Please follow the steps in the other picture Cr203 + NazCO3 + KNO3 ----> Na2CrO4 + CO2 + KNO2Step 1:3+ 2-1+ 4- 2-1+ 5+ 2-1+ 6+ 2-1+ 3+ 2-4+ 2-Cr2 O3 + Naz C 03 + KN O3 ---> Na2 Cr 04 + K N O2 +C O2Step 2:The oxidation number of Cr changes from 3+ to 6+. Likewise, that of N changes from 5+ to 3+.Step 3:3+Cr2O3 + NazCO3 + KNO3 ---> NazCrO4 + CO2 + KNO23 e lost5+6+3+2.e gainedStep 4:Cr2O3 + NazCOa+ KNO3 ---> 2 Na2CrO4_ + CO2 + KNO2|3 e lost x 26 eZe gained 1 = 2 eStep 5:Cr2O3 + NazC03 + KNO3 ----> 2 Na2CrO4 ,+ CO2 +6 e x 1 = 6 eKNO2Zex3-6eThe appropriate factors are 1 and 3.1 Cr203 + NazCO3 + 3 KNO3----> (1 x 2) Na2CrO4 + CO2 + 3 KNO2 KMN04 +H2SO4→ K,SO4 + MnSO4 + CasO4 + CO2 + H202.CaC204 +Substance oxidized:Substance reduced:Balanced equation:

Answered: Image /qna-images/answer/8b17fe4a-2e11-4f7b-bdd8-c21fbd7380ed.jpg

Answered: CaC204 + H,SO4 K,So4 + MnSO4 + Caso4 +…

Science

Chemistry

CaC204 + H,SO4 K,So4 + MnSO4 + Caso4 + CO2 + H20 2. KMN04 + Substance oxidized: Substance reduced: Balanced equation:

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 29Q: When jump-starting a car with a dead battery, the ground jumper should be attached to a remote part...

See similar textbooks

Related questions

Q: Balance the following redox reaction using the half-reaction method MnO41- + SO32- = MnO2 + SO42-…

A: Here we required to balance the redox reaction by ion electron method.

Q: Use the information in the ALEKS Data tab to sort the following chemical species by oxidizing power.…

A: Reduction Potential Al3+ + 3 e- → Al -1.66 VZn2+ + 2e- → Zn…

Q: A dimensional analysis setup to determine the mass of Fe that can be fully oxidized by 8.93 grams of…

A: Given Reaction : 4 Fe + 3 O2 → 2 Fe2O3 Conversion given : 8.93 g O2 ×1 mole O231.998 g O2×3 mole…

Q: In acidic conditions, manganate(VII) ions are reduced to manganese(II) ions, Mn. In neutral…

A: The balanced equations for the reduction of manganate(VII), MnO4-(aq) in acidic and neutral medium…

Q: Determine the element which is oxidized, element which is reduced, oxidizing agent, and reducing…

Q: In the oxidation-reduction reaction Snat +2 Fe2+-→2 Fe3+ + Sn2* O a. Sn4+ is oxidized and Fe2+ is…

A: Gain of electrons is known as reduction and loss of electrons is known as oxidation.

Q: Write balanced equations for the following redox reactions: CO + I2O5 -> CO2 + I2 in basic…

Q: How many grams of X (MW = 98.82 g/mol)(in g) will be deposited on a cathode in 2.73 h by a current…

Q: 2. Write the equations of the reactions. Write the electron balance and put the coefficients and…

A: The oxidation half-reaction and reduction half-reaction for the given reaction is shown in equation…

Q: Formaldehyde (CH20) reacts with potassium permanganate (KMN04) under neutral con acid (CH202) and…

A: Oxidation: loss of electrons is called oxidation Oxidation number of atom increases…

Q: What element is oxidized and what is the oxidizing agent in the reaction below? Fe₂O₃(s) + 3CO(g) →…

Q: A sample consisting of a mixture of Na₂SO3 and inert matter weighs 1.468 g and is added to 100.0 ml…

A: A question based on mole concept that is to be accomplished.

Q: A 0.250M solution of Na2C2O4 is to be used in a reaction in which C2O-24 will be oxidized to CO2.…

Q: 12. Which of these methods are utilized to help prevent the rusting of iron? I. Painting iron II.…

A: Rusting is slowly eating down of metallic surface of iron by aerial oxygen and moisture. It is…

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: A fresh metal surface with 1015 atoms per square centimeter is prepared. This surface is exposed to…

A: A gas molecule approaching a surface encounters a net attractive potential due to the closely spaced…

Q: In a laboratory experiment, a student set up an electrochemical cell that contained sodium bromide,…

Q: Zn O ↑ ZnCl2 * OXIDIZING REDUCING

A: It is oxidizing

Q: How many grams of X (MW = 157.49 g/mol)(in g) will be deposited on a cathode in 2.11 h by a current…

A: Faradays First Electrolysis Law provides that the amount of reaction taking place on the basis of…

Q: What metal can be oxidized by a solution of Mn2+ but not Mg2+? zinc silver…

A: From the standard data, EMn2+/Mno = -1.18 V & EMg2+/Mgo = -2.363 V From the given…

Q: Balance the reactions in both acidic and basic mediums please. Balance the following reactions using…

A: "Since you have asked multiple questions, we will solve first question for you (as per our…

Q: 4 NH, +30, – 2 N, +6H,O Identify the clement that gets reduced. Identify the element that gets…

Q: Is Zn+2AgNO3>>>Zn(NO3)2+2Ag an oxidation-reduction reaction? If so, what is oxidized and what is…

Q: In the oxidation-reduction reaction Sna+ + 2 Fez+ →2 Fez+ + Sn2* O a. Fe3+ is reduced and Sn2+ is…

Q: 34. 2K,Cr20, + 2H2O+ 3S → 3502 + 4KOH + 2Cr,03

A: “Hey, since there are multiple questions posted, we will answer first question. If you want any…

Q: Which is more reducing, a solution with 20 mM sufide (HS-; assume S0 as product of sulfide…

A: A reducing agent is the species defined as the substance which oxidizes itself while reduces others.…

Q: What element is oxidized and what is the oxidizing agent in the reaction below: Fe203 (s) + 3 CO (g)…

Q: CIO3- O OXIDIZING REDUCING ↓ CIO2*

Q: I am trying to balance this redox equation: CrBr3 + HNO3----> Cr2O72- + BrO4-1 + NO2 (in acidic…

A: Step 1. Write down the unbalanced equation ('skeleton equation') of the chemical reaction. All…

Q: Which of the following is false for sacrificial anodes? Mercury or indium is added in aluminum…

A: Electrochemistry:

Q: one of the following is oxidizing agent O a. S406-2 O b. S205-2 O c. S203-2 O d. none of them

A: Given: Few species 1). S4O62-. 2). S2O52-. 3). S2O32-.

Q: 48 of 48 In the reaction below, which substance is being oxidized? Fe2O3 + 3CO -> 2Fe + 3CO2 CO…

A: To know which substance is oxidised and which is reduced, one has to calculate the oxidation number…

Q: <p>Which metal can be oxidized with an Sn2+ solution but not with an Fe2+ solution?

A: The order of reactivity of metals can be remembered by MAZINT- magnesium, aluminium, zinc, iron,…

Q: The Haber process is the principal industrial route for converting nitrogen into ammonia: N21g2 + 3…

A: Oxidation is a process where the oxidation number increases and reduction is a process where the…

Q: Determine which substance is oxidized & reduced in the following reaction: Cu,So, (aq) 2Zn (s) -…

A: An oxidizing agent is substance which oxidizes something else. Oxidizing agents give oxygen to…

Q: How many grams of cadmium metal will be plated out in an electrolysis system operated at 3.103 A for…

A: Given, current = 3.103 A Time (t) = 525.5 1 Faraday = 96485.3 coulmb/ mol Molar mass of Cd =…

Q: Which is more reducing, a solution with 20 mM sufide (HS-; assume S0 as product of sulfide…

A: Reducing agents are those species that undergo oxidation, while the oxidizing agent is those species…

Q: Which of the following is being oxidized? Cu + 4HNO3 – Cu(NO3)2 + 2NO2 + 2H2O

A: In oxidation reaction, the oxidation number increases due to loss of electron.

Q: The process of corrosion involves two steps reactions: Oxidation of Fe with O2, and Oxidation of…

A: Given: The process of corrosion involves two steps reactions: Oxidation of Fe with O2, and…

Q: O3- is an oxidizing agent that oxidizes : KI to I2 I2 to I- S2O3- to I

Q: 1. Given the following reaction, identify the species that is oxidized. 5CO + 1205 s 2 + 5CO2 а. СО…

A: 1.

Q: Cr2072- + 6S203²- + 14H* → 2Cr3+ + 3S406²- + 7H20 What is the reducing agent here?

A: Those chemical species that lose their electrons during the reaction to reduce other atoms are known…

Q: n the following chemical reaction which is the oxidising agent? 5H2O2 + 2MnO4- + 6H+ = 2Mn2+ +…

A: Oxidizing agents are the compounds which removes electrons from the other molecules and cause…

Q: Identify Reducing and Oxidizing Agent Fe+O2=Fe2O3

A: Oxidation : Oxidation is defined as the loss of electrons . In oxidation , the oxidation state of an…

Q: Balance the equation and determine the reaction. 1N + e -1

A: The given unbalanced nuclear reaction is: MZA →N714 + e-10 We have to find the unknown MZA, where…

Q: How many grams of X (MW = 91.45 g/mol)(in g) will be deposited on a cathode in 1.15 h by a current…

Q: 10. Balance the following redox reaction using the half-reaction method: MnO41- + SO32- MnO2 + SO42-…

A: The addition of electrons or decreases in the oxidation state is known as a reduction reaction and…

Q: H₂O₂+ KMnO4 + H₂SO4 O₂ + MnSO4 + K₂SO4+H₂O 1. What is element is oxidized? Potassium or Manganese 2.…

A: The reaction given is, => H2O2 + KMnO4 + H2SO4 → MnSO4 + K2SO4 + H2O + O2

Question

Please follow the steps in the other picture

Cr203 + NazCO3 + KNO3 ----> Na2CrO4 + CO2 + KNO2
Step 1:
3+ 2-
1+ 4- 2-
1+ 5+ 2-
1+ 6+ 2-
1+ 3+ 2-
4+ 2-
Cr2 O3 + Naz C 03 + KN O3 ---> Na2 Cr 04 + K N O2 +C O2
Step 2:
The oxidation number of Cr changes from 3+ to 6+. Likewise, that of N changes from 5+ to 3+.
Step 3:
3+
Cr2O3 + NazCO3 + KNO3 ---> NazCrO4 + CO2 + KNO2
3 e lost
5+
6+
3+
2.e gained
Step 4:
Cr2O3 + NazCOa+ KNO3 ---> 2 Na2CrO4_ + CO2 + KNO2
|3 e lost x 26 e
Ze gained 1 = 2 e
Step 5:
Cr2O3 + NazC03 + KNO3 ----> 2 Na2CrO4 ,+ CO2 +
6 e x 1 = 6 e
KNO2
Zex3-6e
The appropriate factors are 1 and 3.
1 Cr203 + NazCO3 + 3 KNO3
----> (1 x 2) Na2CrO4 + CO2 + 3 KNO2

KMN04 +
H2SO4→ K,SO4 + MnSO4 + CasO4 + CO2 + H20
2.
CaC204 +
Substance oxidized:
Substance reduced:
Balanced equation:

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Consi‎der follo‎wing rea‎ction: HgO (s) -> Hg(l) + ½ O2 (g) Delta H = +90.7 kj/mol. Wh‎at qua‎ntity of h‎eat in kj/mol is req‎uired to prod‎uce on‎e m‎ole HgO? Wri‎te your answer wit‎hout units. Gi‎ven the fol‎lowing data 2Cl‎F(g) + O‎2(g) --> Cl2‎O(g) + F2‎O (g) De‎lta H= 167.4 kJ I 2Cl‎F3(g) + 2O‎2(g) --> Cl‎2O(g) + 3F2‎ O (g) Delta H= 341.4 kJ II 2 ‎F2(g) + O‎2(g) ---> 2F2O‎ (g) Delt‎a H= -43.4 kJ III Calc‎ulate the de‎lta H in kJ for below‎ reaction: ClF(g) + F2(g) ---> ClF3(g)
How can I round this number? Example: Cp = qmetal = -365.4 cal = 0.0501 cal/g°C m∆T (109.7g)(-66.5°C) help me with this Cp = qmetal = -77.0 cal = 0.9803921cal/g°C m∆T (109.7g)(-66.5°C)
Aleks data for AgBrO3 is 5.38 x 10^-5
To prepare a standard solution of Mn2+, a 0.250 g sample of Mn is dissolved in 10 mL of concentrated HNO3 (measured with a graduated cylinder). The resulting solution is quantitatively transferred to a 100-mL volumetric flask and diluted to volume with distilled water. A 10-mL aliquot of the solution is pipeted into a 500-mL volumetric flask and diluted to volume.a. Express the concentration of Mn in mg/L, and estimate its uncertainty using a propagation of uncertainty.b. Can you improve the concentration’s uncertainty by using a pipet to measure the HNO3, instead of a graduated cylinder?
How many g of water you need to add into HCl solution (V= 130.0 cm3 mass percentage 22.0 % (w/w), density: 1.40 g/cm3) if you would like to get a solution with 5 % (w/w)? What is the concentrations (g/dm3 and mol/dm3) of the final solution if the density of it is 1.050 g/cm3? Mr(HCl) = 36.46.
When jump-starting a car with a dead battery, the ground jumper should be attached to a remote part of the engine block. Why?
Define and e xplain the differences between the following terms. a. law and theory b. theory and experiment c. qualitative and quantitative d. hypothesis and theory
A lead compound would be most promising if it had: A.KM = 4.7 × 10^5 M. B.K(I) = 1.5 × 10^-8 M. C.K(I)= 4.7 × 10^-5 M. D.K(I)= 4.7 × 10^5 M. E.K(I) = 1.5 × 10^8 M.
Would you help me whit this example (6) Thank you.
4. K2SO4(aq) + Pb(NO3)2 (aq) -----> PbSO4(s) + KNO3(aq)5. Na2S(aq) + Cd(NO3)2(aq) -----> CdS(s) + NaNO3(aq)
Please explain how to find the highest O.N and why is for example number a) Cr +6 and not +7. Thank you!
2N2O5-------> ?(A) 4NO2{g) + O2 (g)(B) 2NO2 + O6(C) N2O6 + O4