Consider a voltaic cell at 25°C consisting of a Co(s) electrode immersed in a 1.0 M Co(NO3)2 solution and an Al electrode immersed in a 1.0 M AI(NO3)3 solution, linked by a KCI bridge. Refer to the half-reactions and standard potentials below. Al3+ + 3e Al -1.67 V Co2+2e Co -0.28 V 1. Which is the reduction half reaction and potential? [Select) A A13++ 3e Al -1.67 V +1.67 V B. Al Al3+ + 3e™ C. Co²+ + 2e Co -0.28 V D. Co Co2+ + 2e* +0.28 V II. Which is the oxidation half reaction and potential? Select] A A133e Al -1.67 V B. Al Al 13e +1.67 V C. Co2¹ +2e → Co -0.28 V D. Co Co2 +2e +0.28 V III. Which is the net cell reaction and potential? | Select J A 3A13+ 2Co3AI 2Co2 -1.39 V -1.39 V B. 2A13+ 3Co2A1+ 3Co2¹ C. 2A1+ 3C02¹2A13¹+ 3Co +1.39 V D. 3Al2C023A1³+ + 2Co +1.39 V IV. What is the cell notation? [Select] A. AllA1³(aq)||Co²2¹ (aqlCo(s) B. Co² ColAl(s)A1³+ (aq) C. Cos) CofaqlA1³(aq)|Al(s) D. Al3AClCo²¹ (₂) V

Consider a voltaic cell at 25°C consisting of a Co(s) electrode immersed in a 1.0 M Co(NO3)2 solution and an Al electrode immersed in a 1.0 M AI(NO3)3 solution, linked by a KCI bridge. Refer to the half-reactions and standard potentials below. Al3+ + 3e Al -1.67 V Co2+2e Co -0.28 V 1. Which is the reduction half reaction and potential? [Select) A A13++ 3e Al -1.67 V +1.67 V B. Al Al3+ + 3e™ C. Co²+ + 2e Co -0.28 V D. Co Co2+ + 2e* +0.28 V II. Which is the oxidation half reaction and potential? Select] A A133e Al -1.67 V B. Al Al 13e +1.67 V C. Co2¹ +2e → Co -0.28 V D. Co Co2 +2e +0.28 V III. Which is the net cell reaction and potential? | Select J A 3A13+ 2Co3AI 2Co2 -1.39 V -1.39 V B. 2A13+ 3Co2A1+ 3Co2¹ C. 2A1+ 3C02¹2A13¹+ 3Co +1.39 V D. 3Al2C023A1³+ + 2Co +1.39 V IV. What is the cell notation? [Select] A. AllA1³(aq)||Co²2¹ (aqlCo(s) B. Co² ColAl(s)A1³+ (aq) C. Cos) CofaqlA1³(aq)|Al(s) D. Al3AClCo²¹ (₂) V

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter19: Principles Of Chemical Reactivity: Electron Transfer Reactions

Section: Chapter Questions

Problem 84GQ

See similar textbooks

Similar questions

The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
Consider the voltaic cell 2 Ag+(aq) + Cd(s) 2 Ag(s) + Cd2+(aq) operating at 298 K. (a) Calculate the Ecell for this cell. (b) If (cone. Cd2+) = 2.0 M and (cone. Ag+) = 0.25 M, calculate Ecell. (c) If Ecell = 1.25 V and (cone. Cd2+) = 0.100 M, calculate(cone. Ag+).
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Consider a voltaic cell with the reaction H2(g) + Sn4+(aq) 2 H+(aq) + Sn2+(aq) operating at 298 K. (a) Calculate the Ecell for this cell. (b) Calculate the Ecell for PH2 = 1.0 bar, (cone. Sn2+) = 6.0 104M, (cone. Sn4+) = 5.0 104M, and pH = 3.60.
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
Identify each statement as true or false. Rewrite each false statement to make it true. (a) Oxidation always occurs at the anode of an electrochemical cell. (b) The anode of a discharging voltaic cell is the site ofreduction and is negative. (c) Standard-state conditions for electrochemical cells are aconcentration of 1.0 M for dissolved species and a pressure of 1 bar for gases. (d) The potential of a voltaic cell does not change withtemperature. (e) All product-favored oxidation-reduction reactions have astandard cell potential Ecell, with a negative sign.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.