a.(CH3)3CCH2CH(CH2CH3)2 b. C. CH3(CH2)3CH(CH2CH2CH3)CH(CH3)2 d.

Q: 1. Crown ethers can be considered examples of? (a) acid catalysts (b) Grignard reagents (c)…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: presence of yellow oily layer A. Nitration presence of brown precipitate from an alkylbenzene B.…

A:

Q: CH2 CH3 CH3 D. CH name reagents A, B, C, D, & E

A: 1st reaction can be accomplished by using C2H5Cl, AlCl3 catalyst (Freidal craft alkylation reaction)…

Q: CI СООН CH3 NO2 A B C D

A: The electrophilic substitution reaction depends on the Group present in the ring .

Q: Which member of each pair is more soluble in water? Why?(a) CH₃CH₂OCH₂CH₃(l) or CH₃CH₂OCH₃(g)(b)…

A: Which member of each pair is more soluble in water it is to be identified and explained. (a)…

Q: VELANCOT 4. LKNEAE 5. WHOLER 6. KAYLL 7. APHRITEG 8. ACOOLHL 9. ALAKEN 10.

A: On rearranging the scramble letters, we obtain a specific word, which does some meaning and…

Q: What is the best set of reagents to use for the synthesis?

A: Wittig reaction: It is very useful reaction in converting carbonyl compounds into alkenes. The…

Q: Draw the organic products formed when 2-bromopentan-3-one (CH3CH2COCHBrCH3) is treated with each…

A: The products formed when 2-bromopentan-3-one is treated with Li2CO3, LiBr, DMF is given as,

Q: 2. A.Electrons in a cyclic conjugated system.| B.The compound is (a, aa, or na)

A: 2. In this compound a benzene ring is attached to a ketone. Now the number of electrons in cyclic…

Q: 1. LIAIH,, ether major product 2 H,0°

A: We have given the organic reaction and we have to find the major product of the reaction.

Q: CH3 CH3 1. (CF3CO0")2Hg, H2O CH3-CH-CH CH2 CH3-CH-CH-CH3 2. NaBH4 OH (CF3CO0"),Hg, = mercuric…

A:

Q: a.) Draw B as a hexagon with wedges and dashed wedges to show the stereochemistry of…

A: The given molecules are represented as follows:

Q: Locate the three isoprene units in santonin and show how the carbon skeleton of farnesol might be…

A:

Q: Fe3+ from Cr3+. Explain the chemistry of the separation.

A: We have already read salt analysis in our lower classes, where we learnt to separate each class of…

Q: CH3CH20CH3 and CH:CH2CH CH3CH2OCH3 and CH3CCH3 CH2CH2CH 요 CH3CCH3 II and IV CH3CH2OH and CH 3CH

A:

Q: 3.) Butanedionic Why completely soluble in water? Why insoluble in HCl? Why completely soluble in…

A: Solubility :-      It is the property of the compound which have tendency to soluble in a…

Q: (a) What is the major alkene formed when A is dehydrated with HS2O4? (b) What is the major alkene…

A: The major product of the reaction has to be given.

Q: Dimethyl ether (CH3OCH3) and ethanol (CH3CH2OH) are isomers, butCH3OCH3 has a pKa of 40 and CH3CH2OH…

A: The structures of two isomers are as follows-  It is given that pKa of dimethyl ether is 40 and…

Q: CH2-CH3 HNO3 A (Para Product Only)- H2/Pt or Cl2 B H2SO4 Fe/HCI FeCl3

A: A chemical reaction is a process that leads to the chemical transformation of reactant to product.…

Q: Which group in each pair is assigned the higher priority in R,S nomenclature? a. -CD3, -CH3…

A: To identify: The group with higher priority among the given pairs.

Q: rignand resgent Hzo MgloH)l+ cHs --cHs -> Neopentan

A: Grignard reagent is utilized to create a carbon-carbon in the structure. The formula of grignard…

Q: Me Me D Me Me

A: Here we are required to find the reagent D which is used to form metal This is done by…

Q: How to convert cyclopentene to tert butoxycyclopentan

A: Given reaction is,

Q: 8. +) Draw the structure of (2S,3S)-2-chloro-3-methylhexane. Use wedges and dashes (where…

A: Answer :

Q: These compounds are unreactive to NaNH2 EXCEPT a. 1-butene. b. 2-butyne. c. 2-butene. d. 1-butyne.

A: Given :-  a. 1-butene b. 2-butyne c. 2-butene d. 1-butyne    To identify :-  A compound that…

Q: Draw the structure of a dihalide that could be used to prepare each alkyne. There may be more than…

A: a. Required alkyl dihalide for the preparation of compound 2-butyne is 2, 2-dibromo-butane or 2,3…

Q: Which combination of reagents would you use to prepare chlorobenzene (C6H5Cl) from benzene (C6H6)?…

A: Benzene reacts with halogen like Cl2 or Br2 in an electrophilic substitution reaction in presence of…

Q: What is the major product of a reaction between I – Cl and 2-methyl propene in CH2Cl2?

A: Reaction name : Electrophilic addition reaction.  Electrophile: I+ (idonium ion)  Intermediate:…

Q: Which is the method of choice for preparing the ether (CH3CH2),COCH3? (a) (CH3CH2), COH + CH3MGBT…

A: Since you have asked multiple questions, we will answer only first question for you. In order to get…

Q: H;C „CH3 ? CH3 starting material final product

A:

Q: What is the reagent? OGMU Me-N OGMI OGMUL OMe OH ? Me-N OMe O

A:

Q: Explain why toluene did or did not react witj permanganate solutions

A: As we know that, KMnO4 is a good oxidizing agent. So it will easily oxidise the CH3 group present on…

Q: hat is the major product? A 3 CH₂ ..... Br ...... CH₂ (A) CH₂ (B) Z CN NaCN ??? ...... CH₂ (C) CH3…

A:

Q: Predict the reagent. CI 1. CH3CH2MGB 2. H30- (CH3CH2)2CuLi

A:

Q: H. H.

A: A carbon connected with four different atom or groups is known as chiral carbon. Chiral carbon is…

Q: H3C-CEC-CH, is called O a) 2-butyne O b) 3-butyne c) butyne O d) 1-butyne e) none of the above

A: Write IUPAC name of the given structure--

Q: Draw the products formed when (CH3)2C=CH2 is treated with each reagent. a.HBr b. H2O, H2SO4 c.…

A: 2-methylpropene or Isobutylene is four carbon branched alkene having many industrial importance. It…

Q: Explain the characteristics of electrophilic addition of HX to alkenes ?

A: GIVEN: The determine the characteristics of electrophilic addition of HX to alkenes Explanation:…

Q: Which of the following reactions willactually yield the indicated product?

A: The given following reaction is actually yield the indicated product can be identified

Q: CH3 CH2 H2C ČH3 С. A в cholesta - 3, 5 - diene В a.

A:

Q: ca/Fech major product CH + CH;CI- ACl3 Alc3

A: " Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: 2. Draw the reactantls) CH3(CH2)24 C-o-CH2 CCH2)48 CH3 t HzO insect wax

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: NaoH cyclopentane deivatve ? Ø is phonyl cyclic kip unsaturated systew Naom

A: The details solution for this is provided below in attach image.

Q: The suitable reactants for the production of methyl-tertiarybutyl ether is: CH3 A. CH3-C-Ơ Na +…

A:

Q: H2C=CHCH=CH2 CH;CCH,CH,CH,CH,CH3 Reagents a. Br2, CH2CI2 b. KCN, HCN LIAIH, then H3O* d. H2, Pd/C…

A:

Q: (a) Octane burns with oxygen gas. (b) 3-ethylpentan-2-ol is combined with an oxidizing agent, H2O2.…

A: a) Octane burns with oxygen gas. The equation for the given reaction is, 2C8H18 + 25O2 ---> 16CO2…

Q: a. Which compound will have the higher boiling point? O Br2 OICI b. Which compound will have the…

A: In these three questions, we will select the higher boiling point compound. We know that, boiling…

Q: What alkylborane is formed from hydroboration of each alkene?

A:

Q: Write the systematic names for each heterocyclic component. NH HN- NH

A: