Calculate AG for the below chemical reaction if it is conducted at 25 °C and the reactionis started by mixing the components together to end with 35.0 atm of CH4. O.0200 atmCH, and 0.0250 atm H2. AG° for the reaction is +128.93 kJ/mol.3 CH4 (g) → C3Hg (g) + 2 H2 (g)O 101.3 kJ/molO 5.31 x 10 kJ/molO 182.1 kJ/molO 156.6 kJ/molO 74.6 kJ/mol

Answered: Image /qna-images/answer/873b90f3-091b-46d0-b38b-d5c784da8b19.jpg

Calculate AG for the below chemical reaction if it is conducted at 25 °C and the reaction is started by mixing the components together to end with 35.0 atm of CH. 0.0200 atm CH, and 0.0250 atm H. AG° for the reaction is +128.93 kJ/mol. 3 CH, (g)CaHa (g) + 2 H2 (g) O 101.3 kJ/mol O 5.31 x 10 kJ/mol O 182.1 kJ/mol O 156.6 kJ/mol O 74.6 kJ/mol

Calculate AG for the below chemical reaction if it is conducted at 25 °C and the reaction is started by mixing the components together to end with 35.0 atm of CH. 0.0200 atm CH, and 0.0250 atm H. AG° for the reaction is +128.93 kJ/mol. 3 CH, (g)CaHa (g) + 2 H2 (g) O 101.3 kJ/mol O 5.31 x 10 kJ/mol O 182.1 kJ/mol O 156.6 kJ/mol O 74.6 kJ/mol

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter5: Gases

Section: Chapter Questions

Problem 5.110PAE

See similar textbooks

Similar questions

For the reaction TiCl2(s) + Cl2(g) TiCl4(), rG = 272.8 kj/mol-txn. Using this value and other data available in Appendix L, calculate the value of fG for TiCl2(s).
How many L atm are equal to 12.2 kJ of work?
Use the values of Hf in Appendix 4 to calculate H for the following reactions. (See Exercise 77 .) a. b. SiCl4(l)+2H2O(l)SiO2(s)+4HCl(aq) c. MgO(s)+H2O(l)Mg(OH)2(s)
The bombardier beetle uses an explosive discharge as a defensive measure. The chemical reaction involved is the oxidation of hydroquinone by hydrogen peroxide to produce quinone and water: C6H4(OH)2(aq) + H2O2(aq) C6H4O2(aq) + 2H2O(l) Calculate H for this reaction from the following data: C6H4(OH)2(aq) C6H4O2(aq) + H2(g)H = 177.4 kJ H2(g) + O2(g) H2O2(aq)H = 191.2 kJ H2(g) + 12O2(g) H2O(g)H = 241.8 kJ H2O(g) H2O(l)H = 43.8 kJ
How much will the temperature of a cup (180 g) of coffee at 95 C be reduced when a 45 g silver spoon (specific heat 0.24 J/g C) at 25 C is placed in the coffee and the two are allowed to reach the same temperature? Assume that the coffee has the same density and specific heat as water.
A bottle of soda has a head space containing 25.0 mL of CO2 gas at 4.2 atm pressure when the soda is at 4.4C. The bottle is opened slowly, letting the excess pressure escape. Howmuch work does the escaping CO2 do if the ambient pressure is 1.0 atm? Assume that the temperature remains constant.
The combustion of methane can be represented as follows: a. Use the information given above to determine the value of H for the combustion of methane to form CO2(g) and 2H2O(l). b. What is Hf for an element in its standard state? Why is this? Use the figure above to support your answer. c. How does H for the reaction CO2(g) + 2H2O (1) CH4(g) + O2(g) compare to that of the combustion of methane? Why is this?
Given the thermochemical expression CaO(s) + 3C(s) CaC2(s) + CO(g) rH = 464.8 kJ/mol calculate the quantity of energy transferred when (a) 34.8 mol CO(g) is formed by this reaction. (b) A metric ton (1000 kg) of CaC2(s) is manufactured. (c) 0.432 mol carbon reacts with CaO(s).
From the values for G f given in Appendix 1, calculate G at 25C for each of the reactions in Question 19.