Based on the galvanic cell formed by following cell reaction (assuming all concentrations are 1.0 M): Ag*(aq) + Fe?*aq) → Fe*aq) + Ag(s) a. What are the ions present in the anode compartment? b. What are the ions present in the cathode compartment? c. Which material can serve as the electrode in the anode? d. Which material can serve as the electrode in the cathode? e. Write the cell diagram.

Based on the galvanic cell formed by following cell reaction (assuming all concentrations are 1.0 M): Ag(aq) + Fe?aq) → Fe*aq) + Ag(s) a. What are the ions present in the anode compartment? b. What are the ions present in the cathode compartment? c. Which material can serve as the electrode in the anode? d. Which material can serve as the electrode in the cathode? e. Write the cell diagram.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 135CWP: Consider a galvanic cell based on the following half-reactions: a. What is the expected cell...

See similar textbooks

Similar questions

Consider the following galvanic cell: Calculate the concentrations of Ag+(aq) and Ni2+(aq) once the cell is dead.
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
You want to set up a series of voltaic cells with specific cell potentials. A Zn2+(aq, 1.0 M)| Zn(s) half-cell is in one compartment. Identify several half-cells that you could use so that the cell potential will be close to (a) 1.1 V and (b) 0.50 V. Consider cells in which the zinc cell can be either the cathode or the anode.
Consider a cell based on the following half-reactions: a. Draw this cell under standard conditions, labeling the anode, the cathode, the direction of electron flow, and the concentrations, as appropriate. b. When enough NaCl(s) is added to the compartment containing gold to make the [Cl] = 0.10 M, the cell potential is observed to be 0.31 V. Assume that Au3+ is reduced and assume that the reaction in the compartment containing gold is Au3+(aq)+4Cl(aq)AuCl4(aq) Calculate the value of K for this reaction at 25C.
For a voltage-sensitive application, you are working on a battery that must have a working voltage of 0.85 V. The half-cells to be used have a standard cell potential of 0.97 V. What must be done to achieve the correct voltage? What information would you need to look up?
A fuel cell designed to react grain alcohol with oxygen has the following net reaction: C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) The maximum work that 1 mole of alcohol can do is 1.32 103 kJ. What is the theoretical maximum voltage this cell can achieve at 25C?