Consider the following reaction that takes place at 298 K 2 NO,(9) - N,0,(g) The values of AH and AS are -58.03 kJ and -176.6 JK, respectively. a. Find the value of AG at 298 K. b. Is the reaction spontaneous at 298 K? c. If AH and AS do not depend on the temperature, at what temperature is AG = 0?

Consider the following reaction that takes place at 298 K 2 NO,(9) - N,0,(g) The values of AH and AS are -58.03 kJ and -176.6 JK, respectively. a. Find the value of AG at 298 K. b. Is the reaction spontaneous at 298 K? c. If AH and AS do not depend on the temperature, at what temperature is AG = 0?

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter16: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 61E: Consider the reaction Fe2O3(s)+3H2(g)2Fe(s)+3H2O(g) a. Use Gf values in Appendix 4 to calculate G...

See similar textbooks

Related questions

Q: Consider the reaction below at constant pressure. Use the information provided to determine the…

A: If delta S surrounding is positive then reaction will be spontaneous.

Q: For a particular reaction, Δ?∘=20.1 kJ/mol and Δ?∘=45.9 J/(mol⋅K). Assuming these values change very…

Q: The following reaction is nonspontaneous at 25°C: Cu20(s) → 2Cu(s) + '/202(g), AG° = 141 kJ/mol If…

Q: Consider the reaction below at 25°C: 2 N205 (g) = 4NO2 (g) + O2 (g) AG° rxn =+1.65 kJ What is AG…

A: Since you have not specified which question to answer, we will answer first question for you.

Q: For the reaction 2 NH3(g) + 2 O2(g) → N20(g) + 3 H2O(1) AH° = -683.1 kJ and AS° = -0.3656 kJ/K kJ…

A: Recall the reaction 2NH3(g) + 2O2(g) ----> N2O(g) + 3H2O(l) Given ∆H°=-683.1 kJ and ∆S°=-0.3656…

Q: Consider the decomposition of gaseous N2O4: N2O4(g) → 2 NO2(g) ΔH° = +57.1 kJ/mol; ΔS° = +175.8…

A: The chemical equation : N2O4(g) ---> 2NO2(g) ∆H° = +57.1 KJ/mol ...or because 1KJ = 1000 J…

Q: A reaction is found to have a change in enthalpy of -8.67 kJ/mol and a change in entropy of 29.87…

Q: 1) Calculate ΔH0rxn , ΔS0rxn and ΔG0rxn for the formation of ammonia gas from nitrogen gas and…

A: Here we are required to Gibbs free energy for the given reaction .

Q: For the reaction: 2 NO2(g) ó N2O4(g)Kp = 8.85 at 25.00 oC. The standard state free energy change…

A: Given, Kp of the reaction is 8.85 Temperature, T = 25 oC = 298K Standard free energy, ∆Go= -5.40…

Q: Consider the reaction: 4 A (g) 2 B (s) + 3 C (g) + 20.5 kJ, at what ------ temperature(s) would you…

A: Gibbs free energy change is an extensive property as well as state function whose absolute value…

Q: 2. The enthalpy and entropy change of a reaction are -3.9 kJ/mole and +56.6 J/mole K respectively at…

A: Given data: The enthalpy change of reaction ΔH=-3.9 kJ/mol. The entropy change of reaction ΔS=+56.6…

Q: What is the ∆G° if ∆H° is +42.7 kJ and ∆S° is +88 J/K? (SHOW CALCULATIONS) b) Is it spontaneous?…

A: ∆H°=+42.7kJ =42.7 × 1000 = 42700joule ∆S°= +88J/K ∆G°=?

Q: 2) Consider the following information AH = -40.5 kJ; AS = 342.1 J/K 40°C A+B→C (a) Just by looking…

A: ΔG ΔH ΔS Spontaneous at all temperature - + Spontaneous at low temperature - -…

Q: For the following reaction, AH° for the reaction is -206.1 kJ/mol, while AS° is -215 J/K•mol . NO…

A: For the reaction to be spontaneous , we have to see the value of Gibbs free energy. ∆G = negative (…

Q: For the reaction C6H6 (1) + 3 H2 (g) C6H12 (1) AHO = -206.7 kJ/mol What statement is true? (Hint:…

A: A reaction would be spontaneous if ∆G (reaction) is negative.

Q: For the process, CO 2 (s) -> CO 2 (g), this process (and explain why) A. is always spontaneous B. is…

A: For any process to be spontaneous, the free energy change must be negative.delta G = delta H - T…

Q: 10. A reaction at 45 °C has the following enthalpy and entropy: AH° = -86.6 kJ and AS = 382J/K. a.…

A: ∆G°=∆H°-T∆S° If ∆G° = -ve, the reaction will be spontaneous. If ∆G° = +ve, the reaction will be…

Q: At what temperature/temperature range does this reaction become spontaneous? Explain your reason.…

A: Given, Br2(l)⇔br2(g)and△H=30.91kJ△s=0.0933kJ/Kwe know that ;△G=△H-T△Swhere, △G= Change in Gibb's…

Q: SBr4 (g) → S (g) + 2 Br2 (l) ΔGo = 77.75 kJ ΔSo = 125.2 J/K ΔHo = 115.4 kJ What would…

Q: Given the AH° and AS°, calculate the AG° values for the following reactions and indicate whether the…

Q: For the reaction of 2SO2(g) + O2(g) → 2SO3(g) having the following conditions: Temperature = 25°C AG…

A: Given: ∆H = -198.4 kJ ∆S = -187.8 JK

Q: If H=-180kJ/mol and S=45J/k, then the reaction will be… a) Spontaneous at all temperatures b)…

A: Reaction spontaneity ∆H ∆S reaction spontaneity + value - value non spontaneous at all…

Q: Is the following reaction spontaneous as written? Explain. Do whatever calculation is needed to…

Q: For the reaction C2H6 (g) → C2H4 (g) + H2 (g) ΔH° is +137 kJ/mol and ΔS° is +120 J/K ∙ mol. This…

A: Given, The balanced chemical equation, C2H6 (g) → C2H4 (g) + H2 (g) ΔH°=+137 kJ = 137000 J, and ΔS°…

Q: 1. From the data in the Appendix of Open Stax, calculate AH°, AS°, and AG° for the following…

A: For a given reaction , ∆H° , ∆S° and ∆G° can be calculated using standard formation values of each…

Q: Consider the following reaction; A(g) + B(s) - C(g) + D(g); AH = -164.1 kJ; AG = -170.1 kJ at 298 K…

A: The reaction taking place is given as, => A (g) + B (s) -----> C (g) + D (g) ΔHo =…

Q: Consider the reaction represented below, which is spontaneous at 298K SO2(g) + 2 NH3(g) → SO(NH2)2…

A: Those reaction which proceeds themselves in forward direction without any external support are known…

Q: Consider the following process (note the indication of temperature): Part A Which of the following…

A: Correct answer is spontaneous. For the given process H2O (l) -----> H2O (g) , Gibb's free…

Q: 57. For each reaction, calculate AHan, AS, and AGan at 25 °C and state whether or not the reaction…

A: Note - Since you have asked multiple questions (multiple reactions), we are supposed to solve only…

Q: Consider the reaction: 4 A (g) ------ 2 B (s) + 3 C (g) + 20.5 kJ, at what…

Q: 2. The enthalpy and entropy change of a reaction are -3.9 kJ/mole and +56.6 J/mole K respectively at…

A: The given data contains, Enthalpy change = -3.9 kj/mol. Entropy change = 56.6 J/mol.K = 0.0566…

Q: Consider the following reaction in which acetic acid decomposes to form methane and carbon dioxide:…

Q: 1. For the reaction C₂H6 (g) → C₂H4 (g) + H₂ (g) AH° is + 137 kJ/mol and AS° is + 120 J/K mol. Which…

Q: For the process O2(g) 2O(g), ΔH° = 498 kJ·mol –1. What would be the predicted sign of ΔS°rxn…

A: Given that :Reaction = O2(g) → 2O(g) ∆H° = 498kJ/mol

Q: Write equations for the oxidation of Fe and of Al. Use ΔG°(f) to determine whether either process…

A: Oxidation reaction is defined as the reaction in which a chemical specie loses electrons.…

Q: The following reaction is spontaneous at room temperature: N2(g) + 3H2(g) → 2NH3(g) For this…

Q: Consider the reaction at 298 K:2 H2S(g) + SO2(g)----->3 S(s, rhombic) + 2 H2O(g) ΔG°rxn = -102…

A: given: △G°rxn=-102KJT=298K R= 0.008314KJ/K/mol △Grxn=△G°rxn +RT lnQ --(i) now Reaction…

Q: Our atmosphere is composed primarily of nitrogen and oxygen, which coexist at 25 °C without reacting…

A: The relation between Gibbs free energy and equilibrium constant is shown below: ∆G0 = -RTln Kp…

Q: Consider the following reaction. Use the information here to determine the value of ΔSsurr at 355…

Q: For the reaction C2H6 (g) → C2H4 (g) + H2 (g), ∆Ho is + 137 kJ/mol and ∆So is 120J/mol.K. This…

A: The relation between entropy change, enthalpy change and free energy change can be shown from the…

Q: Briefly describe the Third Law of Thermodynamics. b) Consider the reaction 2X(g)+ O2(g)→3Y(g)…

A: Hello. Since your question has multiple sub-parts, we will solve the first three sub-parts for you.…

Q: Consider the decomposition of gaseous N2O4: N2O4(g) → 2 NO2(g) ΔH° = +57.1 kJ/mol; ΔS° = +175.8…

A: A reaction is said to be exothermic if energy is released in the form of heat and light during the…

Q: Calculate the Kc for the following reaction at room temperature, is it spontaneous? At what…

A: Recall the given reaction 2SO2g + O2g ↔ 2SO3gGiven that ∆Hrxno=-196 kJ…

Q: Consider

Q: Consider the following process: F2(l) ->F2(s) The process is spontaneous at --- temperatures when…

Q: 9. Consider the following reaction: N2O4 (g) → 2NO2 (g) a. Determine the AG° value for the reaction…

Q: From the following AH and AS values, predict whether the reaction would be spontaneous. If not, at…

Q: A reaction has values ΔS = 72.3 J K mol-1 and ΔH = 47.0 kJ mol-1. At what temperature (in °C) will…

A: Solution: We know ΔG=ΔH−TΔS if ΔG<0, process is spontaneous if ΔG>0, process is non…

Q: 9. For the following reaction at 298 K, AS = -308.2 J/K and AH = -192.7 kJ: 4NO(g) N₂O(g) + N₂O₂(g)…

A: Given reaction is 4NO(g) → NO(g) + N₂O3(g) For this reaction at 298 K , ΔS= -308.2 J/K and = -0.3082…

Q: For the process O2(g) 2O(g), ΔH° = 498 kJ·mol –1. What would be the predicted sign of ΔS°rxn…

Question

Consider the following reaction that takes place at 298 K
2 NO,(g) – N,0,(9)
The values of AH and AS' are -58.03 kJ and -176.6 J/K, respectively.
a. Find the value of AG' at 298 K.
b. Is the reaction spontaneous at 298 K?
c. If AH and AS do not depend on the temperature, at what temperature is AG = 0?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step by step

Solved in 4 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
At 298 K, G = 70.52 kJ for the reaction 2NO(g) + O2(g) 2NO2(g) (a) Calculate _G at the same temperature when PNO = 1.0 104 atm, PO2=2.0103 atm, and PNO2=0.30 atm. (b) Under the conditions in part a, in which direction is the reaction spontaneous?
What is the standard free energy change, G, for a reaction? What is the standard free energy of formation, Gf for a substance? How are Gf values used to calculate Grxn? How can you use Hesss law to calculate Grxn? How can you use H and S values to calculate Grxn? Of the functions H, S, and G, which depends most strongly on temperature? When G is calculated at temperatures other than 25Cwhat assumptions are generally made concerning H and S?
Methane can be produced from CO and H2.The process might be done in two steps, as shown below, with each step carried out in a separate reaction vessel within the production plant. Reaction 1 CO(g)+2H2(g)CH3OH(l) S = -532 J/K Reaction 2 CH3OH(l)CH4(g)+12O2(g) S= +162 J/K NOTE: You should be able to work this problem without using any additional tabulated data. (a) Calculate H for reaction 1. (b) Calculate Gf for CO(g). (c) Calculate S° for O2(g). (d) At what temperatures is reaction 1 spontaneous? (e) Suggest a reason why these two steps would need to be carried out separately. Substance Hf (kJ mol-1) Gf (kJ mol-1) S (J mol-1 K-1) CO(s) -110.5 197.674 CH3OH( l ) -238.7 -166.4 126.8 CH4(g) -74.8 186.2
On the basis of your experience, predict which reactions are spontaneous: (a) PbO2(s)Pb(s)+O2(g)(b) N2(l)N2(g) at 25C (c) C6H12O6(s)C6H12O6(l) at 25C (d) Ca2+(aq)+CO32(aq)CaCO3(s)
Consider the reaction: H2S(g)+SO2(g)3S(g)+2H2O(l) for which H is 233 kJ and S is 424 J/K. a. Calculate the free energy change for the reaction (G) at 393 K. b. Assuming H and S do not depend on temperature, at what temperatures is this reaction spontaneous?
The decomposition of diamond to graphite [C(diamond) C(graphite)] is thermodynamically favored, but occurs slowly at room temperature. a. Use fG values from Appendix L to calculate rG and Keq for the reaction under standard conditions and 298.15 K. b. Use fH and S values from Appendix L to estimate rG and Keq for the reaction at 1000 K. Assume that enthalpy and entropy values are valid at these temperatures. Does heating shift the equilibrium toward the formation of diamond or graphite? c. Why is the formation of diamond favored at high pressures? d. The phase diagram shows that diamond is thermodynamically favored over graphite at 20,000 atmospheres pressure (about 2 GPa) at room temperature. Why is this conversion actually done at much higher temperatures and pressures?
Consider the reaction N2O2(g) 2NO2(g) where PNO2=0.29 atm and PN2O4=1.6. For this reaction at these conditions. G = 1000 J and G = 6000 J. Which of the following statements about this reaction is(are) true? a. The reverse reaction is spontaneous at these conditions. b. At equilibrium. PN2O4 will be greater than 1.6 atm. c. The value of K for this reaction is greater than 1. d. The maximum amount of work this reaction can produce at these conditions is 6000 J. e. The reaction is endothermic.
Consider the reaction Fe2O3(s)+3H2(g)2Fe(s)+3H2O(g) a. Use Gf values in Appendix 4 to calculate G for this reaction. b. Is this reaction spontaneous under standard conditions at 298 K? c. The value of H for this reaction is 100. kJ. At what temperatures is this reaction spontaneous at standard conditions? Assume that H and S do not depend on temperature.
On the basis of your experience, predict which of the following reactions are spontaneous. (a) CO2(s)CO2(g) at 25C (b) NaCl(s)NaCl(l) at 25C (c) 2NaCl(s)2Na(s)+Cl2(g)(d) CO2(g)C(s)+O2(g)
Thermite reactions have been used for welding metal parts such as railway rails and in metal refining. One such thermite reaction is Fe2O3(s)+2Al(s)Al2O3(s)+2Fe(s). Is the reaction spontaneous at room temperature under standard conditions? During the reaction, the surroundings absorb 851.8 kJ/mol of heat.
Use the standard free energy data in Appendix G to determine the free energy change for each of the following reactions, which are run under standard state conditions and 25 C. Identify each as either spontaneous or nonspontaneous at these conditions. (a) C(s,graphite)+O2(g)CO2(g) (b) O2(g)+N2(g)2NO(g) (c) 2Cu(s)+S(g)Cu2S(s) (d) CaO(s)+H2O(l)Ca(OH)2(s) (e) Fe2O3(g)+3CO(g)2Fe(s)+3CO2(g) (f) CaSO42H2O(s)CaSO4(s)+2H2O(g)