Consider the following reaction: CH₂(g) + H₂O(g) = CO(g) + 3 H₂(g) AH = 231 kJ predict the equilibrium shift (R- right, L - left, N - no change) in the following situations: 1. The reactor is heated [Select ] V 2. H₂ is injected in the reactor [Select] 3. H₂O is injected in the reactor [Select] 4. Helium is added and total pressure increased [Select] 5. Catalyst is added [Select] 6. Reactor with a smaller volume is used [Select]

Consider the following reaction: CH₂(g) + H₂O(g) = CO(g) + 3 H₂(g) AH = 231 kJ predict the equilibrium shift (R- right, L - left, N - no change) in the following situations: 1. The reactor is heated [Select ] V 2. H₂ is injected in the reactor [Select] 3. H₂O is injected in the reactor [Select] 4. Helium is added and total pressure increased [Select] 5. Catalyst is added [Select] 6. Reactor with a smaller volume is used [Select]

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 69QRT

See similar textbooks

Similar questions

Consider the system A(g)+2B(g)+C(g)2D(g)at 25C. At zero time, only A, B, and C are present. The reaction reaches equilibrium 10 min after the reaction is initiated. Partial pressures of A, B, and D are written as PA, PB, and PD. Answer the questions below, using LT (for is less than), GT (for is greater than), EQ (for is equal to), or MI (for more information required). (a) PD at 11 min PD at 12 min. (b) PA at 5 min PA at 7 min. (c) K for the forward reaction K for the reverse reaction. (d) At equilibrium, K Q. (e) After the system is at equilibrium, more of gas B is added. After the system returns to equilibrium, K before the addition of B K after the addition of B. (f) The same reaction is initiated, this time with a catalyst K for the system without a catalyst the system with a catalyst. (g) K for the formation of one mole of D K for the formation of two moles of D. (h) The temperature of the system is increased to 35C. PB at equilibrium at 25C PB at equilibrium at 35C. (i) Ten more grams of C are added to the system. PB before the addition of C PB after the addition of C.
The following equilibrium is established in a closed container: C(s)+O2(g)CO2(g)H=393kJmol1 How does the equilibrium shift in response to each of the following stresses? (a) The quantity of solid carbon is increased. (b) A small quantity of water is added, and CO2 dissolves in it. (c) The system is cooled. (d) The volume of the container is increased.
The equilibrium constant for a certain reaction decreases from 8.84 to 3.25 102 when the temperature increases from 25C to 75C. Estimate the temperature where K = 1.00 for this reaction. Estimate the value of S for this reaction. (Hint: Manipulate the equation in Exercise 79.)
Consider the decomposition of CaCO3(s) into CaO(s) and Co2(g). What is the equilibrium partial pressure of CO2 at room temperature?
Monochloroethane (C2H5Cl) can be produced by the direct reaction of ethane gas (C2H6) with chlorine gas or by the reaction of ethylene gas (C2H4) with hydrogen chloride gas. The second reaction gives almost a 100% yield of pure C2H5Cl at a rapid rate without catalysis. The first method requires light as an energy source or the reaction would not occur. Yet G for the first reaction is considerably more negative than G for the second reaction. Explain how this can be so.
Consider the reaction H2(g)+Br2(g)2HBr(g) where H = 103.8 kJ/mol. In a particular experiment, equal moles of H2(g) at 1.00 atm and Br2(g) at 1.00 atm were mixed in a 1.00-L flask at 25C and allowed to reach equilibrium. Then the molecules of H2 at equilibrium were counted using a very sensitive technique, and 1.10 1013 molecules were found. For this reaction, calculate the values of K, G, and S.
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
a. Using the free energy profile for a simple one-step reaction, show that at equilibrium K = kf/kr, where kf and kr, are the rate constants for the forward and reverse reactions. Hint: Use the relationship G = RT ln(K) and represent kf and kr, using the Arrhenius equation.(K=AeEa/RT) b. Why is the following statement false? A catalyst can increase the rate of a forward reaction but not the rote of the reverse reaction.
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
Consider the reaction: A(g)+2B(g)+C(s)2D(g)At 25C, only A, B, and C are present. The partial pressures of A, B, and D are given as PA, PB, and PD. Equilibrium is established 18 minutes after the reaction starts. Use terms is less than (LT), is greater than (GT), is equal to (EQ), or insufficient information (X) to answer the following questions. (a) PD at 5 min PA. (b) PA at 21 min PA at 27 min. (c) PB at 7 min PB at 13 min.(d) After 20 min, more B is added. When equilibrium is reestablished, K before the addition K after the addition. (e) After 20 min, the temperature is increased to 35C. PA before the temperature increase PA after the temperature increase after equilibrium is reestablished.
Consider the equation G = G + RT ln(Q). What is the value of G for a reaction at equilibrium? What does Q equal at equilibrium? At equilibrium, the previous equation reduces to G = RT ln(K). When G 0, what does it indicate about K? When G 0, what does it indicate about K? When t G = 0, what does it indicate about K? G predicts spontaneity for a reaction, whereas G predicts the equilibrium position. Explain what this statement means. Under what conditions can you use G to determine the spontaneity of a reaction?
Organ pipes in unheated churches develop tin disease, in which white tin is converted to gray tin. Given white Sm: H f =0.00 kJ/mol; S =51.55 J/mol K gray Sn: H f =2.09 kJ/mol; S =44.14 J/mol K calculate the equilibrium temperature for the transition.