Baking soda is a pure substance, sodium bicarbonate. Vinegar is a mixture of acetic acid dissolved in water, and it is only the acetic acid that reacts. Acetic acid and sodium bicarbonate tan react together according to the chemical equation below: HC2H302 NaHCOP NaC2H302 + H20 + Co2 acetic acid + sodium bicarbonate sodium acetate + water + carbon dioxide Samuel wants to help his brother make a science fair volcano. 1. For his first experiment, Samuel obtains samples of solid acetic acid powder and solid sodium bicarbonate powder from his chemistry teacher. He mixes the two powders together, but there is no reaction. b) Considering the ståte of matter of the particles, give a possible explanation for why there is no reaction.

Baking soda is a pure substance, sodium bicarbonate. Vinegar is a mixture of acetic acid dissolved in water, and it is only the acetic acid that reacts. Acetic acid and sodium bicarbonate tan react together according to the chemical equation below: HC2H302 NaHCOP NaC2H302 + H20 + Co2 acetic acid + sodium bicarbonate sodium acetate + water + carbon dioxide Samuel wants to help his brother make a science fair volcano. 1. For his first experiment, Samuel obtains samples of solid acetic acid powder and solid sodium bicarbonate powder from his chemistry teacher. He mixes the two powders together, but there is no reaction. b) Considering the ståte of matter of the particles, give a possible explanation for why there is no reaction.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter5: Stoichiometry

Section: Chapter Questions

Problem 97E

See similar textbooks

Similar questions

Aqueous hydrogen fluoride (hydrofluoric acid) is used to etch glass and to analyze minerals for their silicon content. Hydrogen fluoride will also react with sand (silicon dioxide). (a) Write an equation for the reaction of solid silicon dioxide with hydrofluoric acid to yield gaseous silicon tetrafluoride and liquid water. (b) The mineral fluorite (calcium fluoride) occurs extensively in Illinois. Solid calcium fluoride can also be prepared by the reaction of aqueous solutions of calcium chloride and sodium fluoride, yielding aqueous sodium chloride as the other product. Write complete and net ionic equations for this reaction.
Many over-the-counter antacid tablets are now formulated using calcium carbonate as the active ingredient, which enables such tablets to also be used as dietary calcium supplements. As an antacid for gastric hyperacidity, calcium carbonate reacts by combining with hydrochloric acid found in the stomach, producing a solution of calcium chloride, converting the stomach acid to water, and releasing carbon dioxide gas (which the person suffering from stomach problems may feel as a “burp”). Write the unbalanced chemical equation for this process.
One of relatively few reactions that takes place directly between two solids at room temperature is Ba(OH)2+8H2O(s)+NH4SCN(s)Ba(SCN)2(s)+H2O(l)+NH3(g) In this equation, the 8H2O in Ba(OH)2 8H2O indicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate. a. Balance the equation. b. What mass of ammonium thiocyanate (NH4SCN) must be used if it is to react completely with 6.5 g barium hydroxide octahydrate?
Which of the following statements about chemical reactions is false? l type='a'> When balancing a chemical equation, all subscripts must be conserved. i>When one coefficient is doubled, the rest of the coefficients in (he balanced equation must also be doubled. i>The subscripts in a balanced equation tell us the number of atoms in a molecule. i>The phases in a chemical reaction tell us the nature of the reactants and products.
Explain how an equation can be balanced even if the number of reactant particles differs from the number of product particles.
Although these days many people have “self-cleaning” ovens, if your oven getsreallydirty you may have to resort to one of the spray-on oven cleaner preparations sold in supermarkets. What evidence is there that such oven cleaners work by a chemical reaction?
In a common experiment in the general chemistry laboratory, magnesium metal is heated in air to produce MgO. MgO is a white solid, but in these experiments it often looks gray, due to small amounts of Mg3N2, a compound formed as some of the magnesium reacts with nitrogen. Write a balanced equation for each reaction.