Consider the following reaction where Ke = 1.29x10-2 at 600 K: COCI₂ (9)CO (g) + Cl₂ (g) A reaction mixture was found to contain 0.105 moles of COCl₂ (g), 4.46x10-2 moles of CO (g), and 4.00×10-² moles of Cl₂ (g), In a 1.00 liter container. Indicate True (T) or False (F) for each of the following: T1. In order to reach equilibrium CoCl₂(g) must be consumed. F2. In order to reach equilibrium Ke must increase. TV3. In order to reach equilibrium CO must be consumed. TV 4. Qe is less than Ke. F 5. The reaction is at equilibrium. No further reaction will occur.

Consider the following reaction where Ke = 1.29x10-2 at 600 K: COCI₂ (9)CO (g) + Cl₂ (g) A reaction mixture was found to contain 0.105 moles of COCl₂ (g), 4.46x10-2 moles of CO (g), and 4.00×10-² moles of Cl₂ (g), In a 1.00 liter container. Indicate True (T) or False (F) for each of the following: T1. In order to reach equilibrium CoCl₂(g) must be consumed. F2. In order to reach equilibrium Ke must increase. TV3. In order to reach equilibrium CO must be consumed. TV 4. Qe is less than Ke. F 5. The reaction is at equilibrium. No further reaction will occur.

Chemistry & Chemical Reactivity

9th Edition

ISBN:9781133949640

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter18: Principles Of Chemical Reactivity: Entropy And Free Energy

Section18.4: Entropy Measurement And Values

Problem 3RC: Calculate rS for the following reaction at 25 C. 2 H2(g) + O2(g) 2 H2O() (a) 326.6 J/K mol-rxn...

See similar textbooks

Similar questions

Consider the reaction CO32-(aq) + H2O(l) HCO3-(aq) + OH–(aq). Kb for CO32- is 2.1 × 10–4 at 25°C. What is Ka for the HCO3- ion at 25°C?
Find ΔH for the reaction C3H8 (l) + 5O2(g) --> 3CO2(g) + 4H2O(l) ΔHrxn = ? Given: [CO2(g)] = -393.5 kJ/mol, [H2O(l)] = -285.8 kJ/mol, [C3H8(l)] = -103.8 kJ/mol) (Your answer is in kJ and has one digit after the decimal. Enter only the number)
What is the ΔS° for the reaction? Given are the S°, in J K-1 mol-1, of each substance in parentheses. SiCl4 (g, 330.73) + 2 Mg (s, 32.68) → 2 MgCl2 (s, 89.62) + Si (s, 18.83) -198.02 J/K 254.96 J/K 198.02 J/K -254.96 J/K
The reaction CO2(g) + H2O(l) ⇔ H+(aq) + HCO3-(aq) has ΔH° = -12.65 kJ mol-1 and ΔS° = -192.5 J mol-1 K-1. This is actually a coupled reaction. The first step is CO2(g) + H2O(l) ⇔ H2CO3(aq), with ΔH° = -20.35 kJ mol-1 and ΔS° = -96.3 J mol-1 K-1. The second step is H2CO3(aq) ⇔ H+(aq) + HCO3-(aq). Calculate ΔG° (in kJ mol-1) for the second reaction at 25.0 °C.
The value of KC for the thermal decomposition of hydrogen sulfide, shown below, is 2.2 × 10-4 at 1400 K. 2H2S(g)⇌2H2(g)+S2(g) A sample of gas in which [H2S] = 3.45 M is heated to 1400 K in a sealed vessel. After chemical equilibrium has been achieved, what is the value of [H2S]? Assume no H2 or S2 was present in the original sample.
XY ↔ X + Y Kc = 1.1 x 10-1 at 125C ΔH = -24.5 kJ/mol rxn. b. A catalyst is added to the reaction. a.How will the concentrations of the reactants and products at equilibrium change? Explain your reasoning.b. How will the addition of a catalyst affect the enthalpy of the reaction? Explain your reasoning. c.The temperature of the reaction is decreased from 125 oC to 25 oC. In the boxes like the ones shown here, draw a possible new molecular diagram to represent any changes that would occur in concentrations. d. Will the equilibrium constant value increase, decrease, or remain the same when the temperature is decreased? Explain your reasoning. e. How will lowering the temperature affect the enthalpy of the reaction? Explain your reasoning.
The value of Kc for the reaction of acetic acid with ethanol is 3.4 at 25∘C: CH3CO2H(soln)+ C2H5OH(soln)⇌ CH3CO2C2H5(soln)+H2O(soln) Kc=3.4 a) How many moles of ethyl acetate are present in an equilibrium mixture that contains 3.6 mol of acetic acid, 5.9 mol of ethanol, and 11.6 mol of water at 25 ∘C? b) Calculate the number of moles of all reactants and products in an equilibrium mixture prepared by mixing 1.00 mol of acetic acid and 10.00 mol of ethanol.Express your answer using one significant figure. 1) nCH3CO2H 2) nC2H5OH 3) nCH3CO2C2H5 4) nH2O
At 25oC, Ksp for copper(I) chloride (CuCl) is 1.0 x 10-6. Calculate ΔΔGo (kJ/mol) for the reaction: CuCl(s) ⇆ Cu+(aq) + Cl-(aq) Select one: a. 34.2 kJ/mol b. 3.42 x 104 kJ/mol c. -3.42 x 104 kJ/mol d. -34.2 kJ/mol
Calculate Hrxn for the reaction below. CO(g) + NO(g) CO2(g) +1/2 N2(g) You are given the following set of reactions. CO(g) + 1/2 O2(g) CO2(g) H = -283.0 kJN2(g) + O2(g) 2 NO(g) H = 180.6 kJ
2. Calculate Kc for each reaction. a. I2(g)⇌2I(g)Kp=6.26×10−22I2(g)⇌2I(g) Kp=6.26×10−22 (at 298 KK)Express your answer to three significant figures. b. CH4(g)+H2O(g)⇌CO(g)+3H2(g) Kp=7.7×1024CH4(g)+H2O(g)⇌CO(g)+3H2(g)Kp=7.7×1024 (at 298 KK)Express your answer to two significant figures c. N2(g)+O2(g)⇌2NO(g) Kp=4.10×10−31N2(g)+O2(g)⇌2NO(g)Kp=4.10×10−31 (at 298 KK)Express your answer to three significant figures.
At room temperature when HI (aq) is added to potassium bisulfite, KHSO3(s), sulfur dioxide is formed and the reaction vessel becomes cold. HI (aq) + KHSO3(s)→ SO2(g) + H2O(l) + K+(aq) + I-(aq). Fill in the blank: A.) If the temp of the reaction vessel is increased then Kfwd will... (decrease, stay the same, increase, or need more info). B.) If the temp of the reaction vessel is increased then forward reaction rate will... (decrease, stay the same, increase, or need more info).
11. What is the slope of an Arrhenius plot for the following reaction? 2NOC12NO + Cl₂ 18 M 28 CO] [C] Temperature (K) 400. wing prop 500. 600. 8.18 × 10-2 K 5.06 × 10-2 K -1.22 x 104 K -1.96 x 104 K k (L/mol's) 6.6 x 10-4 2.9 x 10-1 16.3 A. B. C. D. E. not enough information to calculate the slope