Answered: By how many volts will the potential of…

By how many volts will the potential of an ideal Mg2 ion-selective electrode change if the electrode is transferred from 1.00 104 M MgCl2 to 1.00 103 M MgCl2?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 50QRT

See similar textbooks

Related questions

Q: Calculate the cell potential for a cell at 41oC with a Cu2+ concentration of 0.011 M and a Zn2+…

A: We have to calculate the cell potential.

Q: Pt | H2 (g, 1.00 bar) | HCI (5.00E-4 M) || KCI(0.100 M) | Hg) | Hg2Cl2¢s) (s)| The anode in the…

A: In an electrochemical cell, the reaction that takes place is a redox reaction. In one of the…

Q: Find the cell potential of a galvanic cell based on the half reactions at 25 C Cd2+ + 2e- = Cd…

Q: What is the initial cell potential? Express your answer to two decimal places and include the…

A: Initial concentration of Ni2+ = 1.80 mol/L Initial concentration of Zn2+ = 0.120 mol/L The…

Q: the I / I- iodine electrode has a standard potential equal to zero. What will be E ° for the Na / Na…

A: In standard conditions, the iodine standard electrode potential is 0.54 V. I2+2e-→2I-, EI-|I2o=0.54…

Q: Propagation of uncertainty. In an extremely accurate measurement of the Faraday constant, a pure…

A: This problem is related to Faraday`s Law of electrolysis, states as "mass of substance deposited or…

Q: Which reference electrode is used to measure the electrode potential of other electrodes?

A: A reference electrode is an electrode which has a stable and well known electrode potential.

Q: write the electrolysis reactions of aqueous solutions of Zn (NO3) 2, Li2SO4, BaCl2, AgBr with…

Q: The standard cell potential for the reaction provided below is-2.431V, calculate the cell potential…

Q: The potential of cell Zn|ZnCl2 (0.555 mol/kg)|AGCI(s)|Ag is 1.015 V at 25°C. The standard potential…

A: The mean activity coefficient of cation and anion can be calculated by using the debye-huckle…

Q: Given the cell: Pb | Pb²+ (0.120 M) || Cd2+ (0.050 M) | Cd Answer the ff: 1. The standard cell…

Q: Consider the cell Pt(s)/ H2(g, 1 bar)/NaOH (aq, 0.01m), NaCl (aq, 0.01125m)/ AgCl(s) / Ag(s) 2H₂O +…

A: Recall the cell representation, Pt s / H2 g, 1 bar / NaOH aq, 0.01 m,…

Q: Calculate the standard potential and the Ecell of Pt ǀ Fe2+ (0.05), Fe3+ (0.01) ǁ MnO-4 (0.02), Mn2+…

A: Here we are required to find the standard cell potential and cell potential for the given…

Q: A standard o.0100 M solution of Na* is required to calibrate an ion-selective electrode method to…

A: The question is based on the concept of solution preparation. we have to prepare a standard solution…

Q: How much time (in hr) must a constant current of 50.0 A be passed through an electrolytic cell…

A: Given : Current = 50.0 A Moles of Cu formed = 5.00 mol And the ions of Cu present in the solution is…

Q: The cell potential for this reaction is, V when [ Zn2*] = 1.0 M and [Pb2*] = 2.0 x 10-4 M. Pb2+ (aq)…

A: The cell potential is calculated by Nernst equation . E = E° - (0.0591/n) log Qc E = cell potential…

Q: Calculate the electrode potentials of the following half-cells.(a) Ag+(0.0436 M)|Ag(b) Fe3+(5.34 ×…

Q: Calculate the emf of a cell made up of iron and lead electrodes in a solution of Fe and Pb of equal…

Q: What is the standard emf of a galvanic cell made of a Pb electrode in a 1.0 M Pb(NO3)2 solution…

Q: Will the electromotive force of the galvanic element Al-Ag change if we add Cl- ions to the Ag…

A: The electric potential produced by either the changing of magnetic field or electrochemical cell is…

Q: What is the electrode potential of an electrode consisting of Zinc metal in a solution in which the…

A: Given, The electrode potential of an electrode consisting of Zinc metal in a solution in which the…

Q: Calculate the cell potential of the lead dipole electrode when its concentration is (0.3) at a…

Q: Calculate the potential of each electrode below: 1. a zinc electrode immersed in 0.0500 M Zn(NO3)2…

A: Since you have asked multiple questions, we will solve, first one for you. For remaining questions,…

Q: What would the potential of a standard hydrogen electrode (S.H.E.) be under the given conditions?…

A: The potential of standard hydrogen electrode ( S.H.E ) can be calculated by using Nernst equation. E…

Q: 3. Use electrode potential data to determine AG° for the reaction 2Als) + 3B12 1) –→ 2AI* (aq. 1M) +…

A: Given- Reaction-2 Al (s) + 3 Br2 (s) → 2 Al3+ (aq) + 6 Br- (aq) To find- ∆G° for the reaction

Q: Calculate the potential of a platinum electrode (! inert) immersed in a solution prepared by…

A: Given- Platinum electrode. Concentration of KBr = 0.0100 M To find- Potential of platinum…

Q: Which would the cell potential be if you changed the concentrations to [Fe3*] = 0.60 [Hg²*) = 1.30 M…

A: The Nernst equation is shown below: Where: Ecell = cell potential E0cell = standard cell potential…

Q: Given the standard potentials EΘ (Cu2+,Cu) = +0.340 V andEΘ (Cu+,Cu) = +0.522 V, calculate EΘ…

A: The relationship between the change in free energy (∆G0) and the electrode potential (E0) in the…

Q: Measure the cell potentials of Cells A-D Cell A: Zn(s) | Zn²*(0.10 M) || Sn²*(0.010 M) | Sn(s) Cell…

A: Calculation of cell potential is done using Nernst equation: E=E∘-0.0591nlogPR

Q: A cell composed of a platinum indicator electrode and a silver-silver chloride reference electrode…

A: The detailed solution of the given question is done below in step 2. Here it is important to note…

Q: Calculate the theoretical cell potential of the following cells. If the cell is short-circuited,…

Q: Calculate the actual cell potential if you have a 1 M solution of MgSO4, but only a 0.5 M solution…

Q: What would the potential of a standard hydrogen electrode (S.H.E.) be under the following…

A: Given, Molar concentration of H+ = [H+] = 0.12 M Pressure of H2 = PH2 = 2.2 atm Temperature = T =…

Q: Calculate the standard potential for the following reaction at 25°C. Cd(s) + 2Ag+(aq) ⇌…

A: The Ecell0 of the cell is given by the sum of oxidation half cell and reduction half cell.

Q: Calculate the value of the EMF of galvanic cells and write the electrode reactions occurring in…

A: a) Zn/Zn2+(0.001)∥Cd2+(0.1)/Cd Anode : Zn = Zn2+ + 2e-…

Q: The following entries are found in a table of standard clectrode potentials: 1,(5) + 2e = 21- 1,(aq)…

A: Since you have asked multiple question we will solve the first question for you. If you want any…

Q: Calculate a difference (mV) of the real (formal) standard redox potential if the ionic strength of…

A: On changing the ionic strength of solution formal potential of the cell changes.

Q: A. What is the cell notation of the set-up? B. What is the standard cell potential (Eºcell)? C. If…

Q: In a standard hydrogen electrode: A) delta G°<0 B) delta G°>0 C) delta G°=0?

A: C) delta G°=0

Q: [1] Activity coefficient can be determined using (i) Electrode concentration cell. (ii) Chemical…

A: Note: Since you have posted multiple independent questions in the same request, we will solve the…

Q: What is the schematic representation of a cell with a saturated calomel electrode as the reference…

A: The Calomel electrode is a- saturated solution of potassium chloride in water is in contact with the…

Q: For Zn|Zn2+(0.25M) || Cu2*(0.25M)|Cu, the cell potential (increases, decreases, is unaffected) when…

Q: An ideal Pb ion-selective electrode is moved from a 5.80 x 10 M Pb(NO,), solution to a 3.45 x 10- M…

Q: A voltaic cell is set up with an aluminum electrode in a 0.025 mol/L AlI(NO3)3 aqueous solution and…

A: A numerical problem based on determination of cell potential.

Q: Given the cell: Zn | Zn²+ (0.100 M) || Co2+ (0.050 M) | Co Answer the ff: 1. The standard cell…

Q: Use the Nernst equation to calculate the actual cell potential of a galvanic cell under the…

A: The reduction half cell reaction is, The oxidation half cell reaction is, Zn2+(aq) + 2e-⇌Zn(s)…

Q: The standard cell potential for the reaction shown here is 0.653 V. Calculate the cell potential at…

A: We have given that Ecell° = 0.653 V And net reaction as follow 2Hg(aq)2+ + 2V(aq)2+ ⇋…

Q: Calculate the potential of a zinc electrode in a 0.0500 M solution of Zn (NO3) 2 ?

Q: List the types of electrodes used for pH measurement. Explain the construction details of one of…

A: The concentration of hydrogen ion (or) the measurement of alkalinity (or) acidity of a solution is…

Question

By how many volts will the potential of an ideal Mg2 ion-selective electrode change if the electrode is transferred from 1.00 104 M MgCl2 to 1.00 103 M MgCl2?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
Calculate the electrode potentials for the following systems: (a) Cr2O72-(5.00 10-3 M),Cr3+(2.50 10-2 M),H+ (0.100 M)|Pt (b) UO22+(0.100 M),U4+ (0.200 M),H+ (0.600 M)|Pt
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Calculate the theoretical potential of each of the following cells. Is the cell reaction spontaneous as written or spontaneous in the opposite direction? (a) Pt|Cr3+(2.00 10-4M),Cr2+(1.50 10-3 M)||Pb2+ (5.60 0215 10-2M)|Pb (b) Hg|Hg22+(2.00 10-2 M)||H+(1.50 10-2 M),V3+ (2.00 10-2M),VO2+(3.00 10-3M)|Pt (e) Pt|Fe3+(3.00 10-2 M), Fe2+ (4.00 10-5M)||Sn2+ (3.50 10-2M), Sn4+ (5.50 10-4 M)|Pt
The following cell was found to have a potential of —0.492 V: Ag|AgCl(sat’d)||HA(0.200 M),NaA(0.300 M)|H2(1.00 atm),Pt Calculate the dissociation constant of HA, neglecting the junction potential.