When 1.045 g of CaO is added to 50.0 mL of water at 25.0 PC in a calorimeter, the temperature of the water increases. to 32.3°C Part A Assuming that the specific heat of the solution is 4.18 J/(g C) and that the calorimeter itself absorbs a negligible amount of heat, calculate 4 in kilojoules for the reaction CaO(s) + H₂O(1)→Ca(OH)₂ (aq) IVE ΑΣΦ ? ΔΗ = Submit Previous Answers Request Answer X Incorrect; Try Again; 5 attempts remaining kJ

When 1.045 g of CaO is added to 50.0 mL of water at 25.0 PC in a calorimeter, the temperature of the water increases. to 32.3°C Part A Assuming that the specific heat of the solution is 4.18 J/(g C) and that the calorimeter itself absorbs a negligible amount of heat, calculate 4 in kilojoules for the reaction CaO(s) + H₂O(1)→Ca(OH)₂ (aq) IVE ΑΣΦ ? ΔΗ = Submit Previous Answers Request Answer X Incorrect; Try Again; 5 attempts remaining kJ

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter9: Energy And Chemistry

Section: Chapter Questions

Problem 9.50PAE: 9.50 When a 13.0-g sample of NaOH(s) dissolves in 400.0 mL of water in a coffee cup calorimeter, the...

See similar textbooks

Similar questions

When 1.0 g of fructose, C6H12O6(s), a sugar commonly found in fruits, is burned in oxygen in a bomb calorimeter, the temperature of the calorimeter increases by 1.58 C. If the heat capacity of the calorimeter and its contents is 9.90 kJ/C, what is q for this combustion?
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
Nitric acid, HNO3, can be prepared by the following sequence of reactions: 4NH3(g)+5O2(g)4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) How much heat is evolved when 1 mol of NH3(g) is converted to HNO3(l)? Assume standard states at 25 C.
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
A 250-g sample of water at 20.0C is placed in a freezer that is held at a constant temperature of 20.0C. Considering the water as the system, answer the following questions: a What is the sign of qsys for the water after it is placed in the freezer? b After a few hours, what will be the state of the water? c How will the initial enthalpy for the water compare with the final enthalpy of the water after it has spent several hours in the freezer? d What will the temperature of the water be after several hours in the freezer?
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
A student performing a calorimetry experiment combined 100.0 ml. of 0.50 M HCI and 100.0 ml. of 0.50 M NaOH in a StyrofoamTM cup calorimeter. Both solutions were initially at 20.0 C, but when the two were mixed, the temperature rose to 23.2 C (a) Suppose the experiment is repeated in the same calorimeter but this time using 200 mL of 0.50 M HCl and 200.0 ml of 0.50 M NaOH. WIII the AT observed be greater than, less than, or equal to that in the first experiment, and why? (b) Suppose that the experiment is repeated once again in the same calorimeter, this time using 100 mL of 1.00 M HCI and 100.0 ml. of 1.00 M NaOH. Will the T observed be greater than, less than, or equal to that in the first experiment, and why?
Given 2Cr2O3(s)4Cr(s)+3O2(g)H=+2269.4kJ (a) What is the heat of formation of chromium(III) oxide? (b) What is H for the formation of 13.65 g of chromium (III) oxide?
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
Consider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.