Photosynthesis is the process by which plants synthesize glucose from carbon dioxide and water. The overall reaction is: 6CO2(g)+6H2O(g)⟶C6H12O6(s)+6O2(g)6CO2(g)+6H2O(g)⟶C6H12O6(s)+6O2(g) How many grams of glucose can be made from 40.65 grams of carbon dioxide?

Q: Calculate the number of g of iron that can be made from 16.5 g of Fe2O3?

A:

Q: Upon heating 112 g MgSO4 · 7 H2O: (a) how many grams of water can be obtained? Enter the value of…

A: The mass, number of moles and molar mass are related by the following formula Number of…

Q: Green plants use light from the Sun to drive photosynthesis. Photosynthesis is a chemical reaction…

A: The answer to the following question is given as:

Q: Ammonium phosphate ((NH,) PO, is an important ingredient in many solid fertilizers. It can be made…

A:

Q: Dichloromethane (CH2Cl2)(CH2Cl2), used as a solvent in the decaffeination of coffee beans, is…

A: Given, Mass of Methane=2.51 kg Percent yield=44.5 %

Q: Gaseous butane (CH;(CH,) CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A:

Q: Aqueous sulfuric acid (H₂SO4) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A:

Q: Aqueous sulfuric acid (H,SO reacts with solid sodlum hydroxlde (NaOH) to produce aqueous sodlum…

A: Sulfuric acid reacts with sodium hydroxide to form sodium sulfate and water. The equation for the…

Q: C6H5Cl + 2 NH3 --> C6H5NH2 + NH4Cl Assume that 20.0 g of chlorobenzene at90% purity is mixed with…

A: Amount of pure chlorobenzene present in 100 g of sample = 90 g Amount of pure chlorobenzene present…

Q: One of the steps in the commercial process for converting ammonia to nitric acid is the conversion…

A: The balanced reaction between ammonia and O2is as follows, The given grams of NO and H2O are…

Q: Using the following equation, balance the reaction and answer the question. C3H8 + O2 --> CO2 +…

A: The balanced chemical equation for the burning of C3H8 is as follows:

Q: Aqueous sulfuric acid (H, SO reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A:

Q: Gaseous butane CH3CH22CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2…

A: Mass of butane = 33.1 g Mass of O2 = 228 g

Q: Using the following equation: Fe2O3 + H2 --> Fe + H2O Calculate how many grams of iron (Fe) can be…

A: The amount of substance is usually defined in terms of mole. The mole is the SI unit of the quantity…

Q: Aqueous sulfuric acid (H,SO4 reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: Moles of sulfuric acid and sodium hydroxide can be calculated as

Q: Combustion reactions are a notable source of carbon dioxide in the environment. Using the following…

A: 100 g of Propane is used.  The molar mass of Propane = 44.1 g/mol

Q: Aqueous sulfuric acid (H,So,) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A:

Q: Gaseous butane  CH3CH22CH3  reacts with gaseous oxygen gas  O2  to produce gaseous carbon…

A: The balanced chemical reaction between butane and oxygen is shown below.

Q: Acetic acid (vinegar) is produced industrially by combining methanol with carbon monoxide as…

A: In Balanced chemical equation no.  of atoms of each species are equal on both side of the reactent…

Q: Aqueous sulfuric acid (H,SO,) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A:

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (O₂) to produce gaseous carbon dioxide (CO)…

A:

Q: Gaseous methane (CH4) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2)…

A: The balanced chemical reaction is written below.CH4 (g) + 2O2 (g) → CO2 (g) +  2H2O (g)According to…

Q: Gaseous butane (CH3(CH2),CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

A: Mass of butane = 43.0 g  Mass of oxygen gas = 305 g  Theoretical yield of water = ?

Q: 1. How many grams of oxygen can be formed if 295.0 g KCIO3 react? Show all required calculations and…

A: Balanced chemical equation: 2KClO3 ----->  2KCl + 3O2 For this equation: Number of moles of O2 =…

Q: Tetraphosphorus trisulfide, P4S3, is used in the head of wooden matches.  This material is…

A: Answer :-  8,3,8  The balanced chemical equation for the reaction between red phosphorus P4 and…

Q: 7. Combustion reactions are a notable source of carbon dioxide in the environment. Using the…

A:

Q: ) Write a balanced combustion reaction for C6H10.  B) If 45.0 g of C6H10 react with 156 g of…

A: Mass of C6H10 = 45 g Mass of O2 = 156 g A) balanced chemical reaction  B) Mass of CO2 form  C)…

Q: Solve the following problems, take a picture and upload solution here. Make sure to have the correct…

A: Magnesium hydroxide reacts with hydrochloric acid to form water and magnesium chloride. The equation…

Q: Liquid hexane (CH, (CH,(CH,),CH;) • reacts with gaseous oxygen gas (o, to produce gaseous carbon…

A:

Q: Magnesium oxide can be made by heating magnesium metal in the presence of oxygen.  What will the…

A: The chemical reaction regarding the formation of magnesium oxide is  2Mg(s) +O2(g) ---->>>…

Q: :                         4 NH3 (g) + 7 O2 (g) → 4 NO2 (g) + 6 H2O (g) The combustion of 261 g of…

A: We are given the balanced equation, 4NH3 (g)+7O2(g)→4NO2(g)+6H2O(g) So, from the above-balanced…

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: Mass of HCl = 6.93 gm  Moles of HCl = 6.93/36.5 = 0.190 Mass of NaOH = 10.9 gm  Moles of NaOH =…

Q: Ammonium phosphate ((NH,) PO, Is an important ingredient in many fertilizers. It can be made by…

A: balanced equation    3 moles of ammonia react to produce 1 mole of ammonium phosphate  find the…

Q: Thermite welding is an exothermic reaction, which produces molten iron that permanently binds metals…

A: The reactants which gets completely consumed in a reaction is called limiting reactant .The…

Q: 2). Thionyl chloride, SOC12, is used as a powerful drying agent. The thionyl chloride reacts with…

A:

Q: The reaction of the combustion of 28.9 grams of acetylene produces how many grams of carbon dioxide?

A: The amount of carbon dioxide produced by the combustion of 28.9 g of acetylene is given below

Q: C3H8(g) + 5 O2(g) ⟶ 3 CO2(g) + 4 H2O(g) Using the chemical reaction above, how many moles of carbon…

A: Given reaction is, C3H8(g) + 5 O2(g) ⟶ 3 CO2(g) + 4 H2O(g)

Q: 3. Thermite welding is an exothermic reaction, which produces molten iron that permanently binds…

A: →The Reactant which gets completely consumed in a Reaction  is called limiting Reactant The…

Q: Under certain conditions, the substance bromine trifluoride can be broken down to form bromine and…

A: Dissociation of bromine trifluoride under certain conditions produces bromine and fluorine gas. The…

Q: Aqueous sulfuric acid (H,SO,) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A:

Q: Edible ethanol, for use in the pharmaceutical industry, is still made by the fermentation of sugars.…

A: In the given question, four subparts are there from the topic of fermentation of sucrose and their…

Q: A major component of gasoline is octane (CH18). When octane is burned in air, it chemically reacts…

A:

Q: N2(g)+3H2(g)→2NH3(g) A) If you have 4.00 gg of H2H2, how many grams of NH3NH3 can be produced? B)…

A: N2(g) + 3H2(g) →2NH3(g)  1 mol N2 reacts with 3 mol H2 produces 2 mol NH3  molar mass of N2 = 28.0…

Q: Ammonium phosphate ((NH4), PO4) is an important ingredient in many fertilizers. It can be made by…

A: Given reaction,       Ammonium phosphate from ammonia and phosphoric acid

Q: Gaseous butane (CH,(CH,) CH, reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A:

Q: Under certain conditions, the substances nitrogen and hydrogen combine to form ammonia. If 24.3…

A: First convert mass into mole by diving molar mass respectively Then Calculate limiting reagent by…

Q: Consider the following unbalanced reaction: P4 + O2 → P4O6 If 3.28 g of P4 is reacted with 9.55 g of…

A: Applying concept of limiting reagent and reaction of inorganic chemistry.

Q: The combustion of acetylene gas, C2H2 produces carbon dioxide and water.      a. How many grams of…

A:

Q: Liquid octane  CH3CH26CH3  reacts with gaseous oxygen gas  O2  to produce gaseous carbon dioxide…

A: The balanced reaction between octane and oxygen is written below: -

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".