Consider the following half-reactions: Half-reaction Cl₂(g) + 2e Cu2+ (aq) + 2e™ Cr3+ (aq) + 3e E° (V) 2Cl(aq) 1.360V mmmm (1) The weakest oxidizing agent is: Cu(s) 0.337V Cr(s) -0.740V (2) The strongest reducing agent is: (3) The strongest oxidizing agent is: (4) The weakest reducing agent is: (5) Will Cl(aq) reduce Cr3+ (aq) to Cr(s)? (6) Which species can be oxidized by Cu²+ (aq)? If none, leave box blank. enter formula

Consider the following half-reactions: Half-reaction Cl₂(g) + 2e Cu2+ (aq) + 2e™ Cr3+ (aq) + 3e E° (V) 2Cl(aq) 1.360V mmmm (1) The weakest oxidizing agent is: Cu(s) 0.337V Cr(s) -0.740V (2) The strongest reducing agent is: (3) The strongest oxidizing agent is: (4) The weakest reducing agent is: (5) Will Cl(aq) reduce Cr3+ (aq) to Cr(s)? (6) Which species can be oxidized by Cu²+ (aq)? If none, leave box blank. enter formula

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 39QAP: Use the following half-equations to write three spontaneous reactions. Justify your answers by...

See similar textbooks

Similar questions

A solution containing a metal ion (M2+(aq)) is electrolyzed by a current of 7.8 A. After 15.5 minutes, 2.39 g of the metal is plated out. (a) How many coulombs are supplied by the battery? (b) What is the metal? (Assume 100% efficiency.)
In biological systems, acetate ion is converted to ethyl alcohol in a two-step process: CH3COO(aq)+3H+(aq)+2eCH3CHO(aq)+H2OE=0.581V CH3CHO(aq)+2H+(aq)+2eC2H5OH(aq)E=0.197V (E°' is the standard reduction voltage at 25°C and pH of 7.00.) (a) Calculate G°' for each step and for the overall conversion. (b) Calculate E°' for the overall conversion.
Use the following half-equations to write three spontaneous reactions. Justify your answers by calculating E° for the cells. 1. MnO4(aq)+8H+(aq)+5eMn2+(aq)+4H2OE=+1.512V 2. O2(g)+4H+(aq)+4e2H2OE=+1.229V 3. Co2+(aq)+2eCo(s)E=0.282V
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Zn|Zn2+(0.50M)Cd2+(0.020M)|Cd (b) Cu|Cu2+(0.0010M)H+(0.010M)|H2(1.00atm)|Pt
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Cu|Cu+(0.80M)Hg22+(0.10M)|Hg|Pt (b) Cr|Cr3+(0.615M)Ni2+(0.228M)|Ni
Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.
A galvanic cell is prepared according to the redox reaction shown below. A voltmeter connected to this galvanic cell under standard conditions reads 0.25 V, and ΔGrxn∘ = −44 kJ/mol. If the concentration of Ni2+ is increased to 2.0 M, then Ecell will ______ and Δ????ΔGrxn will be _________ than ΔGrxn∘. Ni(s) + 2H+(aq) ⟶⟶ Ni2+ + H2(g) A) decrease, less negative B) decrease, more negative C) increase, less negative D) increase, more negative
A galvanic cell is prepared according to the redox reaction shown below. A voltmeter connected to this galvanic cell under standard conditions reads 0.76 V, and Δ?∘???ΔGrxn∘ = −134 kJ/mol. If the concentration of Zn2+ is increased to 2.0 M, then ?????Ecell will ______ and Δ????ΔGrxn will be _________ than Δ?∘???ΔGrxn∘. Zn(s) + 2H+(aq) ⟶⟶ Zn2+ + H2(g) Group of answer choices decrease, less negative increase, more negative increase, less negative decrease, more negative
A 15.46 g meat sample is taken, chopped, passed through a blender and the resulting suspension is filtered; obtaining a clean solution containing NO2-. Subsequently, it is treated with 25.00 mL of KMnO4 0.01548 M in acid medium. After 10 min, the remaining KMnO4 is titrated with 14.97 mL of FeSO4 0.08183 M. a) Indicate the redox reactions that take place and adjust them (Note: NO2- oxidizes to NO3- in an acid medium) b) Calculate the NO2- content in mg / kg (MW nitrite, 46.00) Answer: 1056 mg / kg