Balance the following oxidation-reduction reaction as if it were to occur in a basic solution. |(aq) + Clo-(aq) → 13¬(aq) + Cl(aq) HOW DO WE GET THERE? In the reduction half-reaction, there are 2 electrons on the left-hand side, and there are 2 electrons on the right-hand side of the oxidation half-reaction. Therefore, the electrons balance overall. What is the complete reaction? 31"(aq) → 13"(aq) 2 H*(aq) + CIO (aq) → CI"(aq) + H20(1) |(aq) + CIO (aq) → 13 (aq) + CI (aq) 31(ag) + CIOlag) - lelag) + CIlag)

Balance the following oxidation-reduction reaction as if it were to occur in a basic solution. |(aq) + Clo-(aq) → 13¬(aq) + Cl(aq) HOW DO WE GET THERE? In the reduction half-reaction, there are 2 electrons on the left-hand side, and there are 2 electrons on the right-hand side of the oxidation half-reaction. Therefore, the electrons balance overall. What is the complete reaction? 31"(aq) → 13"(aq) 2 H*(aq) + CIO (aq) → CI"(aq) + H20(1) |(aq) + CIO (aq) → 13 (aq) + CI (aq) 31(ag) + CIOlag) - lelag) + CIlag)

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section17.3: Voltaic Cells

Problem 17.3PSP

See similar textbooks

Similar questions

At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
For the following half-reactions, answer these questions. Ce4+(aq)+eCe3+(aq)E=+1.61VAg+(aq)+eAg(s)E=+0.80VHg22+(aq)+2e2Hg(l)E=+0.80VSn2+(aq)+2eSn(s)E=0.14VNi2+(aq)+2eNi(s)E=0.24VAl3+(aq)+3eAl(s)E=1.68V (a) Which is the weakest oxidizing agent? (b) Which is the strongest oxidizing agent? (c) Which is the strongest reducing agent? (d) Which is the weakest reducing agent? (e) Will Sn(s) reduce Ag+(aq) to Ag(s)? (f) Will Hg(l) reduce Sn2+(aq) to Sn(s)? (g) Which ion(s) can be reduced by Sn(s)? (h) Which metal(s) can be oxidized by Ag+(aq)?
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
In principle, a battery could be made from aluminum metal and chlorine gas. (a) Write a balanced equation for the reaction thatwould occur in a battery using Al3+(aq) | Al(s) andCl2(g) | Cl(aq) half-cells. (b) Identify the half-reaction at the anode and at the cathode. Do electrons flow from the Al electrode when thecell does work? Explain. (c) Calculate the standard potential, Ecell, for the battery.
Calculate the potential developed by a voltaic cell using the following reaction if all dissolved species are 0.015 M. 2 Fe2+(aq) + H2O2(aq) + 2 H+(aq) 2 Fe3+(aq) + 2 H2O()
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
A voltaic cell is constructed using the reaction Mg(s) + 2H+(aq) Mg2+(aq) + H2(g) (a) Write equations for the oxidation and reduction half-reactions. (b) Which half-reaction occurs in the anode compartment, and which occurs in the cathode compartment? (c) Complete the following sentences: Electrons in the external circuit flow from the ________ electrode to the ______ electrode. Negative ions move in the salt bridge from the ______ half-cell to the ______ half-cell. The half-reaction at the anode is ____, and that at the cathode is _____.
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?