Page 2. In a combustion reaction, acetylene (C2H2) burns with oxygen. 2CH2+ 502 4CO2+ 2H2O How many grams of CO2 can be produced when 25.0g of O2 reacts? 3. The reaction of Hydrogen with oxygen produces water, 2H2+ O2 2H2O If you have 5.0 moles of O2. how many moles of H2 are needed for the reacti 4. Using the following reaction, how many moles of CO will be produced wh moles of C react? SC+2SO2-CS2-4CO

Page 2. In a combustion reaction, acetylene (C2H2) burns with oxygen. 2CH2+ 502 4CO2+ 2H2O How many grams of CO2 can be produced when 25.0g of O2 reacts? 3. The reaction of Hydrogen with oxygen produces water, 2H2+ O2 2H2O If you have 5.0 moles of O2. how many moles of H2 are needed for the reacti 4. Using the following reaction, how many moles of CO will be produced wh moles of C react? SC+2SO2-CS2-4CO

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter3: Mass Relations In Chemistry; Stoichiometry

Section: Chapter Questions

Problem 53QAP: Cyanogen gas, C2N2, has been found in the gases of outer space. It can react with fluorine to form...

See similar textbooks

Similar questions

DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
The complete combustion of octane, C8H18, a component of gasoline, proceeds as is shown below. 2 C8H18(l) + 25 O2(g) 16 CO2(g) + 18 H2O(l) (a) How many moles of O2 are needed to burn 2.10 mol of C8H18? ____________mol(b) How many grams of O2 are needed to burn 1.25 g of C8H18? _________g(c) Octane has a density of 0.692 g/mL at 20°C. How many grams of O2 are required to burn 4.90 gal. of C8H18? 1 gal = 3.79 L. ______________g
1. DDT, an insecticide harmful to fish, birds and humans, is produced by the followingreaction2C6H5Cl + C2HOCl3 → C14H9Cl5 + H2OChlorobenzene Chloral DDTIn a government lab, 1142 g chlorobenzene is reacted with 485 g of chloral.a) What mass of DDT is formed?b) Which reactant is limiting? Which is in excess?c) What mass of the excess reactant is left over?d) If the actual yield of DDT is 200 g, what is the percent yield?2. An element consists of 1.40% of an isotope with mass 203.973 amu, 24.10% of anisotope with mass 205.9745 amu, 22.10% of an isotope with mass 207.9766 amu.Calculate the average atomic mass and identify the element3. Calculate the concentration of all ions present in each of the following solutions ofstrong electrolytesa) 0.100 mol of Ca(NO3)2 in 100 mL of solutionb) 2.5 mol Na2SO4 in 1.28 M of solutionc) 4.00 g K3PO4 in 150.0 mL of solution4. A balloon is filled to a volume of 6.00 x 102 mL at a temperature of 19.0oC . Theballoon is then cooled at constant pressure to…
The complete combustion of octane, C8H18, a component ofgasoline, proceeds as follows:2 C8H18(l) + 25 O2(g) ----->16 CO2(g) + 18 H2O(g)(a) How many moles of O2 are needed to burn 1.50 mol ofC8H18?(b) How many grams of O2 are needed to burn 10.0 g of C8H18?(c) Octane has a density of 0.692 g>mL at 20 °C. How manygrams of O2 are required to burn 15.0 gal of C8H18 (thecapacity of an average fuel tank)?(d) How many grams of CO2 are produced when 15.0 gal ofC8H18 are combusted?
For the reaction N2 + 3H2 = 2NH3, if you have 2.00 moles N2 and 4.00 of H2: How many moles of NH3 can be formed, and how many moles of excess reactant will remain?
A major component of gasoline is octane C8H18. When octane is burned in air, it chemically reacts with oxygen gas O2 to produce carbon dioxide CO2 and water H2O. What mass of water is produced by the reaction of 6.94g of octane?
4. The depletion of ozone (O3) in the stratosphere has been a matter of great concern among scientists in recent years. It is believed that ozone can react with nitric oxide (NO) that is discharged from high altitude planes. The reaction is O3 + NO à O2 + NO2 If 7.40 g of O3 reacts with 0.670 g of NO, a) Which compound will be the limiting reagent? b) How many grams of NO2 will be produced? g (3 decimal places) c) Calculate the number of moles of the excess reagent remaining at the end of the reaction. mol (4 decimal places)
Photosynthesis is the process by which plants synthesize glucose from carbon dioxide and water. The overall reaction is: 6CO2(g)+6H2O(g)⟶C6H12O6(s)+6O2(g)6CO2(g)+6H2O(g)⟶C6H12O6(s)+6O2(g) How many grams of glucose can be made from 40.65 grams of carbon dioxide?
5. KO2 is used in a closed-system breathing apparatus. It removes carbon dioxide and water from exhaled air. The reaction for the removal of water is: KO2 + H2O O2 + KOH. The KOH produced is used to remove carbon dioxide by the following reaction: KOH + CO2 KHCO3. a. What mass of KO2 produces 235 g of O2?b. What mass of CO2 can be removed by 123 g of KO2?
A major component of gasoline is octane C8H18 . When octane is burned in air, it chemically reacts with oxygen gas O2 to produce carbon dioxide CO2 and water H2O . What mass of octane is consumed by the reaction of 7.6g of oxygen gas?
One way of commercially producing methanol involves the following reaction: CO (g) + 2 H2 (g) ⇌ CH3OH (g) 1. How many grams of CO does it need to react with 4 moles of H2? 2. How many moles of CO is needed to create 1.81 ×1024 molecules of methanol? 3. How many grams of methanol is produced with 28.01 g of CO?
Liquid hexane CH3CH24CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O. If 13.4g of carbon dioxide is produced from the reaction of 13.8g of hexane and 25.3g of oxygen gas, calculate the percent yield of carbon dioxide.