Calculate the value of the reaction quotient, Q, for the voltaic cell constructed from the following twohalf-reactions when the Zn 2*ion concentration is 0.0110 M and the Ag + ion concentration is 1.27 M?2+Zn*(aq) + 2e→ Zn(s); E° = -0.76 VAg" (aq) + e - Ag(s); E° = 0.80 VA8.66 × 10-3B6.82 × 10-31151.25 x 10-2(E) 147

Answered: Image /qna-images/answer/7ce6a7f8-c097-477f-83ce-fef8b50e5007.jpg

Answered: Calculate the value of the reaction…

Science

Chemistry

Calculate the value of the reaction quotient, Q, for

Principles of Instrumental Analysis

7th Edition

ISBN:9781305577213

Author:Douglas A. Skoog, F. James Holler, Stanley R. Crouch

Publisher:Douglas A. Skoog, F. James Holler, Stanley R. Crouch

Chapter22: An Introduction To Electroanalytical Chemistry

Section: Chapter Questions

Problem 22.1QAP: Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 ...

See similar textbooks

Related questions

Q: Define the term Heterogeneous Equilibria?

A: A reaction is said to be at equilibrium when the rate of forward reaction is equal to the rate of…

Q: Calculate the percentage change in Kx for the reaction H2CO(g) ⇋ CO(g) + H2(g) when the total…

A: Kx represents the equilibrium constant in terms of the mole fractions of the components whereas Kp…

Q: Why do the equilibrium constants for exothermic reactions decrease with increasing temperature?

A: A state in which the concentrations of both reactants and products does not change with time in…

Q: Consider the equilibrium system: 2ICl(s) ⇌ I2(s) + Cl2(g), the Kc expression for the reaction is?

A: Kc is expressed as the ratio of the product of concentration of products and concentration of…

Q: Industrially, methanol is synthesized using the reaction CO(g) + 2…

A: Consider the given reaction of methanol synthesis is as follows; CO(g) + 2 H2(g) →…

Q: Are the processes that move a system toward equilibrium spontaneous or nonspontaneous?

A: In a reaction a stage where both reactant and product are present, but their change in concentration…

Q: Using the axes G vs composition sketch the variation of the Gibbs energy (G) of a reaction mixture…

A: The graph of ∆G that is change in gibbs free energy versus extent of a reaction is needed to be…

Q: Is K very large or very small for a reaction that goes essentially to completion? Explain.

A: Is K very large or very small for a reaction that goes essentially to completion? Explain.

Q: The reaction H,0(0) + CO,(aq) H,CO,(aq) is at equilibrium. What does this mean?.

A: Given : We have to explain above system of equilibrium using collision theory.

Q: Construct the expression for Kp for the following reaction. 2 O:(g) = 3 O2(g) 1 Drag the tiles into…

A: A reversible chemical reaction can move in either forward or backward direction. The stage of a…

Q: A four-phase equilibrium is not usually possible-Justify the statement.

Q: A reaction has an equilibrium constant of 1.8 x 10⁻² at 298 K and an enthalpy change of +200 kJ/mol.…

A: Given, At temperature T1 = 298 K Equilibrium constant, K1 = 1.8x10-2 ∆Hrxn = 200 kJ/mol…

Q: The equilibrium constant for the reaction 2HCl(g) + O2(g) ⇌ H2O(g) + Cl2(g) is 13300 at 400 K and…

Q: The equilibrium constant for the formation of sulfur trioxide, SO3, from sulfur dioxide, SO2, and…

A: Given: The reaction is as follows, Equilibrium constant for the formation of SO3 = 2.643 x 1012…

Q: Is it possible to calculate the equilibrium constant for a reaction?

A: In chemical reaction, the reactants undergo reaction with each other and get converted into the…

Q: The equilibrium constant, K, for the following reaction is 1.80x10 4 at 298 K. Calculate K, for this…

A: Given ; value of Kc

Q: At a certain temperature, 801 K, Kp for the reaction, 2 SO2(g) + O2(g) ⇌ 2 SO3(g) is 1.13 x 1052.…

Q: ol. What is the ratio of the equilibrium constant at 400 K to that at 200 K?

Q: (CHJ 8. The conventional equilibrium constant expression (K.) for the system as described by the…

Q: E, the value of the equilibrium constant, Kp, is

Q: The equilibrium constant for the reaction N2(g) + 3 H2(g) ⇋ 2 NH3(g) is 2.13 × 106 at 288 K and 1.75…

A: The recation is, N2(g) + 3 H2(g) ⇋ 2 NH3(g) The given parametrs are, T1 = 288 K T2 =…

Q: The equilibrium constant, Kc, for the following reaction is 6.50x10-3 at 298 K. Calculate K, for…

Q: ne standard reaction entropy of

Q: A plot of Gibbs Energy against the extent of reaction has been constructed. Which point in the graph…

A: The plot of Gibbs free energy of reaction versus extent of reaction has minima at equilibrium point…

Q: the equilibrium constant for t

A: Equilibrium constant is defined as a constant which explains the relationship between the…

Q: hát is the équilibrium constant for the following reaction

A: Equilibrium constant is that number which gives the relationship between reactants and products at…

Q: equilibrium constant for the reaction 2HC1(g) + 02(g) = H20(g) + C12(g) is 13300 at 400 K and 429 at…

A: Given reaction is : 2HCl (g) + O2 (g) = H2O(g) + Cl2 (g) Equilibrium constant = k1 = 13300 at…

Q: what is the purpose of the equilibrium quotient (Q)? how is Q calculated?

A: Equilibrium quotient is also known as reaction quotient.

Q: What does each symbol represent? K Gibbs free energy reaction quotient Greek lowercase mu mole…

A: Symbols and their representations are given below

Q: For the reaction 4HCI(g) + 02(g)2H,0(g)+ 2C2(g) AH° = -114.4 kJ and AS° = -128.9 J/K The equilibrium…

Q: What is the definition of the reaction quotient (Q) for a reaction? What does Q measure?

A: Reaction quotient is the ratio of the concentration of product to the reactant of a reaction at any…

Q: e Reaction Quotient, Q, is equal to

A: Given, Molarity of KOH = 4.82×10-4 M Volume of KOH = 12 mL Molarity of AgNO3 = 8.44×10-4 M Volume…

Q: The equilibrium constant, Kc, for the following reaction is 1.20x10-2 at 500 K. Calculate K, for…

Q: Write the expression for the reaction quotient for each of the following reactions:(a) 2SO2(g) +…

A: Reaction quotient gives the relation between the concentration of the reactants and products at…

Q: Calculate the value of the thermodynamic equilibrium constant K.

A: The equilibrium constant can be written as the ratio of concentration of products to the…

Q: A system which is not necessarily at equilibrium has a partial pressure of carbon monoxide of 1.67…

A: Given, Partial pressure of carbon monoxide (CO) = pCO = 1.67 atm Partial pressure of carbon dioxide…

Q: Write the reaction quotient for 2 A + B → 2 C + D.

A: Write the reaction quotient for 2 A + B → 2 C + D.

Q: Write the equilibrium expression for the reaction: 2 HCI (аq) Ca(OH)2 (aq) = - CaCl2 (aq) + 2H2O (1)…

A: Equilibrium expression: The equilibrium expression also called equilibrium constant expression is…

Q: A plot of Gibbs Energy against the extent of reaction has been constructed. Which point in the graph…

Q: Explain why there may be an infinite number of values for the reaction quotient of a reaction at a…

Q: The equilibrium constant for the reaction N2 (g) 3H2 2NH3(g) is 2.13 x 106 at 288 K and 1.75 x 105…

A: Given:Temperature T1 = 288 K.Temperature T2 = 308 K.Equilibrium Constant at T1 (K1) =…

Q: The equilibrium constant for the reaction N2(g) + 3H2(g) ↔ NH3(g) is 2.13×106 at 288 K and 1.75×105…

A: Equilibrium is the state of the reversible reactions. So when the rate of the forward direction…

Q: (a) In the Nernst equation, what is the numerical valueof the reaction quotient, Q, under standard…

A: (a) In the Nernst equation, the numerical valueof the reaction quotient, Q, under standard…

Q: Write the expression for the reaction quotient for each of the following reactions:(a) 3O2(g) ⇌…

A: (a) 3O2(g) ⇌ 2O3(g)(b) N2(g) + 3H2(g) ⇌ 2NH3(g)(c) 4NH3(g) + 7O2(g) ⇌ 4NO2(g) + 6H2 O(g) The…

Q: Write the expression of the reaction quotient for the ionization of HOCN in water.

A: The general expression of reaction quotient is given as Reversible reaction : a A + b B⇔ c C + d…

Q: s the relationship between Q and K

Q: Find the standard enthalpy of a reaction for which the equilibrium constant is (a) doubled, (b)…

A: First we have to find out standard enthalpy of a reaction.

Question

Calculate the value of the reaction quotient, Q, for the voltaic cell constructed from the following two
half-reactions when the Zn 2*ion concentration is 0.0110 M and the Ag + ion concentration is 1.27 M?
2+
Zn*(aq) + 2e→ Zn(s); E° = -0.76 V
Ag" (aq) + e - Ag(s); E° = 0.80 V
A
8.66 × 10-3
B
6.82 × 10-3
115
1.25 x 10-2
(E) 147

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
What is the voltage of a concentration cell of Fe2+ ions where the concentrations are 0.0025 and 0.750 M? What is the spontaneous reaction?
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
The half cells Sn2+(aq) |Sn(s) and Cl2(g) |Cl(aq) are linked to create a voltaic cell. (a) Write equations for the oxidation and reduction half-reactions and for the overall (cell) reaction. (b) Which half-reaction occurs in the anode compartment, and which occurs in the cathode compartment? (c) Complete the following sentences: Electrons in the external circuit flow from the ______ electrode to the ____ electrode. Negative ions move in the salt bridge from the _____ half-cell to the _____ half-cell.
For a certain cell, G=25.0 kJ. Calculate E° if n is (a) 1(b)1(c) 41 Comment on the effect that the number of electrons exchanged has on the voltage of a cell.
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?