Answered: Balance the following equation by…

Balance the following equation by entering the correct coefficients in each box. If the coefficient is 1, please enter a 1 in the box, don't leave it blank. C2H4 + O2 CO2 + H2O

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter4: Stoichiometry Of Chemical Reactions

Section: Chapter Questions

Problem 3E: Balance the following equations: (a) PCl5(s)+H2O(l)POCl3(l)+HCl(aq) (b) Cu(s)+HNO3(aq)Cu(...

See similar textbooks

Related questions

Q: Which series of numbers represents the coefficients necessary to balance the equation? AIBR3+K2SO4 →…

A: Step : 1 The required answer is follow as :

Q: When the equation below is balanced , H 2 O 2 (aq)+H^ + (aq); +Fe^ 2+ (aq) H 2 O(l); +Fe^ 3+ (aq)

A: H2O2(aq) + H+(aq) + Fe+2(aq) -------> H2O(l) + Fe+3(aq) We have to balance the above equation.

Q: Balance the following equation: C3H8 + N2O3 = CO2 + H2O + NO

A: In this question, we want to balanced the chemical reaction equation, means both side atoms are…

Q: the balanced equation is C7H16 + 11 O2 = 7 CO2 + 8 H2O

A: Given . C7H16 + 11 O2 → 7 CO2 + 8 H2O mass of CO2 =…

Q: What is the stoichiometric coefficient for oxygen when the following equation is balanced using the…

A: To get the coefficients, balanced the chemical equation.

Q: What is the stoichiometric coefficient for oxygen when the following equation is balanced using the…

A: The question is based on the concept of reaction Stoichiometry. We have to balance the equation…

Q: Balance the following equation with the smallest whole number coefficients. What is the coefficient…

A: The balanced equation and coefficient of Oxygen in balanced equation is given below

Q: Balance the equation shown below. What is the coefficient for CS2? C6H14 + S2- CS2 + H2S O 14 0 1 O…

A: The reaction taking place is given as, => C6H14 + S2 -----> CS2 + H2S

Q: Balance the following equation by filling the gaps with appropriate numbers. CSH8 CO2 + H20

Q: When the following molecular equation is balanced using the smallest possible integer coefficients,…

A: The answer is -

Q: Given the unbalanced chemical equation, CH3OH(1) + O2(g) → CO2(g) + H2O(g), what is the mole ratio…

A: GIVEN Unbalanced reaction: CH3OH (l) + O2 (g) ------> CO2 (g) + H2O (g) Since there are 4 H atom…

Q: Balance the following equation: C2H8 (g) + O2 (g) → CO2 (g) + H2O (g)

A: The following equation can be balanced as follows:

Q: _K2Crz07+_H2C204 · 2H20 →_K[Cr(C204)2(H2O)2] · 2H2O +_CO2 +_H20 a) Balance the equation

A: Balance chemical equation is the chemical equation in which number of atoms both side(reactant and…

Q: compounds

A: A chemical reaction is comprised of two sides. The left side is called as reactants side and the…

Q: balance this chemical reaction _____ C2H6O → ______ C2H4O + ______ H

A: Thus the cofficients are 1, 1, 1.

Q: C9H20 (aq) O2(g) ->

Q: Balance the following equation by algebraic method. C3H8 + O2 → CO2 + H2O

Q: Balance the equation C6H12O6 → CO2 + C2H;OH

A: Balanced Equation When the total number of atoms on the reactant side and the product side is equal,…

Q: Balance the following equation by algebraic method. H20 O2 CO2 C2H2 +

Q: Balance the following equation by algebraic method. C3H6 O2 CO2 H20

A: Let us cosider the balanced equation be, a C3H6 + b O2 = c CO2 + d H2O C 3a = c…

Q: ___ Al + ___ O2 → ___ Al2O3 balance the equation

Q: Balance the following equation by algebraic method. C4H10 O2 CO2 H20 + +

Q: Balance the equation by inserting coefficients as needed. ___C2H6O+____O2⟶___CO2+____H2O

A: Balancing the equation by inserting coefficients

Q: Balance the equation: N2(g) + O2(g) → N2O5(g)

A: Simply count the nitrogen and oxygen individually and then proceed further.

Q: Balance out the following chemical reaction: K3PO4 + Mg3(PO4)2 + KCI MgC12 --> O 2:3: 1:6 O 1:1:1:1…

A: Since you have posted multiple independent questions in the same request, we will solve the first…

Q: Balance the Equation _CH4 + _O2 → _CO2 +_ H2O

A: Combustion :- The burning of hydrocarbons in air or excess of oxygen to form carbon dioxide and…

Q: Balance the equation below 2 H2O + ______ CH4 ? 2 H2 + ______ CO2

A: Given equation is, 2 H2O + ______ CH4 -----> 2 H2 + ______ CO2 Let's balance this,

Q: Properly balance the chemical equation using coefficients: _Cr (s) + O2 (g) _Cr2O3 (s) O 1, 2, 3 O…

A: To balance the reaction 1) To determine n factor of each reactant 2) write the n factor below the…

Q: 8H18 + balance the equation O2 →

A: Balance equation represents the number of atoms of each compound involved in a reaction is equal on…

Q: Balance the following equation using the lowest ratio of whole numbers. Do NOT LEAVE any spaces…

A: This is a acid base reaction

Q: Balance this equation, and then enter the coefficients, in order, below. HCl(g)+O2(g)⇌Cl2(g) +…

Q: Balance the following equation by filling the gaps with appropriate numbers. [5] C +....... [2]…

Q: Balance the following chemical equation by providing the correct coefficients. [2](NH4)3PO4 +…

Q: What coefficient must be added in the blank to balance the following equation? N2 + H2 2NH3 O 1 O 2

A: The question deals with the stoichiometry. The number of atoms present in the reactant side must be…

Q: Balance the equation below. ___ C3H6O2 + ___ O2 → ___ CO2 + ___ H2O

A: Given, ___ C3H6O2 + ___ O2 → ___ CO2 + ___ H2O Balance chemical equation = ? Balanced chemical…

Q: 4. The following equation is unbalanced. Create an atom inventory, then balance the equation. (You…

A: Al4C3 + 12 H₂O → 4 CH4 + 3 Al(OH)3 Al = 4 Al = 1 × 4 = 4 C = 3…

Q: When the equation, ____O2 + ____C2H6 --> ____CO2 + ____H2O is balanced, the coefficient of O2 is:…

A: Reaction is balanced when number of atoms in reactant and product side are equal.

Q: Balance the equation.

A: Balanced chemical equation is defined as a chemical reaction in which the number of the different…

Q: What is the balance equation of C8H18 + O2 (arrow) CO2 + H2O?

A: The reaction given is C8H18 + O2 ------------> CO2 + H2O

Q: 30. Al(NO)3 +_K2CO3 _Al, (CO,)3 +_KNO, What is the correct set of coefficients used to balance the…

A: Given reaction is, Al(NO3)3 +K2CO3 -------> Al2(CO3)3 + KNO3

Q: Balance the following equation by algebraic method. C2H4 + O2 →…

A: A balanced chemical reaction is the one where the number of atoms of each element is same on the…

Q: Balance the following Chemical Reactions: CH:CH 0:- CO:+ H.O+ Cl CoT O2=> CO2H H2O+ H2O+ CO2=…

A: Balanced the given above reaction---

Q: 5. K3PO4 + Fe(NO2)2

A: Given: K3PO4+ Fe(NO2)2

Q: Balance the Equation: _C4H10 +_O2 →_ CO2 +_ H2O

Q: A highly explosive fuel that burns in airtight spaces can be made by mixing potassium chlorate and…

A: We have to predict the balanced chemical reaction.

Q: Balance the following equation by algebraic method. C3H8 O2 CO2 H2O

Q: Fill in the blanks to balance the equation, ___ C3H8 + ___ O2 →

A: This is the combustion reaction of propane. Propane is a hydrocarbon during combustion reaction of…

Q: Balance the following equation by algebraic method. CO2 + C2H6 O2 -> + H20

A: Combustion reaction: A combustion is a chemical reaction between a fuel and an oxidant that produces…

Q: Balance the following equation with the smallest whole number coefficients. What is the coefficient…

A: Balanced chemical between is the equation on which number of atoms on left hand side and right hand…

Question

Balance the following equation by entering the correct coefficients in each box. If the coefficient is 1,
please enter a 1 in the box, don't leave it blank.
C2H4 +
O2–
CO2 +
H20

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

The sugar sucrose, which is present in many fruits and vegetables, reacts in the presence of certain yeast enzymes to produce ethanol and carbon dioxide gas. Balance the following equation for this reaction of sucrose. C12H22O11(aq) + H2O(l) C2H5OH(aq) + CO2(g)
Which of the following pairs of compounds have the same empirical formula? a. acetylene, C2H2, and benzene, C6H6 b. ethane, C2H6, and butane, C4H10 c. nitrogen dioxide, NO2, and dinitrogen tetroxide, N2O4 d. diphenyl ether, C12H10O, and phenol, C6H5OH
Chlorine exists mainly as two isotopes, 37Cl and 33Cl. Which is more abundant? How do you know?
Balance the following equations: (a) PCl5(s)+H2O(l)POCl3(l)+HCl(aq) (b) Cu(s)+HNO3(aq)Cu( NO3)2(aq)+H2O(l)+NO(g) (c) H2(g)+I2(s)HI(s) (d) Fe(s)+O2(g)Fe2O3(s) (e) Na(s)+H2O(l)NaOH(aq)+H2(g) (f) ( NH4)2Cr2O7(s)Cr2O3(s)+N2(g)+H2O(g) (g) P4(s)+Cl2(g)PCl3(l) (h) PtCl4(s)Pt(s)+Cl2(g)
You are making cookies and are missing a key ingredient—eggs. You have plenty of the other ingredients, except that you have only 1.33 cups of butter and no eggs. You note that the recipe calls for 2 cups of butter and 3 eggs (plus the other ingredients) to make 6 dozen cookies. You telephone a friend and have him bring you some eggs. How many eggs do you need? If you use all the butter (and get enough eggs), how many cookies can you make? fortunately, your mend hangs up before you tell him how mans eggs you need, then he arrives, he has a surprise for you—to save time he has broken the eggs in a bowl for you. You ask him how many he brought, and he replies, All of them, but I spilled some on the way over. You weigh the eggs and find that they weigh 62.1 g. Assuming that an average egg weighs 34.21 g: How much hunger is needed to react with all the eggs? How many cookies can you make? Which will you have left over, eggs or butter? How much is kit over? Relate this question to the concepts of chemical stoichiometry.
Balance the equation by inserting coefficients as needed. equation: Al4C3+HCl⟶AlCl3+CH4
Balance the following equation, match the coefficients to the correct value. A Al(OH)3 (s) + B CO2 (g) --> C Al2(CO3)3 (s) + D H2O (l)
Balance this equation, and then enter the coefficients, in order, below. HCl(g)+O2(g)⇌Cl2(g) + H2O(g)
Balance the following equation by selecting the coefficients in the dropdown boxes. The coefficient for Al isa. 1b. 2c. 3d. 4The coefficient for HBr is a. 1b. 2c. 3d. 4e. 5f. 6The coefficient for AlBr3 is a. 1b. 2c. 3d. 4The coefficient for H2 is a. 1b. 2c. 3d. 4
Balance the following equation using the lowest ratio of whole numbers. Do NOT LEAVE any spaces blank; if the coefficient is 1, put a 1 in the box: KOH(aq) + H2SO4(aq) → K2SO4(aq) + H2O(l)
Balance/complete the following chemical equations, and identify the type of equation.a. KClO3 = KCl + O2b. Acetylene (C2H2) + oxygen = carbon dioxide + waterc. Fe + Cl2d. Barium chloride mixed with sodium sulfate
Balance the following equation. Reduce the coefficients to the smallest whole number ratio, and enter a 1 if the coefficient is a 1. Al2O3 (s) + H2O (l) → Al(OH)3 (aq)