Using Hess's Law, determine AHf ° for CH4based on the following reactions. It is knownthat when methane combustion takes place,802.37 kJ / mol of heat is releasedCgrafito + 2H2CH4(g)CH4(9) + 202(9)CO29) + 2H2O)A¢H°= -802.37 kJ/molCgrafito + O2(g)CO2(g)A:H°= -393.5 kJ/mol2H2(9) + O2(9)2H2O(9)A¡H°= -241.83 kJ/mol

Applying Hess's law and with help of data given it is determined that formation∆HCH4.

Answered: Cgrafito + 2H2 CH4(9) CH4(g) + 202(g)…

Cgrafito + 2H2 CH4(9) CH4(g) + 202(g) CO2(9) + 2H2Ou) ACH°= -802.37 kJ/mol Cgrafito + O2(g) CO2(9) AH°= -393.5 kJ/mol 2H2(9) + O2(g) 2H2O(9) A:H°= -241.83 kJ/mol

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter9: Energy And Chemistry

Section: Chapter Questions

Problem 9.53PAE: 9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s)...

See similar textbooks

Related questions

Q: 2.045 g of a new compound with formula C9H8O2 is burned in a bomb calorimeter. During the…

Q: When 33.7 mL of 1.00 M HCl(aq) and 33.1 mL of 1.00 M NaOH(aq), both at 16.7 °C, are added to a…

Q: Carbon disulfide burns in air, producing carbon dioxide and sulfur dioxide. CS2 (1) + 302(g) →…

Q: A piece of unknown metal at 95.0oC with a mass 10.7 g place in a coffee-cup calorimeter with 100.0 g…

A: The principle of calorimetry is - Heat lost by Metal = Heat gained by Water Based…

Q: Using the following data and Hess's law; 2 SO22) + O2g) →2 SO3«g) AH°= -197.8 kJ 2 NOg) + Ozgg) →2…

A: SO2 (g) + NO2 (g) →SO3(g) + NO(g) To get the desired reaction ∆H° value we have to adjust the given…

Q: Given the following combustion data for three different fuels: CH4 (g), C8H18 (l) and CH3OH (l), CH4…

A: The ratio of energy to the molar mass is known as energy density.

Q: 6.48 Diamond and graphite are two crystalline forms of carbon. At 1 atm and 25°C, diamond changes to…

A: According to the given question, The enthalpy of formation of this reaction (ΔH) is calculated by…

Q: Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and…

A: Enthalpy of reaction (∆ Hrxn): The difference in the enthalpies of reactants and products.

Q: . What is ΔHorxn of NH3 (ΔHof = -46 kJ/mol) + O2 = NO2 (ΔHorxn = 34) + H2O (ΔHorxn = -286)

A: Since you have posted multiple unrelated questions as per guidelines we can answer only one per…

Q: Iron can be converted to Fe₂O₃ according to the reaction below. How much heat (in kJ) is required to…

A: The branch of chemistry that deals with the structure, properties and the reaction of the organic…

Q: Given the enthalpies of combustion of propane (C3 H8), carbon and hydrogen, C3H3(g) + 502(g) →…

Q: The heat capacity of a bomb calorimeter was determined by burning 6.79 g methane (energy of…

A: Given: Mass of CH4 combusted = 6.79 g. Heat of combustion of CH4 = -802 KJ/mol. And the change in…

Q: Ammonia burns in the presence of a copper catalyst to form nitrogen gas. 4NH3 (g) + 302(g) → 2N2 (g)…

Q: 5. Liquid hydrazine, N2H4 is a rocket fuel. It combusts in oxygen gas to form nitrogen gas and…

A: The given equations are : 2NH3(g)+3N2O(g)→4N2(g)+3H2O(l) ∆H=-1010 kJ (i)…

Q: Calculate AH for the process: Hg2Cl2 (S) → 2Hg(e) + Cl2(g) rom the following information: Hg(e) +…

Q: 1. Calculate the enthalpy of the following chemical reaction: a) CS₂ + 30₂ → CO₂ + 2S0₂ -> Given:…

A: Dear student , since you have posted multiple questions we will allow to solve only first question…

Q: In an experiment, a 0.7520 g sample of 1,2-benzenediol (C6H6O₂) is burned completely in a bomb…

A: we have to calculate the molar heat of combustion for 1,2-benzenediol

Q: Given the following combustion data for three different fuels: CH4 (g), C8H18 (l) and CH3OH (l),…

A: For fuel CH4 energy per gram is CH4 (g) + 2 O2 (g) → CO2 (g) + 2 H2O (l) ΔH° = −890 kJenergy per…

Q: CH3OH(g) ---> CO(g) + 2H2(g) DH = +90.7 For a given sample of CH3OH(g), the enthalpy change on…

Q: Given the following information: 2NO(g) + O2(g) ---> 2NO2(g) AH = -116 kJ 2N2(g) + 502(g) + 2H2O(t)…

A: The overall chemical equation can be obtained as shown below. 2NO2g→2NOg+O2g…

Q: A 58-g copper calorimeter (sp. ht. = 0.093 cal / g.oC) contains 260 g of water at 20 oC. When 78 g…

Q: High-purity benzoic acid (CH;COOH; AHxn for combustion =-3227 kJ/mol) is used as a standard for…

A: The heat of combustion of benzoic acid is = -3227 kJ/mol The mass of benzoic acid is = 1.221 g The…

Q: A bomb calorimeter, or a constant volume calorimeter, is a device often used to determine the heat…

A: Given: Mass of sample=0.4596 g Mass of water=1.337×103 g Temperature change=21.64 to 23.88°C Heat…

Q: The combustion reaction of 1-pentanol is: C5H11OH(l)+152O2(g)→5CO2(g)+6H2O(l) The heat of…

Q: cooking oil is 1.75 J/(g⋅°C).1.75 J/(g⋅°C). How much heat energy is needed to raise the temperature…

A: Heat of reaction is difference of energy of product and energy of Reactant. If heat of reaction is…

Q: The complete combustion of propane, C3H8(g) + 5 O2(g) --> 3 CO2(g) + 4 H2O(l), has DH = -2220 kJ.…

A: Given combustion reaction of Propane; C3H8(g) + 5 O2(g) --> 3 CO2(g) + 4 H2O(l), has ∆H = -2220…

Q: THERMODYNAMICS: The combustion of 1.00 mol of glucose (C6H1206) liberates 2820 kJ of heat. If 1.17 g…

A: Given: Heat of combustion of glucose = 2820 KJ/mol. Mass of glucose burned = 1.17 g. Initial…

Q: Acetylene burns in air according to the following equation. C2H2(g) + 5/2 02(g) → 2 CO2(g) + H20(g)…

Q: A bomb calorimeter, or a constant volume calorimeter, is a device often used to determine the heat…

A: The heat of a substance is given as :

Q: Use the following data to determine the AH° for the conversion c C(s,diamond) +O,(g) CO,(g) AH°=…

A: We will add all three equation to get final equation.

Q: How much heat in kJ is evolved or absorbed? Burning of 15.5g of propane: C3H8(g) + 2 H2O (l) -->…

Q: The heat of combustion of methanol is -715 kJ/mol. When 0.07 mol of methanol are burned in a bomb…

A: Use formula =Q= nc∆T C= 1174.055kj/kg

Q: What mass of natural gas (CH4) must burn to emit 265 kJ of heat? CH4(g)+2O2(g)→CO2(g)+2H2O(g)…

A: To solve this problem we have to consider the given thermochemical equation . According to this…

Q: When 30.0 g of C8H14 is combusted in a bomb calorimeter, the bomb calorimeter increased in…

Q: Given the following data: Na(g) + O2(g) O2(g) 2N20(g) → 2NO(g), AH = +180.7 kJ AH =-113.1 kJ 2NO(g)…

A: As per Hess’s law, regardless of the steps used in product formation, the change in enthalpy of the…

Q: Octane, C3H18 , is a constituent of gasoline, and burns in the presence of oxygen to produce water…

Q: A 55.00 gram pellet of lead at 25°C is added to 58.5g of boiling water (specific heat of 4.18 Jg1°C)…

Q: In the laboratory a student burns a 0.551-g sample of 2- naphthylacetic acid (C12H1002) in a bomb…

A: In this problem, applying law of calorimetry is the basic concept. Using this all kind of related…

Q: In a bomb calorimeter compartment surrounded by 1.411 kg of water, the combustion of 1.19 g of…

A: Bomb calorimeter: An instrument used to find the change in internal energy by measuring the heat of…

Q: A bomb calorimeter, or a constant volume calorimeter, is a device often used to determine the heat…

Q: 2. Find AH° for the reaction 2H2(e)+ 2C6) + O2=) → C:H;OH0, using the following thermochemical data.…

A: The enthalpy change is a state function and the Hess law states that the change of enthalpy in a…

Q: Which system does more work? O AE=650J & q =770J O AE= -410 J & q = - 100 J O AE=317 J & q = 347 J O…

A: According to the first law of thermodynamics, ∆E = q + w∆E = Change in internal energyq = Heat…

Q: THERMODYNAMICS: The combustion of 1.00 mol of glucose (C6H1206) liberates 2820 kJ of heat. If 1.76 g…

Q: An increasing number of vehicles can run on either gasoline ,C9H20 or C2H5OH. Calculate the amount…

Q: Using the AH -50 kJ/mmol, calculate the enthalpy change if you neutralized six moles of HCl with an…

Q: In an experiment, a 1.1250 g sample of β-D-fructose (C6H12O6) is burned completely in a bomb…

A: Answer: -2709.88 KJ/mol

Q: Find AH for S (s) + O2 (g)-> SO2 (g) (1) 2S (s) + 3 O2 -> 2SO3 (g) AH = -800 kJ (2) 2SO, + O2-> 2SO3…

A: Write reverse of reaction 2 and add both New equation and 1 and divide by 2 Then we get required…

Q: When 50.0 mL of 0.100 M AgNO3 is combined with 50.0 mL of 0.100 M HCl in a coffee-cup calorimeter,…

A: Given, When 50.0 mL of 0.100 M AgNO3 is combined with 50.0 mL of 0.100 M HCl in a coffee-cup…

Q: How much energy is liberated when 600.2g of O2 is reacted with propane in a combustion tank. Assume:…

A: The balanced reaction taking place is given as, => C3H8 (g) + 5 O2 (g) -------> 3 CO2 (g) + 4…

Question

Using Hess's Law, determine AHf ° for CH4
based on the following reactions. It is known
that when methane combustion takes place,
802.37 kJ / mol of heat is released
Cgrafito + 2H2
CH4(g)
CH4(9) + 202(9)
CO29) + 2H2O)
A¢H°= -802.37 kJ/mol
Cgrafito + O2(g)
CO2(g)
A:H°= -393.5 kJ/mol
2H2(9) + O2(9)
2H2O(9)
A¡H°= -241.83 kJ/mol

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A 250-g sample of water at 20.0C is placed in a freezer that is held at a constant temperature of 20.0C. Considering the water as the system, answer the following questions: a What is the sign of qsys for the water after it is placed in the freezer? b After a few hours, what will be the state of the water? c How will the initial enthalpy for the water compare with the final enthalpy of the water after it has spent several hours in the freezer? d What will the temperature of the water be after several hours in the freezer?
A 5.00-g sample of aluminum pellets (specific heat capacity = 0.89 J/C g) and a 10.00-g sample of iron pellets (specific heat capacity = 0.45 J/C g) are heated to 100.0C. The mixture of hot iron and aluminum is then dropped into 97.3 g water at 22.0C. Calculate the final temperature of the metal and water mixture, assuming no heat loss to the surroundings.
Three gas-phase reactions were run in a constant-pressure piston apparatus as shown in the following illustration. For each reaction, give the balanced reaction and predict the sign of w (the work done) for the reaction. . If just the balanced reactions were given, how could you predict the sign of w for a reaction?
Nitric acid, HNO3, can be prepared by the following sequence of reactions: 4NH3(g)+5O2(g)4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) How much heat is evolved when 1 mol of NH3(g) is converted to HNO3(l)? Assume standard states at 25 C.
When 1.0 g of fructose, C6H12O6(s), a sugar commonly found in fruits, is burned in oxygen in a bomb calorimeter, the temperature of the calorimeter increases by 1.58 C. If the heat capacity of the calorimeter and its contents is 9.90 kJ/C, what is q for this combustion?
9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s) from lead metal and oxygen gas. PbO(s)+C(graphite)Pb(s)+CO(g) H = 106.8 kJ 2C(graphite)+O2(g)2CO(g) H= -221.0 kJ If 250 g of lead reacts with oxygen to form lead(II) oxide, what quantity of thermal energy (in kJ) is ahsorhed or evolved?
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
The enthalpy of combustion of solid carbon to form carbon dioxide is 393.7 KJ/mol carbon, and the enthalpy of combustion of carbon monoxide to form carbon dioxide is 283.3 KJ/mol CO. Use these data to calculate H for the reaction 2C(s)+O2(g)2CO(g)
When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
When 50.0 g of 0.200 M NaCl(aq) at 24.1 C is added to 100.0 g of 0.100 M AgNO3(aq) at 24.1 C in a calorimeter, the temperature increases to 25.2 C as AgCl(s) forms. Assuming the specific heat of the solution and products is 4.20 J/g C, calculate the approximate amount of heat in joules produced.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?