio of concentration of products to the concentration of reactants where each…

Question

A student ran the following reaction in the laboratory at 643 K:

2HI(g) H₂(g) + I₂(g)

When she introduced 0.367 moles of HI(g) into a 1.00 liter container, she found the equilibrium concentration of HI(g) to be 0.294 M.

Calculate the equilibrium constant, K_c, she obtained for this reaction

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
The decomposition of PCl5(g) to form PCl3(g) and Cl2(g) has Kc = 33.3 at a high temperature. If the initial concentration of PCl5 is 0.1000 M, what are the equilibrium concentrations of the reactants and products?
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
In a solution with carbon tetrachloride as the solvent, the compound VCl4. undergoes dimerization: 2VCl4V2Cl8 When 6.6834 g VCl4. is dissolved in 100.0 g carbon tetrachloride, the freezing point is lowered by 5.97C. Calculate the value of the equilibrium constant for the dimerization of VCl4 at this temperature. (The density of the equilibrium mixture is 1.696 g/cm3, and Kf = 29.8C kg/mol for CCl4.)
Hydrogen and carbon dioxide react at a high temperature to give water and carbon monoxide. H2(g) + CO2(g) H2O(g) + CO(g) (a) Laboratory measurements at 986 C show that there are 0.11 mol each of CO and H2O vapor and 0.087 mol each of H2 and CO2 at equilibrium in a 50.0-L container. Calculate the equilibrium constant for the reaction at 986 C. (b) Suppose 0.010 mol each of H2 and CO2 are placed in a 200.0-L container. When equilibrium is achieved at 986 C, what amounts of CO(g) and H2O(g), in moles, would be present? [Use the value of Kc from part (a).]
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?