CH3 CH=CH2

Q: CH3 CH2- CH2- CH3 C=C CH3-CH2 CH3

A:

Q: OH キ CH3CH,CH, C-H - CH3CH2 CH2C-A OCHCH3 CH3

A: Aldehydes on treatment with one mole of alcohol in the presence of acid produces hemiacetal.

Q: CH3 CH3-CH-CH2-CH2-CH3

A: The name of the given compound is as follows:

Q: Give the COMMON NAME of the following compound H3C-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH3

A: The given compound is an alkane containing ten carbon atoms in the straight chain.

Q: Give the COMMON NAME of the following compound HạC-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH

A: The given compound is an alkane hydrocarbon contain 10 carbons 22 hydrogen atoms connected each…

Q: C2H5CHCHCN

A:

Q: Name the following using correct nomenclature: IUPAC -H CH3CH2CCH3 | CH3

A:

Q: 4. CH,CHCH,CH,CHCH,CH, CH, OH

A:

Q: CH3 .CH3 What is the name of the following?

A:

Q: Give the IUPAC name for following compound.       CH3(CH2)3CH(CH2CH2CH3)CH(CH3)2

A: International Union of Pure and Applied Chemistry gave guidelines to write the chemical name of…

Q: H3C. CH3

A: The molecular formula for the given organic structure is C5H10O2

Q: Give the complete IUPAC name for each of the following compounds:  A. CH3CH2CBr2CH3 B.…

A: There are some basic rules for the naming the organic compounds. They are as follows. Find the…

Q: Write the IUPAC names of the following compounds   1.CH3CH2CH2CH2OH 2. CH3 -O- CH2CH3

A: Rule 1: Consider a longest carbon chain consisting of maximum number of side chain and functional…

Q: "hat is the IUPAC name of the following compoune он CH3CH,CCH2CH3 ČHĄCH3

A: Naming of organic compounds,according to IUPAC. word root = indicates no of carbons in longest chain…

Q: What is the IUPAC names of  1. CH3CH2COOCH2CH3 2. CH3CH2-CO-O-CO-CH2-CH2-CH3

A: The given first compound belongs to the class of esters in various organic compounds and the given…

Q: What is the IUPAC name of the following compound? CH;CHC=CCHCH2CH3 CHI3 ČILCH,CH3

A: For naming the organic compound, the IUPAC nomenclature is a process of naming organic compounds.…

Q: What is the IUPAC (systematic) name of the molecule depicted below? CH2CH3 Br NO2

A:

Q: 1. Please name the following compounds CH3 -CH2CH3 CH3 (1) (3 `CH3

A:

Q: IUPAC name for the compoun CH3 CH3 H-C-CH2-CH-CH2-CH-CH3

A: The IUPAC name the following compound can be written as -

Q: CH3 CH=CH2

A: We have to give IUPAC name of this organic molecule. NB : As per guidelines we  have to solve only…

Q: ect IUPAC name for the compou || H3C-CH-CH2-c-CH3 CH3

A:

Q: Give the COMMON NAME of the following compound CH3 CH3-CH-CH2-CH2-CH3

A:

Q: the IUPAC name of CH2CHO

A: We need to define IUPAC name of given compound.

Q: What is the IUPAC name of the following? 1S CH,CH,CH,COCH,CH3

A: Given compound is an ester compound. For the IUPAC name of ester: First write the name of alkyl…

Q: Write the IUPAC name of the following: CH3— CH2 — CHO

A: IUPAC naming the standard naming for writing the structure of the compound. It follows the standard…

Q: What is the IUPAC name of the following substance? CH3CH2 CH3CH2 CHCH2C=CCH3

A:

Q: Give the IUPAC name for the following molk H,C- CH3 CH3

A: select the longest carbon chain i.e. the principle chain  numbering  naming (prefix + word root +…

Q: Write the correct name for the compound below: (CH:)½CH(CH2)2CH(CH;)2

A: In general, the base part of the name reflects the number of carbons in what you have assigned to be…

Q: Give the IUPAC name of the following: la) CH3 CH3 (b) CO2H (с) Br CHCH2CH2CHCH3 Br H3C CH3

A: Note : As per our company guidelines we are supposed to answer only first 3 sub-parts. Kindly repost…

Q: When naming cycloalkynes that lack any other functional groups, the triple bond does not require a…

A: Firstly identify the longest chain having higher priority functional group. Here the higher priority…

Q: Give the systematic IUPAC name for the following. CH3

A:

Q: CH3 CH3 H-C CH CH3 H3C This compound has how many chiral carbons? 3.

A: Chiral carbon is also called as asymmetric carbon atom. In which all the atom or group attached to…

Q: Provide the appropriate IUPAC name for the following organic molecules CH₂CH₂C=CCHCH₂CH₂ L CH₂ I CH₂…

A:

Q: write the IUPAC names for the attached compounds.

A: The IUPAC names for the given attached compound can be shown below,

Q: What is the class name of the following structures? CH3 CH CH2 CH3 CH2 CH2 HO.

A: Since you have posted multiple questions, we are entitled to answer the first only. Please repost…

Q: Write IUPAC name of the following compound: (CH3CH2)2NCH3

A: The given compound is an example of amine. Generally, there are three kinds of amines. Primary…

Q: What is the correct IUPAC name for (CH3)2CH(CH2)3CH3?

A: We have given that the organic compound we have to find the IUPAC Name of the given compound. 1.…

Q: Give the IUPAC name for (CH3)2C(CH2CH3)CCCH(CH3)2

A:

Q: IUPAC name for CH3-CH2-C=C-CH3

A: IUPAC is the International Union of Pure and Applied Chemistry. Names of the chemical compounds are…

Q: CH3 CH3 H3C CH3 CH3

A: IUPAC nomenclature is:

Q: Write the IUPAC name of CH3CH2CH(OH)CH(NO2)CH(CH3)CHO.

A: Aldehyde functional group is given more priority as compared to the alcohol functional group.

Q: Provide the correct IUPAC name for the compound shown here. CI CH2-CH2 CH2-CH3

A: IUPAC name  In chemical nomenclature, the organic chemistry nomenclature IUPAC is a method of…

Q: The name of the following structure is CH3 CH3 CH-CH CH2 CH-CH-CH–ČH–CH3 CH-CH2

A:

Q: Name the following compounds: CH2 CH3 a) cy CH CH2CHCH2 CH, CHy CH3 b) CH CH3

A: IUPAC nomenclature: (1) Select the longest continuous carbon chain.  (2) Start the numbering from…

Q: H=CH2 -CH2OH -CH2OCH3 -CH2CH3

A: Cahn-Ingold-Prelog nomenclature rules: First look at the atoms that are immediately linked…

Q: Give the IUPAC name for the attached compound.

A: The given compound is in the Newman projection form.

Q: 4. Give the IUPAC name of the following: (a) CH3 (b) CH,CH;CH3 (e) CH3 CH3

A: “Since you have posted a question with multiple sub-parts, we will solve the first three subparts…

Q: what is the IUPAC name of: 1. CH3(CH2)5CHO 2. CH3CH2O(CH2

A: What is the IUPAC name of: 1. CH3(CH2)5CHO 2. CH3CH2O(CH2)5CH3