Bromine monochloride is synthesized using the reactionBr, (g) + Cl, (g) = 2 BICI(g)K = 1.1 x 10 at 150 KA 202.0 L flask initially contains 0.969 kg of Br, and 1.193 kg of Cl, Calculate the mass of BrCI, in grams, that is present inthe reaction mixture at equilibrium. Assume ideal gas behavior.mass of BrCI:What is the percent yield of BRCI?percent yield:

Answered: Image /qna-images/answer/fe8539fc-f326-40c0-a400-fc1485625d58.jpg

Bromine monochloride is synthesized using the reaction Br, () + Cl, (g) 2 BrCl(g) Kp - 1.1 x 10 at 150 K A 202.0 L flask initially contains 0.969 kg of Br, and 1.193 kg of CI, Calculate the mass of BICI, in grams, that is present in the reaction mixture at equilibrium. Assume ideal gas behavior. mass of BrCI: What is the percent yield of BrCI? percent yield:

Bromine monochloride is synthesized using the reaction Br, () + Cl, (g) 2 BrCl(g) Kp - 1.1 x 10 at 150 K A 202.0 L flask initially contains 0.969 kg of Br, and 1.193 kg of CI, Calculate the mass of BICI, in grams, that is present in the reaction mixture at equilibrium. Assume ideal gas behavior. mass of BrCI: What is the percent yield of BrCI? percent yield:

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter19: The Chemistry Of The Main-group Elements

Section: Chapter Questions

Problem 60QRT

See similar textbooks

Similar questions

At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
Nitrogen, hydrogen, and ammonia are in equilibrium in a 1000-L reactor at 550 K. The concentration of N2 is 0.00485 M, H2 is 0.022 M, and NH3 is 0.0016 M. The volume of the container is halved, to 500 L. (a) Calculate the equilibrium constant. (b) Define y as the change in the concentration of nitrogen in the 500-L container. Is y positive or negative? (c) Write the iCe table and express the equilibrium constant in a polynomial in terms of y.
The density of trifluoroacetic acid vapor was determined at 118.1 C and 468.5 torr, and found to be 2.784 g/L. Calculate KC for the association of the acid.
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
Describe a nonchemical system that is not in equilibrium, and explain why equilibrium has not been achieved.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
. At high temperatures, elemental nitrogen and oxygen react with each other to form nitrogen monoxide. N2(g)+O2(g)2NO(g)Suppose the system is analyzed at a particular temperature, and the equilibrium concentrations arc found to be [N2]=0.041M. [O2]=0.0078M, and [NO]=4.710M. Calculate the value of K for the reaction.
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
The following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1
A 2.500-mol sample of phosphorus pentachloride, PCl5, decomposes at 160C and 1.00 atm to give 0.338 mol of phosphorus trichloride, PCl3, at equilibrium. PCl5(g)PCl3(g)+Cl2(g) What is the composition of the final reaction mixture?
5.49. Consider the following equilibrium: What is the effect on the equilibrium of each of the following changes? (You may need to calculate some standard enthalpy or Gibbs energy changes to answer these.) (a) The pressure is increased by decreasing the volume. (b) The temperature is decreased. (c) The pressure is increased by the addition of nitrogen gas, .