Part b)Calculate the standard enthalpy of formation of C2H6 fromits elements using the following data:20 (graphite) + 3H2 (g) → C2H6 (g)C (graphite) + O2 (g)→ CO2 (g)AH;=H, Rol +0, -- H,O ()AH;=2C,H, (g) + 70, (g) → 4CO, (g) + 6H,0 (1)AH3=AH1= -395.9 kJ/molAH2 = -285.8 kJ/mol AH3=-3115.9 kJ/molW

In a chemical reaction, the enthalpy of reaction (ΔHreaction) is the difference in enthalpy between…

Answered: Calculate the standard enthalpy of…

Science

Chemistry

Calculate the standard enthalpy of formation of C2H6 from its elements using the following data:

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter5: Thermochemistry

Section: Chapter Questions

Problem 5.27QE

See similar textbooks

Related questions

Q: 3- Calculate the molar enthalpy change when tungsten is heated by 15 K.

A: From standard sources we get, the molar heat capacity of tungsten is 24.2 J/mol K

Q: From the following data, calculate the standard enthalpy at 391.4 kelvin for the following…

Q: e the standard enthalpy change, 4,H for the reaction.

Q: Question is attached

A: Enthalpy of reaction is equal to the difference in enthalpy of product and reactant. Enthalpy of…

Q: What is the change in enthalpy for the reaction of S S2- ?

A: The reaction given is, => S + 2 e- → S2-

Q: Determine the standard enthalpy of combustion of methane according to the following reaction

A: -217.3 kJmol-1

Q: Use the given standard enthalpies of formation to calculate the AH° (in kJ) for the hypothet

A: Using the formula ∆H∘ = 2 -∆HfX2D + 3 -∆HfM2 + 2 ∆HfX2M + 2 ∆HfDM2 substitute all the given…

Q: Suppose that the reaction of 1.116 moles consumes 30.34 kJ of heat. What is the molar enthalpy of…

A: Enthalpy change is associated with change of one substance undergoing any change is called as…

Q: Suppose that the reaction of 1.326 moles consumes 25.27 kJ of heat. What is the molar enthalpy of…

Q: The standard enthalpies of formation of gaseous propyne (C3H4), propylene (C3H6), and propane…

Q: Calculate the standard reaction enthalpy (AH° ) in kJ of the following reaction using the standard…

A: The question is based on concept of chemical thermodynamics. we have to calculate enthalpy of the…

Q: The standard enthalpy of formation is the enthalpy associated with the reaction that forms one mole…

A: • The given statement is - " The standard enthalpy of formation is the enthalpy associated with the…

Q: Calculate the standard enthalpy of the reaction for the process 3NO(g) --> N2O(g) + NO2(g)

A: Given :- 3NO(g) --> N2O(g) + NO2(g) standard enthalpy of formation of NO = 90 kJ/mol standard…

Q: sa standard enthalpy of formation equal to zer

A: From the given substances, which has the standard enthalpy of formation is equals to zero at 25°C…

Q: Use standard enthalpies of formation to determine ΔHºrxn (kJ) for : 2NO2(g) -> N2O4 (g)

A: The enthalpy of the reaction, ΔH is calculated as,

Q: In the early days of automobiles, illumination at night was provided by burning acetylene, C2H2.…

Q: How much energy (at constant temperature and pressure) must be supplied as heat to 10.0 g of…

A: CL2 →10 gmmole=1071CL2→CI-+CI+1071mole 1071 1071

Q: enthalpy of formation of

Q: Enthalpy of a reaction can be measure by Glass calorimeter

A: Ans. (i) Enthalpy of reaction can be measured by a calorimeter. There are several types of…

Q: es, the standard formation enthalpy of H,S(g) is

Q: Determine the standard enthal py of formation for the following reaction! СНЗСІ + CI2 -CH2CI2 + HCI

A: “Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: he standard enthalpy of the reaction fc CH-CU.

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: is this the standard enthalpy change, enthalpy change, enthalpy of solution, or the standard molar…

A: Given reaction:- CH3OCH3(l) + 3O2(g) ------> 2CO2(g) +3H2O(l) The above reaction is the…

Q: Assume that the formation of the product MgCl2 in the reaction between magnesium ribbon and…

Q: Does the standard enthalpy of formation of H2O(g) differ from ΔH° for the reaction 2H2(g) + O2(g) ⟶…

A: The change in enthalpy of the reaction is equal to the difference between the enthalpies of…

Q: 2. Determine the standard enthalpy change (AH°) for the reaction: C,H +7/2 Ozg 2CO2le) + 3H,O

A: The chemical reactions involve the liberation or absorption of energy. The change in energy is…

Q: Calculate the enthalpy for the reaction of nitrogen dioxide gas with liquid water to make aqueous…

Q: The enthalpy increase of N; when heated between 300 and 1500 does not exceed 100 kl/mol.

A: Here we have to predict whether given statement is true and false. The statement given is " The…

Q: calculate the reaction enthalpy of this reaction under standard conditions:2HNO2(g)+O2(g)→2HNO3(g)

A: The enthaply of the reaction is calculated as follows,

Q: What is the enthalpy of the reaction at 298 K, in kJ, for. 2 H2 (g) + 02 (g) 2 H20 (g)

A: ∆H for reaction is the difference of products of energy to the reactants of energy.

Q: Write the chemical equation for the standard molar enthalpy of formation of ammonium perchlorate,…

A: the equation is provided in the next step:

Q: Calculate the standard enthalpy, AH°, in kJ/mol for the reaction below. C6H1206(s) + 9O2(g) →…

A: To solve this problem we will use the enthalpy of formation of given compound in the reaction. Since…

Q: Calculate the standard enthalpy change for the reaction at 25 ∘C. C3H8(g)+5O2(g)⟶3CO2(g)+4H2O(g)

A: Enthalpy change of reaction: The enthalpy change of a reaction is roughly equivalent to the amount…

Q: Write the thermochemical equatipn of formatipn of carbon dioxide gas from Carbon (garphite) and…

A: A thermochemical equation is defined as a chemical reaction in which the enthalpy of the reaction is…

Q: standard conditions. 25 C,H18(g) + 0,) – 8 CO,() + 9H What is the standard enthalpy of formation of…

A: The given reaction is : C8H18(g) + (25/2)*O2(g) ----> 8CO2(g) + 9H2O(g)…

Q: Define standard enthalpy of formation (AH°;).

A: To define: standard enthalpy of formation.

Q: Standard Enthalpy of Reaction – Hess’s Law Calculate the enthalpy of the following chemical…

Q: Calculate the heat generated by a reaction mixture of 8.4 L of sulfur dioxide at 1.00 atm and 273 K…

A: Thermodynamic is the branch of chemistry that mainly deals with the heat transfer between system and…

Q: 2. Express the reaction enthalpy for the reaction: B + C →5E +z" 1 1 E +5F in terms of the reaction…

Q: Calculate the standard enthalpy of combustion of liquid benzene from the standard enthalpies of…

A: The reaction of combustion of benzene is given as 2C6H6+15O2→12CO2+6H2O The enthalpy of reaction is…

Q: Cu (s) + 2 Ag+ (aq) -> Cu2+ (aq) + 2 Ag (s) Use the standard enthalpies of formation to…

A: The standard change in enthalpy of reaction can be calculted by using the standard enthalpy of…

Q: Write the equation corresponding to the standard enthalpy of formation of liquid carbon…

A: The chemical reaction corresponding to formation of carbon tetrachloride is given as:C (s) + 2 Cl2…

Q: Given that the standard enthalpy of formation of HI(aq) is −55 kJ mol−1, what is the value of…

A: Given that: Standard enthalpy of formation of HI = -55 KJ mol-1 ∆fH° I-,aq= ? The reaction will be,…

Q: How many moles of isooctane must be burned to produce 100 kJ of heat under standard state…

A: Provided release of heat=100kJ In standard condition, one moles of isooctane produce heat 5461kJ.…

Q: ne standard enthalpy of

Q: standard enthalpy change for this reaction.

Q: Using the provided table, determine the enthalpy for the reaction 2 K(s) + 2 H,O(1) → 2 KOH (aq)…

A: The chemical reaction is:2 K (s)+ 2H2O (l) → 2KOH (aq)+H2 (g) ∆HrGiven: ∆Hf° {K (s)} = 0∆Hf°…

Q: Calculate the pressure to be applied to cause the same enthalpy change when temperature of a…

Q: molar enthalpy of formation of H2O(l) from its elements in their standard states (25 oC and 100…

A: The standard molar enthalpy of formation of a compound is the change in enthalpy during the…

Concept explainers

Thermochemistry

Thermochemistry can be considered as a branch of thermodynamics that deals with the connections between warmth, work, and various types of energy, formed because of different synthetic and actual cycles. Thermochemistry describes the energy changes that occur as a result of reactions or chemical changes in a substance.

Exergonic Reaction

The term exergonic is derived from the Greek word in which ‘ergon’ means work and exergonic means ‘work outside’. Exergonic reactions releases work energy. Exergonic reactions are different from exothermic reactions, the one that releases only heat energy during the course of the reaction. So, exothermic reaction is one type of exergonic reaction. Exergonic reaction releases work energy in different forms like heat, light or sound. For example, a glow stick releases light making that an exergonic reaction and not an exothermic reaction since no heat is released. Even endothermic reactions at very high temperature are exergonic.

Question

Part b)
Calculate the standard enthalpy of formation of C2H6 from
its elements using the following data:
20 (graphite) + 3H2 (g) → C2H6 (g)
C (graphite) + O2 (g)→ CO2 (g)
AH;=
H, Rol +0, -- H,O ()
AH;=
2C,H, (g) + 70, (g) → 4CO, (g) + 6H,0 (1)
AH3=
AH1= -395.9 kJ/mol
AH2 = -285.8 kJ/mol AH3=-3115.9 kJ/mol
W

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Concept

VIEW

Step 1

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
sample of natural gas is analyzed and found to be88.4% methane (CH4) and 11.6% ethane (C2H6) bymass. The standard enthalpy of combustion of methaneto gaseous carbon dioxide (CO2) and liquid water (H2O) is -891 kJ/mol. Write the equation for the combustionof gaseous ethane to carbon dioxide and water.Calculate the standard enthalpy of combustion of ethaneusing standard enthalpies of formation from Table R-11on page 975. Using that result and the standard enthalpyof combustion of methane in Table 15.3, calculate theenergy released by the combustion of 1 kg of natural gas.
Benzoic acid, C6H5COOH, is a common standard used in bomb calorimeters, which maintain a constant volume. If 1.20 g of benzoic acid gives off 31, 723 J of energy when burned in the presence of excess oxygen and in a water bath having a temperature of 24.6 C, calculate q, w, H, and U for the reaction.
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
Write reactions for which the enthalpy change will be a. Hf for solid aluminum oxide. b. the standard enthalpy of combustion of liquid ethanol, C2H5OH(l). c. the standard enthalpy of neutralization of sodium hydroxide solution by hydrochloric acid. d. Hf for gaseous vinyl chloride, C2H3Cl(g). e. the enthalpy of combustion of liquid benzene, C6H6(l). f. the enthalpy of solution of solid ammonium bromide.
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
Calculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
You want to determine the value for the enthalpy of formation of CaSO4(s), but the reaction cannot be done directly. Ca(s) + S(s) + 2 O2(g) CaSO4(s) You know, however, that (a) both calcium and sulfur react with oxygen to produce oxides in reactions that can be studied calorimetrically, and (b) the basic oxide CaO reacts with the acidic oxide SO3(g) to produce CaSO4(s) with rH = 402.7 kJ. Outline a method for determining fH for CaSO4(s), and identify the information that must be collected by experiment. Using information in Appendix L, confirm that fH for CaSO4(s) = 1433.5 kJ/mol.
Sodium carbonate, Na2CO3, is used to manufacture glass. It is obtained from sodium hydrogen carbonate, NaHCO3, by heating. 2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) Calculate the standard enthalpy of reaction, using enthalpies of formation (Table 6.2).
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?