Consider the following reaction: 2CH4 (g) = C2 H2 (g) + 3H2 (g) The reaction of CH4 is carried out at some temperature with an initial concentration of [CH4] = 0.082 M. At equilibrium, the concentration of H2 is 0.016 M. Find the equilibrium constant at this temperature. Express your answer using two significant figures. ΑΣφ K = Submit Request Answer

Consider the following reaction: 2CH4 (g) = C2 H2 (g) + 3H2 (g) The reaction of CH4 is carried out at some temperature with an initial concentration of [CH4] = 0.082 M. At equilibrium, the concentration of H2 is 0.016 M. Find the equilibrium constant at this temperature. Express your answer using two significant figures. ΑΣφ K = Submit Request Answer

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter12: Gaseous Chemical Equilibrium

Section: Chapter Questions

Problem 20QAP: Consider the following hypothetical reactions and their equilibrium constants at 75C,...

See similar textbooks

Similar questions

The following equilibrium is established in a closed container: C(s)+O2(g)CO2(g)H=393kJmol1 How does the equilibrium shift in response to each of the following stresses? (a) The quantity of solid carbon is increased. (b) A small quantity of water is added, and CO2 dissolves in it. (c) The system is cooled. (d) The volume of the container is increased.
Kc = 5.6 1012 at 500 K for the dissociation of iodine molecules to iodine atoms. I2(g) 2 I(g) A mixture has [I2] = 0.020 mol/Land [I] = 2.0 108 mol/L. Is the reaction at equilibrium (at 500 K)? If not, which way must the reaction proceed to reach equilibrium?
The reaction, 3 H2(g) + N2(g) (g), has the fol lowing equilibrium constants at the temperatures given: atT=25°C,K= 2.8 X 104 at T = 500°C, A = 2.4 X IO"7 At which temperature are reactants favored? At which temperature are products favored? YVhat can you say about the reaction if the equilibrium constant is 1.2 at 127°C?
Hydrogenation, the addition of hydrogen to an organic compound, is an industrially important reaction. Calculate rH, rS, and rG for the hydrogenation of octene, C8H16, to give octane, C8H19 at 25 C. Is the reaction product- or reactant-favored at equilibrium? C8H16(g) + H2(g) C8H18(g) Along with data in Appendix L, the following information is needed for this calculation.
Consider the following reaction at 250C: A(s)+2B(g)C(s)+2D(g) (a) Write an equilibrium constant expression for the reaction. Call the equilibrium constant K1. (b) Write an equilibrium constant expression for the formation of one mole of B(g) and call the equilibrium constant K2. (c) Relate K1 and K2.
What is the approximate value of the equilibrium constant KP for the change C2H5OC2H5(l)C2H5OC2H5(g) at 25 C. {Vapor pressure was described in the previous Chapter on liquids and solids; refer back to this chapter to find the relevant information needed to solve this problem.)
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
Consider the equation G = G + RT ln(Q). What is the value of G for a reaction at equilibrium? What does Q equal at equilibrium? At equilibrium, the previous equation reduces to G = RT ln(K). When G 0, what does it indicate about K? When G 0, what does it indicate about K? When t G = 0, what does it indicate about K? G predicts spontaneity for a reaction, whereas G predicts the equilibrium position. Explain what this statement means. Under what conditions can you use G to determine the spontaneity of a reaction?
The equilibrium constant for the butane iso-butane equilibrium at 25 C is 2.50. Calculate rG at this temperature in units of kJ/mol.
The equilibrium constant Kc for the synthesis of methanol, CH3OH. CO(g)+2H2(g)CH3OH(g) is 4.3 at 250C and 1.8 at 275C. Is this reaction endothermic or exothermic?
The following two diagrams represent the composition of an equilibrium mixture for the reaction A2 + B2 2AB at two different temperatures. Based on the diagrams, is the chemical reaction endothermic or exothermic? Explain your answer using Le Chteliers principle. (A atoms are red and B atoms are green in the diagrams.)
Write the mathematical expression for the reaction quotient, QC, for each of the following reactions: (a) CH4(g)+CI2CH3CI(g)+HCI(g) (b) N2(g)+O2(g)2NO(g) (c) 2SO2(g)+O2(g)2SO3(g) (d) BaSO3(s)BaO(s)+SO2(g) (e) P4(g)+5O2(g)P4O10(s) (f) Br2(g)2Br(g) (g) CH4(g)+2O2(g)CO2(g)+2H2O(l) (h) CuSO45H2O(s)CuSO4(s)+5H2O(g)