Aqueous hydrobromic acid (HBr) will react with solid sodium hydroxide (NaOH) to produce aqueous sodium bromide (NaBr) and liquid water Suppose 1.62 g of hydrobromic acid is mixed with 1.0 g of sodium hydroxide. Calculate the maximum mass of sodium bromide that could be produced by the chemical reaction. Round your answer to 3 significant digits. (4,0).

Aqueous hydrobromic acid (HBr) will react with solid sodium hydroxide (NaOH) to produce aqueous sodium bromide (NaBr) and liquid water Suppose 1.62 g of hydrobromic acid is mixed with 1.0 g of sodium hydroxide. Calculate the maximum mass of sodium bromide that could be produced by the chemical reaction. Round your answer to 3 significant digits. (4,0).

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 159CWP: Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced...

See similar textbooks

Similar questions

a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
You have seven closed containers, each with equal masses of chlorine gas (Cl2) . You add 10.0 g of sodium to the first sample, 20.0 g of sodium to the second sample, and so on (adding 70.0 g of sodium to the seventh sample). Sodium and chlorine react to form sodium chloride according to the equation 2Na(s)+Cl22NaCl(s) After each reaction is complete, you collect and measure the amount of sodium chloride formed. A graph of your results is shown below. Answer the following questions: a. Explain the shape of the graph. b. Calculate the mass of NaCl formed when 20.0 g of sodium is used. c. Calculate the mass of Cl2 in each container. d. Calculate the mass of NaCl formed when 50.0 g of sodium is used. e. Identify the leftover reactant, and determine its mass for parts b and d above.
3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.
4.36 Sometimes students in chemistry labs determine percentage yields greater than 100%. Assuming there is no calculation error, how could this happen?
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
Magnesium ribbon reacts with acid to produce hydro- gen gas and magnesium ions. Different masses of magnesium ribbon are added to 10 mL of the acid. The volume of the hydrogen gas obtained is a measure of the number of moles of hydrogen produced by the reaction. Various measurements are given in the table below. (a) Draw a graph of the results by plotting the mass of Mg versus the volume of the hydrogen gas. (b) What is the limiting reactant in experiment 1? (c) What is the limiting reactant in experiment 3? (d) What is the limiting reactant in experiment 6? (e) Which experiment uses stoichiometric amounts of each reactant? (f) What volume of gas would be obtained if 0.300 g of Mg ribbon were used? If 0.010 g were used?
3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
Aqueous hydrobromic acid HBr will react with solid sodium hydroxide NaOH to produce aqueous sodium bromide NaBr and liquid water H2O.Suppose 61. g of hydrobromic acid is mixed with 44.1 g of sodium hydroxide. Calculate the minimum mass of hydrobromic acid that could be left over by the chemical reaction. Be sure your answer has the correct number of significant digits. I keep getting this problem wrong because of the sig. digits, dont round till the end because if it is off by 0.1, it will be incorrect.