Consider the following aqueous equilibrium. CH3CH2NH2(aq) + H20(1) = CH3CH2NH3*(aq) + OH (aq) What is the role of H20 in this equilibrium? A. H20 is acting as the conjugate base to CH3CH2NH2 B. H20 is acting as the base C. H20 is acting as the acid D H20 is acting as the conjugate base to CH3CH2NH3* E. H20 is acting as the conjugate acid to CH3CH2NH2

Consider the following aqueous equilibrium. CH3CH2NH2(aq) + H20(1) = CH3CH2NH3(aq) + OH (aq) What is the role of H20 in this equilibrium? A. H20 is acting as the conjugate base to CH3CH2NH2 B. H20 is acting as the base C. H20 is acting as the acid D H20 is acting as the conjugate base to CH3CH2NH3 E. H20 is acting as the conjugate acid to CH3CH2NH2

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter14: Acids And Bases

Section: Chapter Questions

Problem 38QRT

See similar textbooks

Similar questions

In the following reaction, HClO4 + H2SO4 ↔ ClO4- + H3SO4+ HClO4 is the acid and H3SO4+ is its conjugate base. HClO4 is the acid and ClO4- is its conjugate base. H2SO4 is the acid and H3SO4+ is its conjugate base. H2SO4 is the acid and ClO4- is its conjugate base.
Methyllithium (CH3Li) is often used as a base in organic reactions. What is the conjugate acid of CH3Li? Would you expect CH3Li to be a strong base or a weak base?
Identify the correct base/conjugate acid pair in this equation: NH4+ + H2O -> NH3 + H3O+ A. H2O is a base and NH3 is its conjugate acid. B. H2O is a base and H3O+ is its conjugate acid. C. NH4+ is an acid and H3O+ is its conjugate base. D. NH4+ is an acid and H2O is its conjugate base. E. NH4+ is a base and H2O is its conjugate acid.
One component of sour milk is lactic acid (HC₃H₅O₃). What is the pOH of 0.30M lactic acid? (Ka = 1.4x10⁻⁴) 12.93 2.19 0.52 11.81 13.48
Which of the following statements about the reaction H2(g)+O2(g)→H2O(l)H2(g)+O2(g)→H2O(l) is true? (i) This is an example of an acid–base reaction. (ii) O2O2 is oxidized in this reaction. (iii) H2H2 is reduced in this reaction. Which of the following statements about the reaction is true? (i) This is an example of an acid–base reaction. (ii) is oxidized in this reaction. (iii) is reduced in this reaction. iii only i only ii and iii ii only None of them are true.
What is the conjugate acid of HCO3⁻ ? What is the conjugate base of H2PO4⁻ ?
1. The ΔHac of nitrogen dioxide is -937.86 kJ/mole. The ΔHf of nitrogen dioxide is +33.2 kJ/mole. Propose a reasonable explanation for this difference.
From the following information, determine ΔH°f of malonic acid, CH2(COOH)2(s).CH2(COOH)2(s) + 2O2(g) → 3CO2(g) + 2H2O(l); ΔH° = –861.0 kJSubstance ΔH°f (kJ/mol)CO2(g) –393.5H2O(l) –285.8a. 2613 kJb. 891.1 kJc. −1540.3 kJd. −2613.1 kJe. −891.1 kJ
How does the acidity of hand soap at pH 10 compare to distilled water at pH 7? A. Hand soap is 3x less acidic than distilled water. B. Hand soap is 1000x less acidic than distilled water. C. Hand soap is 1000x more acidic than distilled water. D. Hand soap is 3x more acidic than distilled water.
Consider the molecules R-CH2OH and R-CH2CO2H where R is rest of the hydrocarbon molecule. a) Which has the stronger conjugate base? b) Explain why it is the stronger base. What about the structure helps us to understand why one is stronger than the other? You may use drawings to help explain your answer.
Which of the following acids would be able to neutralize the most base? 100 mL of 0.5 M H2SO4 300 mL of 1.0 M HNO3 200 mL of 0.5 M H2SO4 350 mL of 0.5 M HNO3
1)What volume of a 0.196 M KOH solution is required to neutralize 24.7 mL of a 0.319M HNO3 solution? HNO3+KOH->KNO3 +H2O _____mL KOH 2)what volume of a 0.349 M HNO3 solution is required to neutralize 10.1 mL of a 0.190 M KOH solution? HNO3+KOH->KNO3+H2O ____mL HNO3